Find the chemical equation! Hurry!!

hcl+agno3=agcl+hno3

nacl+agno3=nano3+agcl2mgcl+2agno3=mg(no3)2+agclh2so4+bacl2=2hcl+baso4h2so4+ba(no3)2=2hno3+baso4na2so4+bacl2=2nacl+baso4k2so4+ba(oh)2=2koh+baso4h2so4+ba(oh)2=baso4+2h2omgso4+ba(oh)2=mg(oh)2+baso4cuso4+ba(oh)2=cu(oh)2+baso4na2co3+2hcl=na2co3+h2o+co2na2co3+h2so4=na2so4+h2o+co2k2co3+2hno3=2kno3+h2o+co2caco3+2hcl=cacl2+h2o+co2caco3+2hno3=ca(no3)2+h2o+co2mgco3+2hcl=mgcl2+h2o+co2co2+2naoh=na2co3+h2o

co2+2koh=k2co3+h2o

co2+na2co3+h2o=nahco3nahco3+naoh=na2co3+h2ona2co3+ca(oh)2=2naoh+caco3k2co3+cacl2=caco3+2kclcl2+2naoh=naclo+nacl+h2ocl2+2ca(oh)2=ca(clo)2+cacl2+h2ocl2+2nabr=br2+2nacl

cl2+2ki=2kcl+i2

cl2+h2o=hclo+hcl

After playing for more than half an hour, tired...

Hope, if you don't understand, you can ask.

HCl+AGNo3=AGCl(precipitate)+Hno3NaCl+AGNo3=AGCl+nano3mgCl2+2AGnO3=2AGCl+mg(NO3)2H2SO4+BACl2=BaSO4 (precipitate)+2HCH2SO4+BA(NO3)2=BaSO4 (precipitate)+2Hno3Na2SO4+BACl2=BaSO4 (precipitation)+2NaClk2SO4+BA(OH)2=baso4 (precipitation)+2kohh2so4+ba(oh)2=baso4(precipitation)+2h2omgso4+ba(oh)2=baso4 (precipitation)+mg(oh)2cuso4+ba(oh)2=baso4 (precipitation)+cu(oh)2na2co3+hcl=nacl+h2o+CO2 (gas)Na2CO3+H2SO4=Na2SO4+H2O+CO2 (gas) K2CO3+Hno3=Kno3+H2O+CO2 (gas) CaCO3+2HCl=CaCl2+H2O+CO2 (gas)CaCO3+2Hno3=Ca(NO3)2+H2O+CO2 (gas)MgCO3+2HCl=mgCl2+H2O+CO2 (gas)CO2+2NaOH=Na2CO3+H2O

co2+2koh=k2co3+h2o

CO2 + Na2CO3 + H2O=2NaHCO3 NaHCO3 + NaOH = Na2CO3 + H2ONa2CO3 + Ca(OH)2=CaCO3 (precipitation) + 2NaOH2KOH+CaCl2=Ca(OH)2+2KCCl2+2NaOH=Naclo+NaCl+H2OCl2+2Ca(OH)2=Ca(clo)2+CaCl2+H2OCl2+2Nabr=br2+2nacl

cl2+2ki=2kcl+i2

cl2+h2o=hclo+hcl

Foundation? All that is produced is precipitated silver chloride and barium sulfate.

I can't see it clearly, but it's definitely all in the book.

1 All 1 2al+3h2so4=al2(so4)3+3h2↑2. al(oh)3+3hno3=al(no3)3+3h2o3.

baco3+2hno3=ba(no3)2+h2o+co2↑4. fe2o3+3h2so4=fe2(so4)3+3h2o5.Silver and dilute sulfuric acid do not react.

6. 2hno3+k2co3=2kno3+h2o+co2↑7. agno3+hcl =agcl↓+hno38.

ag2co3+2hno3=2agno3+h2o+co2↑9. fe(oh)2+2hcl=2h2o+fecl210. caco3+2hcl=cacl2+h2o+co2↑11.

ba(no3)2+h2so4=baso4↓+2hno312. ba(oh)2+h2so4=baso4↓+2h2o13. cuo+2hcl=cucl2+h2o14.

cu(oh)2+h2so4=cuso4+2h2o15. fe+2hcl=fecl2+h2↑16. bacl2+h2so4=baso4↓+2hcl17.

nacl + agno3 = agcl↓+ nano318. al2o3+6hcl=2alcl3+3h2o19. fe(oh)3+3hno3=fe(no3)3+3h2o20.

Copper and dilute sulfuric acid do not react.

Give me more points, landlord, I'm tired

1. A student wants to determine the content of potassium carbonate in plant ash, saying.

69 g of sample was placed in a beaker and added to dilute hydrochloric acid.

Exactly complete reaction, after sufficient reaction, the total mass of the toacrated mixture is weighed g (ignoring the effect of the dissolution of carbon dioxide on the mass). Please calculate:

1) The mass of carbon dioxide produced during the reaction is g.

2) The mass fraction of potassium carbonate in the plant ash sample.

1) (2) Solution: Let the mass of K2CO3 in the sample be x.

K2CO3+2HCl=2KCl+H2O+CO2 138 44x g Solution: x= g

A: The mass fraction of potassium carbonate in this sample is 20%.

The precipitation symbol is added by itself.

2.NH4HCO3 high temperature = NH3 + CO2 + H20 It seems that H2O should be more of a gas considering the reaction of double hydrolysis.

NH4)2CO3+Na2S = NH3 gas symbol + H2S gas symbol + Na2CO3

3 2H2O2 heating = 2H2O+O2

4.2Na+Cl2=2NaCl Ignition 2NaCl electrolysis=2Na+Cl2 This is the reaction condition is different. If it is the same condition, the reversible reaction should be considered.

5. hclo3+naoh=naclo3+h20 --hcl04+naoh=naclo4+h20