The chemical equation for the neutralization reaction in the third year of junior high school

1. Hydrochloric acid and sodium hydroxide solution reaction: HCl + NaOH = NaCl + H2O

2. Hydrochloric acid and calcium hydroxide solution reaction: 2HCl + Ca(OH)2 = CaCl2 + 2H2O

3. Reaction of sulfuric acid and sodium hydroxide solution: H2SO4 + 2NaOH = Na2SO4 + 2H2O

4. Aluminum hydroxide drug ** hyperacidity: 3HCl + Al(OH)3 = ALCL3 + 3H2O

5. Reaction of sulfuric acid and calcium hydroxide: H2SO4 + Ca(OH)2 = CaSO4 + 2H2O

6. Hydrochloric acid and potassium hydroxide reaction: HCl + KOH = KCl + H2O

The reactions of acids and bases are both neutralizing reactions.

Example: hydrochloric acid and sodium hydroxide solution reaction: HCl + NaOH = NaCl + H2O

Sulfuric acid and sodium hydroxide solution reaction: H2SO4 + 2NaOH = Na2SO4 + 2H2O

The reaction of hydrochloric acid and sodium hydroxide solution is the neutralization reaction HCl+Naoh=NaCl+H2O

The textbook is the reaction of hydrochloric acid and sodium hydroxide solution: HCl + NaOH = NaCl + H2O

Hydrochloric acid and sodium hydroxide solution reaction: HCl + NaOH = NaCl + H2O

h++oh-——h2o

This is the essence of the "neutralizing part" of all neutralization reactions.

There must be water in the acid-base reaction, and the remaining components are put together in a pair.

The neutralization equation is the reaction of an acid and a base to produce water.

Neutralization Reaction The reaction in which an acid and a base react to produce water and salt.

A special case of metathesis reactions.

The neutralization reaction is the reaction of acid and alkali, and it was searched out at the last time.

NaOH+HCl==NaCl+H2O sodium hydroxide can be neutralized with hydrochloric acid to generate sodium chloride and water, and the reaction is exothermic. Ba(OH)2+2HCl==BACl2+2H2O The neutralization reaction of barium hydroxide and hydrochloric acid is carried out to form barium chloride and water. Fe(OH)3+3HCl==FeCl3+3H2O Ferric(III) hydroxide is insoluble in water, but can also neutralize with hydrochloric acid to form ferric chloride and water.

KOH+HI==Ki+H2O Potassium hydroxide and hydroiodic acid undergo a neutralization reaction to generate potassium iodide and water. Cu(OH)2+H2SO4==CuSO4+2H2O Copper hydroxide and sulfuric acid undergo a neutralization reaction to form copper sulfate and water. It can be seen that the reaction between acid and alkali to produce salt and water is a neutralization reaction.

The neutralization reaction is a metathesis reaction. However, what happens between an acid and a base is not necessarily a neutralization reaction, for example: 2CO(OH)3+6HCl==2COCl2+Cl2 +6H2O Cobalt(III) hydroxide and hydrochloric acid undergo a redox reaction to produce cobalt(II) chloride), chlorine gas and water, the reaction is exothermic, and the solution turns pink.

2Ni(OH)3+6HCl==2nicL2+Cl2 +6H2O Nickel(III) hydroxide and hydrochloric acid undergo redox reaction to generate nickel chloride(II), chlorine gas and water, the reaction is exothermic, and the solution turns turquoise. Because trivalent cobalt and nickel are oxidizing and can oxidize hydrochloric acid to produce chlorine gas, this kind of reaction is not a neutralization reaction. Similarly, the reaction of ferrous hydroxide and nitric acid is not a neutralization reaction.

Hydrogen ions and hydroxide ions are neutralized to form water

It is a reaction in which a mold of H ions and a mold of oh ions react to form a mold of water.

The friends on the second floor summarized it very well, but we have to grasp the laws of chemical equations to learn them when we study, so that we can get twice the result with half the effort.

There are a lot of them on the Internet.

naoh+hcl==nacl+h2o

Sodium hydroxide can be neutralized with hydrochloric acid to produce sodium chloride and water, and the reaction is exothermic.

ba(oh)2+2hcl==bacl2+2h2o

The neutralization reaction of barium hydroxide and hydrochloric acid undergoes to produce barium chloride and water.

fe(oh)3+3hcl==fecl3+3h2o

Iron(III) hydroxide is insoluble in water, but can also neutralize with hydrochloric acid to form ferric chloride and water.

koh+hi==ki+h2o

Potassium hydroxide and hydroiodic acid undergo a neutralization reaction to produce potassium iodide and water.

cu(oh)2+h2so4==cuso4+2h2o

Copper hydroxide and thisonant acid are neutralized to form copper sulphate and water.

It can be seen that the reaction between acid and alkali to produce salt field mill and water is a neutralization reaction. The neutralization reaction is a metathesis reaction. However, what happens between an acid and a base is not necessarily a neutralizing reaction, for example:

2co(oh)3+6hcl==2cocl2+cl2↑+6h2o

Cobalt(III) hydroxide and hydrochloric acid undergo a redox reaction to form cobalt(II) chloride, chlorine gas, and water, and the reaction is exothermic and the solution turns pink.

2ni(oh)3+6hcl==2nicl2+cl2↑+6h2o

Nickel hydroxide (III) and hydrochloric acid undergo a redox reaction to produce nickel chloride(II), chlorine gas and water, the reaction is exothermic, and the solution turns turquoise.

Because trivalent cobalt and nickel are oxidizing and can oxidize hydrochloric acid to form macrochlorine-resistant gas, this kind of reaction does not belong to neutralization reaction. Similarly, the reaction of ferrous hydroxide and nitric acid is not a neutralization reaction.