Formation of Ca HCO3 2 Chemistry 3 5

It is a simultaneous reaction (the temporal sequence is not obvious).

The term carbonic acid aqueous solution is not rigorous, because we say that xx in aqueous solution is pure, and carbonic acid is not pure.

In fact, only about 1% of carbon dioxide dissolved in water combines with water to form carbonic acid.

Whether carbon dioxide and water react first and then react with calcium carbonate, or at the same time, I personally think that this sequence is not easy to determine. I haven't seen an authoritative answer, but for the sake of illustration, studying the principles of chemical reactions is generally understood as the first one. In high school chemistry, the chemical reaction formula for this reaction will be written into one formula instead of being divided into two.

In this case, we can understand it as a simultaneous reaction. So I'm more inclined to react at the same time.

Carbon dioxide can be soluble in water, and the general substance dissolved in water is called the aqueous solution of a substance, with water as the solvent, so the carbonic acid should be called carbon dioxide aqueous solution CO2 (AQ) Carbonic acid also reacts to calcium bicarbonate, and the reaction occurs almost simultaneously.

It is a direct reaction, in no particular order, carbonic acid is an unstable acid, generally speaking, it is an aqueous solution of carbon dioxide.

Because carbonic acid is unstable, we call this an aqueous solution of carbon dioxide.

It reacts with water first, which should be a carbonic acid solution.

Calcium bicarbonate, calcium bicarbonate is an inorganic acid salt. Soluble in water, chemical formula Ca(HCO3)2, relative molecular weight, calcium bicarbonate can be obtained by the reaction of sodium bicarbonate and calcium salt easily soluble in water.

In daily life, the inner wall of the kettle will be scaled after a long time, which is related to the hardness of the water. Mainly calcium bicarbonate Ca(HCO3)2] and magnesium bicarbonate (ChemicalBookmg(HCO3)2] dissolved in water, during the boiling process, they will become calcium carbonate CaCO3] and magnesium hydroxide Mg(OH)2], which are insoluble in water, so that scale is formed.

Calcium bicarbonate can be used as calcium fortifier, emulsion stabilizer, dough conditioner, nutritional supplement, buffer, loosening agent, flour improver, nutritional supplement, yeast food, emulsifier, curing agent, antioxidant synergist, stabilizer.

Physicochemical properties of calcium bicarbonate

Calcium carbonate is dissolved in carbonic acid to form calcium bicarbonate. Evaporation of calcium bicarbonate solution yields calcium carbonate solids. Soluble in water, pyrolysis Ca(HCO3)2== CaCO3 CO2 H2O]; Positive salts are formed with alkalis.

When calcium carbonate encounters carbon dioxide and water, chemical attack occurs to generate soluble calcium bicarbonate, resulting in the phenomenon of "water droplets and stones" over time, the equation: CaCO3+CO2+H2O==Ca(HCO3)2

When calcium bicarbonate is dissolved in water, its aqueous solution is also known as "hard water". Groundwater is "hard water". The water in rivers, lakes and seas is not "hard water" (hard water refers to metal cations such as calcium ions and magnesium ions, and their carbonates are insoluble in water.

Because this is the pure mining principle of "strong acid to weak acid" to do the nuclear reaction (CO2 + H2O is regarded as H2CO3):

ca(clo)2+2co2+2h2o===ca(hco3)2+2hclo

Since HCO3- is less acidic than HCO3, Ca(HCO3)2 cannot react as follows

ca(hco3)2+ca(clo)2===2caco3+2hclo

Two types, considering the amount of NAOH sufficient and the amount of insufficient

ca(hco3)2+2naoh==na2co3+caco3!+2H2O NAOH Deficiency.

ca(hco3)2+naoh==na+h2o+caco3!Naoh sufficient.

The principle is actually the reaction of HCO3- (bicarbonate ion) and OH (hydroxide ion), if there is enough OH-, CO3 2- (carbonate ion) will be generated, and if it is not enough, in addition to carbonate ions, there will be bicarbonate ions = you will understand the column when you learn the ion equation later.

Can't write! co2+ca(oh)2=caco3↓+h2o,caco3+co2+h2o=ca(hco3)2

The liquid resistance formula of the total formula is 2CO2+Ca(OH)2=Ca(HCO3)2

The corresponding ion equation is CO2+OH-=HCO3-

caco32hcl=

cacl2h2o+co2

Calcium carbonate is soluble in.

Dilute hydrochloric acid. CaCO3 + H2O + CO2 = Ca(HCO3)2 is passed into calcium carbonate solution.

into excess carbon dioxide.

gases, calcium carbonate precipitates gradually transform resistant liquids into soluble.

Calcium bicarbonate. ca(hco3)2+2hcl=cacl2+2h2o+2co2

Calcium bicarbonate and hydrochloric acid react with each mu to form carbon dioxide.

Ca(HCO3)2+2NAOH=NA2C, Fan Cake, Lu Gai, Qi Huan Ge Wei Gong Li, O3 + 2H2O+CaCO3

Acid salts. and strong alkali reactions.

CaCO3+2HCl=CaCl2+H2O+CO2 calcium carbonate is soluble in dilute hydrochloric acid.

CaCO3+H2O+CO2=Ca(HCO3)2 is introduced into the calcium calcium-soluble residual solution of carbojudate, and the calcium carbonate precipitate is gradually converted into soluble calcium bicarbonate.

Ca(HCO3)2+2HCl=CaCl2+2H2O+2CO2 calcium bicarbonate reacts with hydrochloric acid to form two liters of rolling carbon oxide.

Ca(HCO3)2+2NaOH = Na2CO3+2H2O+CaCO3 acid salt and strong base.