In chemistry, what is the difference between acids and bases?

Acid is a cation composed of hydrogen ions, and anions are acid radicals.

1.It reacts with alkali to produce salt and water.

2.Reacts with salts to form new acids and new salts (only with weakened salts)3It reacts with alkaline oxides to produce the corresponding salts and water.

4.It can react with acid-base indicators and turn red with purple litmus.

5.Reflecting with some metals (metal activity before h), the composition of salts and hydrogen-6 acids is mainly non-metallic elements.

The universality of bases: the cation consists of a metal (or ammonium), and the anion is hydroxide.

1.Reacts with all acids.

2.It reacts with some acidic oxides to generate the corresponding salts and water3Reacting with acid-base indicator, it turns red in case of phenolphthalein and blue in case of purple litmus4React with the salt to generate new alkali and new salt.

5. Alkali is mainly the metal element of the main group and most of the elements of the secondary group. (Special cases of aluminum and zinc, this is not a junior high school in some places, and it doesn't hurt to know).

Universality of salts: The cation consists of a metal (or ammonium) and an anion is an acid.

1.with acid 2. with alkali.

3.Reacts with salt to generate 2 new salts.

The above three must generate precipitated water, gases and other substances with low solubility), which is essentially a decrease in ion concentration.

4.Displacement reaction with reactive metals (except ammonia salts).

The hands of the beaters are numb, and I don't know if I understand it. This is the chemical properties of all acids and alkalis to be learned in middle school.

Need your score, I'm good at chemistry.

Acids: Ionization produces compounds in which cations are all hydrogen ions.

With the indicator, it is purple litmus that turns red, and the colorless phenolphthalein does not change color.

with lively metal.

2) Substitution reaction with active metal acid + metal == salt + hydrogen 2HCl Fe=FeCl2 H2

3) Reaction with basic oxides Acid + basic oxide salt + water 3H2SO4 + Fe2O3=Fe2(SO4)3 3H2O4) Reaction with some salts Acid + salt New acid + new salt H2SO4 BaCl2=2HCl BaSO4 5) Neutralization reaction with alkali Acid + alkali Salt + water 2HCl Cu(OH)2=CuCl2 2H2O alkali ionization produces anions that are all compounds of hydroxide ions.

1. Alkali + non-metallic oxide salt + water.

Example: Ca(OH)2 + CO2 ====CaCO3 + H2O2, soluble base + soluble salt neoalkali + new salt.

Example: Ca(OH)2+Na2CO3====2NaOH+CaCO3 3, the reaction of acid and alkali (neutralization reaction): acid + alkali salt + water.

For example, NaOH+HCl====NaCl+H2O turns purple litmus blue and colorless phenolphthalein red.

The product of the neutralization of hydrochloric acid and alkali (neutralization reaction), which is composed of metal ions (including ammonium ions) and acid ions.

1. Acid + metal oxide salt + water.

Example: Fe2O3 + 6HCl = = = = 2FeCl3 + 3H2O2, acid + salt New acid + new salt.

Example: CaCO3+2HCl====CaCl2+(H2CO3)====CaCl2+H2O+CO2

3. Acid + metal salt with strong activity + hydrogen.

Example: Fe+2HCl====FeCl2+H2

The definitions and divisions of acids, alkalis, and salts are different in junior high school, high school, and university, and the division of research methods according to different scholars in different eras, so this is a major topic that is still developing.

Acids and bases and salts are defined as:1. Acid: A compound that is composed of all hydrogen ions (H+) generated during ionization is called an acid, or a substance that dissolves in water and can release protons to form H3O+ (hydronium ions) is also an acid.

2. Alkali: In the theory of acid-base ionization, alkali refers to the compound that ionizes anions ionized in aqueous solution, all of which are oh-; In acid-base proton theory, a base refers to a compound that can accept protons; In acid-base electron theory, a base refers to an electron donor.

3. Salt: In chemistry, salt refers to a class of metal ions or ammonium ions (NH) combined with acid ions of compounds, such as calcium sulfate, copper chloride, sodium acetate, generally speaking, salt is the product of metathesis reaction, such as sulfuric acid and sodium hydroxide to produce sodium sulfate and water, there are also other reactions to generate salt, such as displacement reaction.

The method of distinguishing acid-base salts: the compound with all cations H+ is an acid, the compound with an all-oh- anion is a base, and the compound composed of metal ions and acid ions is a salt.

Acids: Acids are also acids in compounds that produce all cations (H+) when ionized, or substances that dissolve in water and release protons to form H3O+ (hydronium ions). Such as hydrochloric acid, sulfuric acid, carbonic acid, nitric acid, etc.

Alkali: The anions ionized in an aqueous solution are all oh- substances, which are bases. Such as lithium hydroxide, sodium hydroxide, rubidium hydroxide, cesium hydroxide, francium hydroxide, etc.

Salts: Compounds in which metal ions or ammonium ions (NH4+) are combined with acid ions or non-metal ions are salts. Such as sodium chloride, calcium nitrate, ferrous sulfate and ammonium acetate, calcium sulfate, copper chloride, sodium acetate, etc.

Most acids are soluble, and silicic acid is slightly soluble.

Alkali potassium sodium barium ammonium soluble, calcium is slightly soluble and insoluble.

Lead barium sulfate is immersed in water, slightly soluble calcium, silver and mercury.

The salts are dissolved with potassium, sodium ammonium, plus soluble nitrate.

Carbonic acid can dissolve potassium and sodium ammonium, and the rest is submerged in the middle.

Hydrochloric acid precipitates silver mercurous, as well as slightly soluble lead chloride.

Acid: Chemically refers to a compound that is completely hydrogen when ionized in solution and can turn purple litmus solution red. In a narrow sense, it can also be divided into inorganic acids and organic acids.

The acid-base proton theory holds that acid is a substance that can release protons, which is collectively called acid. Alkali:

All anions are compounds of hydroxide ions (OH-) on ionization. (Some salt solutions also have a pH value greater than 7, but it is not a base, such as: soda ash (sodium carbonate) Na2CO3, baking soda (sodium bicarbonate) NaHCO3, etc.)

Salts: Chemically speaking, salts in the broad sense are neutral (uncharged) ionic compounds composed of metal cations (positively charged ions) and acid anions (negatively charged ions),10