Second year of junior high school questions! Ace enter! Junior 2 Math Problem !! Urgent!! Ace enter!

Updated on educate 2024-06-04
17 answers
  1. Anonymous users2024-02-11

    Let BC be x and AC be y, then in the triangle ABC x 2+y 2=2 2+8 2In the triangle ACD and BCD x 2-2 2 = y 2-8 2, the solution can be found to find cd

  2. Anonymous users2024-02-10

    Your math learning logic is fundamentally wrong. There's a good way to do it, why not use it? Don't say anything that is not in the grade, the teacher asks. Our teachers have always liked to self-study students. I hope you can think about how exactly you want to learn.

    For this problem, there is no point in using the valley theorem, it is nothing more than an algebraic problem, let a variable x, list all the equations, and solve it.

  3. Anonymous users2024-02-09

    1. According to the diagram, the triangle DFO and BOE are translated to the position of the triangle KCH and the triangle AGK respectively, so that we can get that the triangle OGH is an equilateral triangle, then S AOC + S BOE + S DOF S OGH, and the triangle OGH is an equilateral triangle with a side length of 2, there is S OGH = 3 under the root number, then S AOC + S Boe + S DOF is 3 under the quadratic root number

    S AOC + S Boe + S DoF + S ACK = 3) 2, according to Zu Xuan's theorem (equal area theorem) we can get that the area of the special-shaped quadrilateral bedf = square ABFE, then the sum of the area of the shaded part = 1 square meter.

  4. Anonymous users2024-02-08

    The second one is very simple, the two parts of BFE and FCD are half of ABCD, AD=2, AB=1. Then the interception area should be 1.

  5. Anonymous users2024-02-07

    Solution: Suppose a bus departs every x minutes at a speed of V1 and a taxi at a speed of V2, then:

    5(v1+v2)=v1*x

    10(v2-v1)=v1*x

    Multiply Equation 1 by 2 and subtract Equation 2 to get: 20v1=v1*xx=20.

    Answer: Slightly.

  6. Anonymous users2024-02-06

    The farthest distance between the longitudinal functions of A and B is 1 hour, that is, during the game, the farthest distance between teams A and B is 1 hour.

  7. Anonymous users2024-02-05

    n^5-5n^3+4n

    n(n^4-5n^2+4)

    n(n^2-4)(n^2-1)

    n(n+2)(n-2)(n+1)(n-1)=(n-2)(n-1)n(n+1)(n+2) can be seen to be the multiplication of 5 consecutive natural numbers.

    1 of 5 consecutive natural numbers must be a multiple of 3, 1 must be a multiple of 5, and 2 even numbers must be 1 of 4.

    So the greatest common divisor is 2*3*4*5=120

  8. Anonymous users2024-02-04

    The farthest at 1 hour is derived from the image.

    Otherwise, you can calculate the analytic formula of the function: A y=kx through the dot (1,20) y=20x

    x "1) B over the point (1,16)."

    y②=16x

    x" and then bring in the calculations yourself.

  9. Anonymous users2024-02-03

    1 hour is the farthest, and the function graph represents the relationship between time and distance. So in 1 hour is 20-16km apart is the farthest.

  10. Anonymous users2024-02-02

    Solution: Let the speed of A be 3x km/h and the speed of B be 4xkm/h.

    20 minutes = 1 3 hours.

    According to the title, it is called:

    10/(4x)-6/(3x)=1/3

    1 3x=x=so the speed of the first is km/h).

    B speed: kilometers per hour).

    Answer: The first speed is km/h, and the B speed is 6kmh.

  11. Anonymous users2024-02-01

    Let the speed of A be 3x kmh, then the speed of B is 4xkmh, and the equation is established.

    6/(3x)+1//3=10/(4x)

    Solving the equation gives x=3 2, so.

    The speed of A is 9 2 km/h, and the speed of B is 6 km/h.

  12. Anonymous users2024-01-31

    Kao, this one is simple, A is, and the other is 6

  13. Anonymous users2024-01-30

    Let the speed of A and B be 3x and 4x. respectively

    10000/4x-6000/3x=20

    x = meters per minute.

    A speed B speed.

  14. Anonymous users2024-01-29

    Two numbers are squared at the same time.

    The root number 15 is 15; The root number is.

    Because 15 >, so.

    Root number 15> root number.

  15. Anonymous users2024-01-28

    Colleague Squared: Ah, no need to estimate.

  16. Anonymous users2024-01-27

    Because dg is parallel to ba, 1= 3

    Since AD and EF are both perpendicular to BC, AD is parallel to EF, so 3 = 2

    So 1= 2

  17. Anonymous users2024-01-26

    a*a+2a+b*b-6b+10=0

    a*a+2a+1+b*b-6b+9=0 (split 10 into 1 and 9) a+1) + (b-3) squared = 0 is obtained by talking about the non-negative property.

    a+1=0 b-3=0

    So, a=-1 b=3

Related questions
15 answers2024-06-04

Question 1: x y) 2 = x2 2 x y y2 = 9 1 formula.

x y) 2=x2 2xy y2=5 2. >>>More

13 answers2024-06-04

1.Yes, e.g., carbon, carbon is a substance c

H2 represents hydrogen, which is a substance, and can also represent a molecule such as hydrogen. >>>More

19 answers2024-06-04

m 2 + 2n - 20 + (n-2) root number 5 = 0, m, n, are rational numbers So m 2 + 2n-20 is a rational number. >>>More

22 answers2024-06-04

1.Help me determine whether several plants have straight or fibrous roots: >>>More

16 answers2024-06-04

Note: The area of the triangle ABC can be used as the bottom and CF as the height. >>>More