What happens to calcium carbonate when it meets white vinegar? Requirements: Write chemical equation

According to the principle of stronger acids to weaker acids, calcium carbonate.

It dissolves and releases carbon dioxide.

It should be carbonic acid, but it is unstable so it decomposes into carbon dioxide and water) CaCO3 + 2CH3COOH = (CH3COOH) 2CA+CO2 + H2O Remember to make strong acid to make weak acid to judge whether it is a reaction, for metathesis reaction, it can be judged according to whether there is gas, precipitation, and water generation to judge whether it is a reaction.

CaCO3+2CH3COOH=(CH3COO)2CA+H2O+CO2CO3)2- +2CH3COOH=2CH3COO- +H2O+CO2 calcium carbonate is immersed in white vinegar, and fine bubbles emerge on the surface, and the solid gradually dissolves.

Also, remember to add the volatile symbol after CO2 when writing equations

Calcium carbonate dissolves and releases carbon dioxide (which is supposed to produce carbonic acid, but it is unstable so it decomposes into carbon dioxide and water) CaCO3 + 2CH3COOH = (CH3COOH) 2CA+CO2 + H2O

It will dissolve after a long period of soaking.

caco3+2ch3cooh=(ch3coo)2ca+h2o+co2

This reaction still needs to understand a little bit about the acidity of the acidity, compared to the acidity of acetic acid, which is stronger than the acidity of carbonic acid. Therefore, when the amount of acetic acid is sufficient, it can react to produce calcium acetate, carbon dioxide and water.

Acetic acid is more acidic than carbonic acid, so strong acid can make weak acid, acetic acid can dissolve calcium carbonate, produce calcium acetate and carbon dioxide, water, precipitate dissolution.

2hac+caco3=caac2+co2+h2o

Acetic acid is more acidic than carbonic acid, so acetic acid reacts with calcium carbonate to form calcium acetate and water, that is, acetic acid is used to remove scale.

Acetic acid reacts with calcium carbonate to form calcium acetate, water, and carbon dioxide. Its chemical equation is as follows:

caco3 + 2ch3cooh ==ca(ch3coo)2 + co2 + h2o

The chemical equation for the reaction of acetic acid with calcium carbonate can be of two kinds. When the amount of acetic acid is relatively small, acetic acid and calcium carbonate react to form calcium bicarbonate and calcium acetate. When the amount of acetic acid is relatively large, acetic acid and calcium carbonate react to form calcium acetate, carbon dioxide and water.

Reaction equation: caco +2ch cooh=ca ++2ch coo-+h o+co.

Acetic acid reacts with calcium carbonate to form calcium acetate, carbon dioxide, and water. The reaction equation is as follows:

2ch3cooh + caco3 ==ca(ch3coo)2 + co2 + h2o

Acetic acid should be a weak acid that is more acidic than carbonate, so it can react with calcium carbonate to form soluble calcium acetate and carbon dioxide gas and water, so that calcium carbonate precipitates and dissolves.

caco3+2hac=caac2+h2o+co2

Acetic acid reacts with calcium carbonate to produce calcium acetate, water and carbon dioxide, which is a type of reaction in which relatively strong acids produce weak acids.

The chemical equation for the reaction of calcium carbonate with acetic acid is: CaCO3+2CH3COOH=(CH3COO)2Ca+H2O+CO2

Calcium carbonate is an inorganic compound with the chemical formula CACO, commonly known as limestone, limestone, stone powder, etc. Calcium carbonate is alkaline and basically insoluble in water and soluble in hydrochloric acid.

It is one of the most common substances on earth, found in aragonite, calcite, chalk, limestone, marble, travertine and other rocks, and is also the main component of the bones or shells of some animals. Calcium carbonate is also an important building material and has a wide range of industrial uses.

Physical properties

White fine crystalline powder, tasteless and odorless. There are two forms: amorphous and crystalline.

The crystalline type can be divided into orthorhombic crystal system and hexagonal crystal system (anhydrous calcium carbonate is colorless orthorhombic crystal, calcium hexahydrate is colorless monoclinic crystal), which is columnar or diamond-shaped, and the density is. The melting point is 1339 (when it has been decomposed), and the lower melting point is 1289. Insoluble in alcohol, soluble in ammonium chloride solution, almost insoluble in water.

Chemical equation: CaCo +2ch Cooh = Ca(ch CoO)2 + H O+Co

Ion equation: CaCo +2ch Cooh = Ca + 2ch CoO- +H O + Co

Calcium carbonate is a valuable resource with a wide range of uses, and limestone is the trade name for limestone as a mineral raw material. In the history of human civilization, limestone has been widely used because of its wide distribution in nature and easy access.

As an important building material has a long history of mining, in modern industry, limestone is the main raw material for the manufacture of cement, lime, calcium carbide, is an indispensable flux limestone in the metallurgical industry, high-quality limestone is widely used in the manufacture of papermaking, rubber, paint, coating, medicine, cosmetics, feed, sealing, bonding, polishing and other products after ultra-fine grinding.

The ratio of limestone and building stone, lime production, metallurgical flux, ultrafine calcium carbonate to limestone consumed by cement production is 1 3.

The concept of chemical equations

A chemical equation, also known as a chemical reaction equation, is a formula that represents a chemical reaction with a chemical formula. Chemical equations reflect objective facts. The formula that uses the chemical formula (organic matter in organic chemistry generally uses the simple structure formula) to express the chemical reaction of a substance is called a chemical equation.

The chemical equation not only indicates the reactants, products, and reaction conditions. At the same time, the stoichiometric number represents the quantitative relationship between the reactants and the product substances, and the mass relationship between the substances can also be expressed through the relative molecular mass or relative atomic mass, that is, the mass ratio between the substances. For gas reactants and products, the volume ratio can also be obtained directly from the stoichiometric number.

The chemical equation for the reaction of calcium carbonate and acetic acid is described in Chinese as calcium carbonate plus vinegar is equal to calcium acetate plus carbon dioxide plus water. Acetic acid can be expressed in terms of HCOOH. Then the two sides are trimmed according to the chemical elements.

Calcium carbonate is a precipitate that can be dissolved in acetic acid, and the reaction is as follows:

caco3+2hac=cacl2+h2o+co2

Carbon dioxide gas is generated, and calcium carbonate precipitates are gradually dissolved

Because acetic acid is more acidic than carbonic acid, calcium carbonate reacts with acetic acid to produce water-soluble calcium acetate and carbon dioxide and water.

The chemical equation for the reaction of calcium carbonate and acetic acid is as follows:caco3+2ch3cooh=（ch3coo）2ca+h2o+co2↑

The ionic equation for the reaction of calcium carbonate and acetic acid is given below:caco3 + 2ch3cooh = 2ch3coo- +ca2+ +h2o + co2↑

Calcium carbonate and acetic acid chemical reaction.

The equation is: CACO +2ch COOH=CA(ch COO) +H O+CO

The ionic equation for the reaction of calcium carbonate with acetic acid.

caco₃＋2ch₃cooh＝ca₂＋＋2ch₃coo－＋h₂o＋co₂↑

Calcium carbonate meets dilute acetic acid and dilute hydrochloric acid.

Dilute nitric acid boils and dissolves. When heated to 900 kilopascals, it decomposes into calcium oxide and carbon dioxide.

Heating calcium carbonate to 900 degrees at one atmosphere will decompose into quicklime.

and carbon dioxide (industrially produced co):

Carboxyl hydrogen atom of acetic acid.

It can be partially ionized into hydrogen ions (protons) and released, resulting in the acidity of carboxylic acids. Acetic acid is a single weak acid in aqueous solution, the acidity coefficient is, pka=, and the pH of the acetic acid solution with a concentration of 1mol L (similar to the concentration of household vinegar) is, that is, only the acetic acid molecule is dissociated.

The chemical reaction equation of calcium carbonate and acetic acid is: CACO +2ch COOH=CA(CH COO) +H O+CO.

Acetic acid is a relatively simple organic acid, and its acidity is weaker than hydrochloric acid, but here it reacts with calcium carbonate in the same nature, that is, the acid and carbonate undergo metathesis reaction. Calcium carbonate and acetic acid react to form calcium acetate and carbon dioxide and water.

Physical propertiesCalcium carbonate (CACO) is an inorganic compound commonly known as limestone, limestone, stone powder, marble, etc. Calcium carbonate is neutral, basically insoluble in water, soluble in hydrochloric acid.

It is one of the most common substances on earth, found in aragonite, calcite, chalk, limestone, marble, travertine and other rocks, and is also the main component of animal bones or shells.

Calcium carbonate boils in case of dilute acetic acid, dilute hydrochloric acid, and dilute nitric acid, and dissolves. When heated to 900 kilopascals, it decomposes into calcium oxide and carbon dioxide.

The chemical equation for the reaction of calcium carbonate and acetic acid is as follows:caco3+2ch3cooh=（ch3coo）2ca+h2o+co2↑

The ionic equation for the reaction of calcium carbonate and acetic acid is given below:caco3 + 2ch3cooh = 2ch3coo- +ca2+ +h2o + co2↑

The ionic reaction equation of calcium carbonate and acetic acid: caco 2ch cooh ca 2ch coo h o co ; The chemical reaction equation is CaCo +2ch Cooh=Ca(ch CoO) +H O+Co.