How calcium carbonate and calcium bicarbonate are converted 5

The chemical equation between calcium carbonate and calcium bicarbonate which is the conversion is:

1.Calcium carbonate to calcium bicarbonate.

caco3 + h2o +co2 = ca(hco3)2;

2.Calcium bicarbonate to calcium carbonate.

ca(hco3)2 +

2NaOH = CaCO3 +NaCO3 +H2O It seems that the chemical reaction is generally insoluble to more insoluble, but in essence this is not the case.

If there are two chemical equilibrium in the same system, and one ion participates in both chemical equilibrium, the reaction moves in the direction of decreasing concentration of that ion until equilibrium is reached.

In the above reaction, there are multiple equilibriums:

CO3+H=HCO3 (the charge of the ions is not hit, because there is no way to mark the upper and lower corners).

co3+ca=caco3

So will bicarbonate or calcium carbonate be formed? It depends on the concentration of hydrogen ions and calcium ions, and if the concentration of hydrogen ions remains the same, bicarbonate is formed if the concentration of hydrogen ions is large enough. If the concentration of hydrogen ions is too small, calcium carbonate is formed.

In other words, if you add acid to calcium carbonate (a small amount, if you have more, it will become carbon dioxide), it will become calcium bicarbonate, and if you add alkali to calcium bicarbonate, it will become calcium carbonate, and no matter what it becomes, the concentration of carbonate will be reduced.

Dicalcium carbonate will be decomposed into calcium carbonate and carbon dioxide, and the two will be converted to each other, in natural water, when the pH value is between 6 9, the proportion of calcium carbonate will account for more than 90% of all carbonates, but when the pH value exceeds 9, the proportion of calcium carbonate will rise in a straight line.

Calcium carbonate is converted into calcium bicarbonate by mixing it with water and then introducing carbon dioxide.

1 calcium carbonate to calcium bicarbonate.

caco3 + h2o +co2 = ca(hco3)2;

2 calcium bicarbonate to calcium carbonate.

ca(hco3)2 + 2naoh = caco3↓ +naco3 +h2o

1. Reacting with carbon dioxide, Ca(OH) is disturbed early 2+CO2=CaCO3+H2O, and the white powder becomes a white lumpy.

2. Reaction with sodium carbonate, Ca(OH)2+Na2CO3=CaCO3+2NaOH.

3. Calcium oxide becomes calcium hydroxide: CaO+H2O=Ca(OH)2.

4. Calcium hydroxide becomes calcium carbonate: Ca(OH)2+CO2=CaCO3 +H2O.

5. Calcium carbonate becomes calcium chloride: CaCO3 + 2HCl = CaCl2 + H2O + CO2.

6. Calcium hydroxide becomes calcium chloride: Ca(OH)2+2HCl=CaCl2+H2O.

1. Calcium carbonate answered the carbon circle, and the calcium dicalcium acid was judged.

caco3 + h2o +co2 = ca(hco3)2;

2 calcium bicarbonate to calcium carbonate.

ca(hco3)2 + 2naoh = caco3↓ +naco3 +h2o

The method of converting carbonic acid into calcium carbonate is to add calcium oxide or calcium hydroxide, and calcium carbonate can be obtained by using strong acid to make weak acid, calcium carbonate is an inorganic compound with the chemical formula Caco, which is basically insoluble in water, but soluble in hydrochloric acid.

According to the different production methods of calcium carbonate, calcium carbonate can be divided into heavy carbonate calcium carbonate, light calcium carbonate, colloidal calcium carbonate and crystalline calcium carbonate. Light calcium carbonate is widely used in the production of organic synthesis, metallurgy, glass and asbestos. It can also be used as a raw material for tooth powder, toothpaste and other cosmetics.

CaCO3+CO2+H2O===Ca(HCO3)2 is nothing too much.

Either calcium hydroxide and CO2 are overdosed.

First CO2 + CA(OH)2 CAC3 + H2O then CAC3+CO2+H2O CA(HCO3)2,4, how to ?!? He is so responsive to the forces of nature as if it were a formula You say why, 2, carbon dioxide dissolved in water is first acidic, which has H+ ions, H+ can react with calcium carbonate, here CO2 reacts with calcium hydroxide, carbon dioxide overdose produces calcium bicarbonate, not too much calcium carbonate is generated, calcium carbonate and excess carbon dioxide reaction is also to produce calcium bicarbonate, 2, you think, if it is excess carbon dioxide, then dissolved in solution is equivalent to more carbonic acid, if there is excess carbonic acid, Calcium bicarbonate is formed by reacting with calcium carbonate.

The reaction between calcium hydroxide and CO2 is also the same reason, as long as there is an excess of carbon dioxide, you have to treat it as an excess of acid, so it is easy to solve, 0, why does carbon dioxide react with calcium carbonate to form calcium bicarbonate?

By the way, please talk about the problem of overdose vs. small amounts.

<> calcium hydroxide and carbon dioxide react to form calcium carbonate, so calcium oxide must be turned into calcium hydroxide first, that is, quicklime into hydrated lime, and water can be added to complete the preparation of calcium hydroxide. Calcium carbonate is then obtained by introducing carbon dioxide into the calcium hydroxide suspension.

Calcium oxide is a basic oxide that is sensitive to moisture. It easily absorbs carbon dioxide and moisture from the air. It reacts with water to form calcium hydroxide (Ca(OH)?

and produces a lot of heat, which is corrosive. Calcium hydroxide reacts with carbon dioxide: co?

ca(oh)?=caco?↓+h?o。