Can acetaldehyde undergo addition reaction?

OK. Acetaldehyde does not have a carbon-carbon double bond, but it has a carbon-oxygen double bond.

For example. Acetaldehyde and HCN can be added, that is, HCN can be added on carbonyl-Co-, H can be added to O, and CN can be added to C.

CH3CH+HCN=CH3CH(OH)CN, but acetaldehyde does not undergo addition reaction with HCl or halogens.

Only H2 and HCN can be added to the carbonyl group, which is a high school requirement.

Done: Thank you.

Yes, there are carbon-oxygen double bonds, and both aldehydes and ketones can undergo addition reactions.

Of course, you can, you can have an unsaturated bond, and although acetaldehyde doesn't have a carbon-carbon double bond, it has a carbon-oxygen double bond, and of course it can be added to pull.

OK. The simplest is that it can form acetic acid (CH3COOH) with O2, KMno4, etc

As long as there is a double bond, the addition reaction can occur, and acetaldehyde contains a c=0 bond, so the addition reaction can occur.

Of course, as long as there is a double bond, it can be bonus.

No, H2 is reducible, and the main chemical properties are also reducing, acetic acid is a weak acid, which has the general properties of acids, and is also reducing.

The acetaldehyde carbonyl group can be hydrogenated to produce ethanol.

But not all carbonyl groups can be hydrogenated, such as the carbonyl group of acetic acid, which can only be reduced with LialH4.

Moreover, the carbonyl group cannot be added with BR2 and HBR, etc.

Of course you can ......Who said that only carbon-carbon double bonds can add ......One atom can add ......

No, there are no carbon-carbon double bonds.

Yes. There are carbon-oxygen double bonds. Acetic acid is generated.

The addition reaction between aldehydes and aldehydes is aldol condensation: the potential carbon of one aldehyde is added to the carbon of another carbonyl group, such as acetaldehyde:

ch3cho+ch3cho==ch3ch(oh)ch₂cho

Aldehydes without hydrogen cannot undergo aldol condensation reaction, such as formaldehyde. Under alkaline conditions, an autoredox reaction (Conizaro reaction) occurs between aldehydes without hydrogen to form one molecule of alcohol and one molecule of acid: HCO+HCO==CH3OH+HCOh

The addition reaction of formaldehyde and formaldehyde is: CH3CH+CH3CH==CH3CH(OH)CHcho

The addition reaction is that two atoms at the end of the reactant molecule bound by heavy bonds or conjugated unsaturated systems are bonded to groups or atoms provided by the reagent respectively in the reaction to obtain a saturated or relatively saturated addition product.

After the addition reaction, the heavy bond opens, and the atoms at each end of the original heavy bond are connected to a new group. The addition reaction is generally the reaction of two molecules to form one molecule, which is equivalent to the chemical reaction of inorganic chemistry.

The coupling reaction can be divided into several categories, such as ionic addition, free radical addition, cycloaddition and heterogeneous addition. Among the most common tansen are electrophilic addition of alkenes and nucleophilic addition of carbonyl groups.

The addition reaction between aldehydes and aldehydes is aldol condensation: the potential carbon of one aldehyde is added to the carbon of another carbonyl group, such as acetaldehyde:

ch3cho+ch3cho==ch3ch(oh)ch₂cho

Aldehydes without hydrogen cannot undergo aldol condensation reaction, such as formaldehyde. Under alkaline conditions, an autoredox reaction (Conizaro reaction) occurs between aldehydes without hydrogen to form one molecule of alcohol and one molecule of acid: HCO+HCO==CH3OH+HCOh

1. Compounds containing a Coch structure (or can be oxidized into this structure by sodium hypohalide) can undergo iodoform reaction with sodium hydroxide and iodine.

2. Iodoform reaction to generate iodoform and sodium carboxylate.

3. Acetaldehyde reaction equation ch cho 3naio chi naoh hcoona 2

Acetone reaction equation ch coch 3naio chi ch coonanaoh 2

Ethanol reaction equation ch ch pure front oh 3 naio chi hcoona naoh 2h o

1. Compounds containing a Coch structure (or can be oxidized into this structure by sodium hypohalide) can undergo iodoform reaction with sodium hydroxide and iodine.

2. Iodoform reaction to generate iodoform and sodium carboxylate.

3. Acetaldehyde reaction equation ch cho 3naio chi naoh hcoona 2

Acetone reaction equation ch coch 3naio chi ch coonanaoh 2

Ethanol reaction equation ch ch pure front oh 3 naio chi hcoona naoh 2h o