Chemical equation for the formation of acid rain, chemical equation for the formation of acid rain

Acid rain is mostly due to the combustion of fossil fuels

Coal containing sulphur is burned to produce sulphur dioxide.

s+o (ignition) so

Sulfurous acid is formed by the interaction of sulphur dioxide and water.

so + h o h so (sulphurous acid).

Sulfurous acid can be oxidized into sulfuric acid in the air.

2H SO +O 2H SO (sulfuric acid).

2) Nitrogen oxides are dissolved in water to form acids: During thunderstorms and lightning, a small amount of nitrogen dioxide is often produced in the atmosphere.

When lightning occurs, nitrogen combines with oxygen to form nitric oxide.

n o (lightning or high temperature) = 2no

Nitric oxide is structurally unstable and oxidizes into nitrogen dioxide in the air.

2no+o₂＝2no₂

Nitrogen dioxide and water react to form nitric acid.

3NO +Ho = 2HNO (nitric acid) + NO3) acid rain reacts with marble:

caco +h so caso +h o+co caso +so +h o=ca(hso) 5) In addition, there are other acid gases dissolved in water that cause acid rain, such as hydrogen fluoride, fluorine gas, chlorine and other acid gases.

Route 1: 2SO2 + 02 = dust (catalyst) = 2SO3S03 + H2O = H2SO4

Route 2: SO2 + H2O = H2SO3

2h2so3+o2=2h2so4

There are two types of acid rain:1

sulfuric acid rain; 2

Nitric acid acid rain.

Sulfuric acid rain formation process.

2so2+o2=2so3

so3+h2o=h2so4

so2+h2o=h2so3

2h2so3+o2=h2so4

Nitric acid acid rain formation process.

It's more complicated. The main reaction equation is:

2no+o2=2no2

3NO2+H2O=2HNO3+NOh.

Acid rain is the result of the combination of sulfur oxides and nitrogen oxides with rainwater

Sulfur: SO2 + H2O = H2SO3 (sulfurous acid, a medium and strong acid) because it can be oxidized in the air: 2SO2 + O2 = 2SO3 SO3 + H2O = H2SO4

Nitrogen: 2NO+O2=2NO2

3no2+h2o=2hno3+no

Acid rain. There are two kinds: 1 sulfuric acid rain; 2 Nitric acid.

type acid rain. 1 Formation process of sulfuric acid rain 2SO2+O2=2SO3 SO3+H2O=H2SO4

SO2+H2O=H2SO3 2H2SO3+O2=H2SO42 The formation process of nitric acid rain is relatively complex The main reaction equations.

Yes 2NO+O2=2NO2 3NO2+H2O=2HNO3+NO

There are two types of acid rain: 1 sulfuric acid rain;2 Nitric acid acid rain.

1 Formation process of sulfuric acid rain 2SO2+O2=2SO3 SO3+H2O=H2SO4

SO2+H2O=H2SO3 2H2SO3+O2=H2SO42 The formation process of nitric acid acid rain is complex The main reaction equation is 2NO+O2=2NO2 3NO2+H2O=2HNO3+NOnO

First, acid rain can lead to soil acidification. Long-term acid rain will leach a large amount of nutrients in the soil, resulting in a serious shortage of nutrients in the soil, resulting in poor soil. Secondly, acid rain can also induce plant pests and diseases, which can greatly reduce crop yields and lead to a decrease in the protein content of plants.

Then, acid rain can also dissolve the non-metallic building material's case-hardening cement, which can damage the building.

Acid rain is mostly formed by the combustion of fossil fuels, and the combustion of coal containing sulfur produces sulfur dioxide: S + O2 = ignition = SO2;Sulfurous acid is formed by the reaction of sulfur dioxide and water: SO2+H2O=H2SO3;Sulfurous acid is oxidized in the air to sulfuric acid:

2h2so3+o2→2h2so4。

Nitrogen oxides dissolve in water to form acids: small amounts of nitrogen dioxide are often produced in the atmosphere during thunderstorms and lightning.

When lightning occurs, nitrogen combines with oxygen to form nitric oxide.

N2 + O2 = Discharge = 2NO

Nitric oxide is structurally unstable and oxidizes into nitrogen dioxide in the air.

2no+o2=2no2

Nitrogen dioxide and water react to form nitric acid.

3no2+h2o=2hno3+no

3) Acid rain reacts with marble:

CaCO3+H2SO4=CASO4+H2O+CO2 CaSO3+SO2+H2O=CA(HSO3)2(4) In addition, there are other acidic gases that are dissolved in water to cause acid rain, such as hydrogen fluoride, fluorine gas, chlorine, hydrogen sulfide and other acidic gases.

Chemical equation: 2SO2 + 2H2O = 2H2SO3 Analysis process: The waste gas containing SO2 emitted in industrial production forms sulfurous acid H2SO3 when it encounters water in nature, and if it encounters water vapor, it becomes acid particles - acid mist, and acid rain (acid rain of sulfuric acid) is formed as rain falls to the ground

The chemical equation for the formation of nitric acid rain is as follows:

2no +o2 → 2no2

3no2 +h2o →2hno3 +no

Similarly, nitrogen oxides (mainly NO, NO2) emitted by industrial production can also form nitric acid smoke or produce acid rain when they encounter water vapor in the air. However, the current acid rain in the world is mainly sulfuric acid rain.

Chemical equation: 2SO2 + 2H2O = 2H2SO3 Analysis process: The waste gas containing SO2 emitted in industrial production forms sulfurous acid H2SO3 when it encounters water in nature, and if it encounters water vapor, it becomes acid particles - acid mist, and acid rain (acid rain of sulfuric acid) is formed as rain falls to the ground

The chemical equation for the formation of nitric acid rain is as follows: 2NO+O2 2NO2 3NO2+H2O 2HNO3+NO Similarly, nitrogen oxides (mainly NO2 and NO2) emitted by industrial production can also form nitric acid smoke or produce acid rain when they encounter water vapor in the air. However, the current acid rain in the world is mainly sulfuric acid rain.