The chemical equation for the neutralization reaction in the third year of junior high school

Updated on educate 2024-02-29
17 answers
  1. Anonymous users2024-02-06

    1. Hydrochloric acid and sodium hydroxide solution reaction: HCl + NaOH = NaCl + H2O

    2. Hydrochloric acid and calcium hydroxide solution reaction: 2HCl + Ca(OH)2 = CaCl2 + 2H2O

    3. Reaction of sulfuric acid and sodium hydroxide solution: H2SO4 + 2NaOH = Na2SO4 + 2H2O

    4. Aluminum hydroxide drug ** hyperacidity: 3HCl + Al(OH)3 = ALCL3 + 3H2O

    5. Reaction of sulfuric acid and calcium hydroxide: H2SO4 + Ca(OH)2 = CaSO4 + 2H2O

    6. Hydrochloric acid and potassium hydroxide reaction: HCl + KOH = KCl + H2O

  2. Anonymous users2024-02-05

    The reactions of acids and bases are both neutralizing reactions.

    Example: hydrochloric acid and sodium hydroxide solution reaction: HCl + NaOH = NaCl + H2O

    Sulfuric acid and sodium hydroxide solution reaction: H2SO4 + 2NaOH = Na2SO4 + 2H2O

  3. Anonymous users2024-02-04

    The reaction of hydrochloric acid and sodium hydroxide solution is the neutralization reaction HCl+Naoh=NaCl+H2O

  4. Anonymous users2024-02-03

    The textbook is the reaction of hydrochloric acid and sodium hydroxide solution: HCl + NaOH = NaCl + H2O

  5. Anonymous users2024-02-02

    Hydrochloric acid and sodium hydroxide solution reaction: HCl + NaOH = NaCl + H2O

  6. Anonymous users2024-02-01

    h++oh-——h2o

    This is the essence of the "neutralizing part" of all neutralization reactions.

  7. Anonymous users2024-01-31

    There must be water in the acid-base reaction, and the remaining components are put together in a pair.

  8. Anonymous users2024-01-30

    The neutralization equation is the reaction of an acid and a base to produce water.

  9. Anonymous users2024-01-29

    Neutralization Reaction The reaction in which an acid and a base react to produce water and salt.

  10. Anonymous users2024-01-28

    A special case of metathesis reactions.

  11. Anonymous users2024-01-27

    The neutralization reaction is the reaction of acid and alkali, and it was searched out at the last time.

  12. Anonymous users2024-01-26

    NaOH+HCl==NaCl+H2O sodium hydroxide can be neutralized with hydrochloric acid to generate sodium chloride and water, and the reaction is exothermic. Ba(OH)2+2HCl==BACl2+2H2O The neutralization reaction of barium hydroxide and hydrochloric acid is carried out to form barium chloride and water. Fe(OH)3+3HCl==FeCl3+3H2O Ferric(III) hydroxide is insoluble in water, but can also neutralize with hydrochloric acid to form ferric chloride and water.

    KOH+HI==Ki+H2O Potassium hydroxide and hydroiodic acid undergo a neutralization reaction to generate potassium iodide and water. Cu(OH)2+H2SO4==CuSO4+2H2O Copper hydroxide and sulfuric acid undergo a neutralization reaction to form copper sulfate and water. It can be seen that the reaction between acid and alkali to produce salt and water is a neutralization reaction.

    The neutralization reaction is a metathesis reaction. However, what happens between an acid and a base is not necessarily a neutralization reaction, for example: 2CO(OH)3+6HCl==2COCl2+Cl2 +6H2O Cobalt(III) hydroxide and hydrochloric acid undergo a redox reaction to produce cobalt(II) chloride), chlorine gas and water, the reaction is exothermic, and the solution turns pink.

    2Ni(OH)3+6HCl==2nicL2+Cl2 +6H2O Nickel(III) hydroxide and hydrochloric acid undergo redox reaction to generate nickel chloride(II), chlorine gas and water, the reaction is exothermic, and the solution turns turquoise. Because trivalent cobalt and nickel are oxidizing and can oxidize hydrochloric acid to produce chlorine gas, this kind of reaction is not a neutralization reaction. Similarly, the reaction of ferrous hydroxide and nitric acid is not a neutralization reaction.

  13. Anonymous users2024-01-25

    Hydrogen ions and hydroxide ions are neutralized to form water

  14. Anonymous users2024-01-24

    It is a reaction in which a mold of H ions and a mold of oh ions react to form a mold of water.

  15. Anonymous users2024-01-23

    The friends on the second floor summarized it very well, but we have to grasp the laws of chemical equations to learn them when we study, so that we can get twice the result with half the effort.

  16. Anonymous users2024-01-22

    There are a lot of them on the Internet.

  17. Anonymous users2024-01-21

    naoh+hcl==nacl+h2o

    Sodium hydroxide can be neutralized with hydrochloric acid to produce sodium chloride and water, and the reaction is exothermic.

    ba(oh)2+2hcl==bacl2+2h2o

    The neutralization reaction of barium hydroxide and hydrochloric acid undergoes to produce barium chloride and water.

    fe(oh)3+3hcl==fecl3+3h2o

    Iron(III) hydroxide is insoluble in water, but can also neutralize with hydrochloric acid to form ferric chloride and water.

    koh+hi==ki+h2o

    Potassium hydroxide and hydroiodic acid undergo a neutralization reaction to produce potassium iodide and water.

    cu(oh)2+h2so4==cuso4+2h2o

    Copper hydroxide and thisonant acid are neutralized to form copper sulphate and water.

    It can be seen that the reaction between acid and alkali to produce salt field mill and water is a neutralization reaction. The neutralization reaction is a metathesis reaction. However, what happens between an acid and a base is not necessarily a neutralizing reaction, for example:

    2co(oh)3+6hcl==2cocl2+cl2↑+6h2o

    Cobalt(III) hydroxide and hydrochloric acid undergo a redox reaction to form cobalt(II) chloride, chlorine gas, and water, and the reaction is exothermic and the solution turns pink.

    2ni(oh)3+6hcl==2nicl2+cl2↑+6h2o

    Nickel hydroxide (III) and hydrochloric acid undergo a redox reaction to produce nickel chloride(II), chlorine gas and water, the reaction is exothermic, and the solution turns turquoise.

    Because trivalent cobalt and nickel are oxidizing and can oxidize hydrochloric acid to form macrochlorine-resistant gas, this kind of reaction does not belong to neutralization reaction. Similarly, the reaction of ferrous hydroxide and nitric acid is not a neutralization reaction.

Related questions
9 answers2024-02-29

The chemical equation for the reaction of brass with dilute hydrochloric acid to form hydrogen gas: Zn + 2HCl = H2 + ZNCL2 >>>More

13 answers2024-02-29

Equation. It can only react with dilute nitric acid, not concentrated nitric acid). >>>More

10 answers2024-02-29

Chemical equation.

It is a formula in which the equation is equal to the left (or arrow) of each reactant and the right is the chemical formula of each product. For example, hydrogen and oxygen react to produce water >>>More

10 answers2024-02-29

The first is the substitution of salt solutions, as long as one metal is found to be more active than another, for example: >>>More

10 answers2024-02-29

1.Aluminum and hydrochloric acid: 2al+6HCl=2alCl3+3H2 gas. >>>More