Chemical Equation Urgent! ） 30

agno3+nacl=agcl()+nano3 ag+ +cl+=agcl

bacl2+na2so4=baso4+2naclcuso4+na2s=cus+naso4

al2(so4)3+ nahco3+h2o=al(oh)3+co2+na2so4

alcl3+na2s

fecl2 k2s

fecl3na2s

Hey, I don't want to write about it, it's about the same as the one above, and your points are too small.

I don't know if you're a student at that stage, but if you're a high school student, the following equation won't either.

al2(so4)3+ 6nahco3+6h2o=2al(oh)3+3co2+na2so4

A couple of other college graduates don't know if they can write, hehe.

These things are actually very simple.

ab+cd=ad+bc

Just swap the order.

In this way, the metal ions in front and the anions in the back form a precipitation, and a precipitation symbol is added.

Misspelled molecules, such as Al2S3, Fes and Fe2S3

Upstairs, Al2S3 seems to be completely double hydrolyzed in water, Fe2S3 does not seem to exist, and some equations are not so simple. This part should be super-curricular in high school. The fourth reaction is too.

So much to give 5 points not to write for you.

2NaCl== Electrolysis==2Na

Cl2mgCl2== Electrolysis ==mg

Cl22Al2O3 = electrolysis = 4Al

3o22fe2o3

3c = = high temperature = 3CO2

4Fe2: Four methods for the preparation of O2.

1) 2H2O = = Electrolysis = = 2H2

o22）2kclo3=mno2=2kcl

3o23）2kmno4===k2mno4

mno2o2

4）2na2o2

2co2==2na2co3

O23: The preparation of coarse scale silicon is stupid Answer:

SiO22C [High Temperature Electric Furnace]SI

2CO (quartz sand) (coke) (crude silicon).

Crude silicon turns into pure silicon:

Si (coarse) 2Cl2 SiCl4

SiCl42H2 high temperature Si (pure).

Laboratory preparation of 4HCL4:CL2.

mno24hcl=mncl2

cl22h2o

5: The reaction principle of the foam fire extinguisher.

al2(so4)3

6nahco3==3na2so4

2al(oh)3↓

6CO26: Preparation of NH3

3h2n2== high temperature. High pressure. Catalyst = 2NH37: industrially prepared HCl

H2Cl2 = ignition = 2HCl

8: Industrial preparation of H2SO4

4fes211o2=2fe2o3

8so22so2

o2=2so3

so3h2o=h2so4

9: Industrial preparation of Hno3

4NH35O2=== catalyst) 4NO

6h2o2no

o2===2no2

3no2h2o==2hno3no

Ca(ClO)2+HCl===CaCl2+2HCOCA(ClO)2 reacts with HCl, irrespective of the HCl concentration, the reaction equation is the same.

HCl(concentrated) and Ca(ClO)2 do not produce Cl2, CaCl2 and H2O.

The presence of Cl2 indicates that a redox reaction has occurred. Whereas, HCl does not have strong oxidizing properties. The Cl element in HCL is +1 valence, and the Cl element in CL- is also +1 valence, so there is no redox reaction between the two of them, and of course there is no Cl2 formation (Cl in Cl2 is 0 valence).

Therefore, no matter whether the hydrochloric acid is concentrated or dilute, the result is HClO and CaCl2

The active ingredient is the chemical equation of chlorine gas released by the reaction of bleaching powder of Ca(clo)2 and concentrated hydrochloric acid:

Ca(ClO)2 + 4HCl(concentrated) = CaCl2 + 2H2O + 2Cl2

The chemical equation for the reaction of bleaching powder and concentrated hydrochloric acid with concentrated hydrochloric acid is the following for the active ingredient naclo

Naclo + 2HCl (concentrated) = NaCl + H2O + Cl2

Iron and sulfur field coarse zinc acid solution reaction: Fe+ZNSO4 reaction can not be carried out.

Magnesium and silver chloride reaction mg + 2agcl = mgcl2 + ag aluminum and sulfate stool xiang iron solution should be 2 al + 3fe so4 = al2 (so4) 3 + 3fe

Zinc and mercury nitrate solution react Zn + Hg (NO3) 2 = Zn (NO3) 2 + Hg

1.Because zinc activity is stronger than iron is not reflected.

2.Because silver chloride is not reflected.

3.Because aluminum activity is stronger than iron is not reflected.

This Gao Feng is not sure).

Wish! A: Lu.

1。Add hydrochloric acid.

2。Slow oxidation.

3。Sulfur and heat.

4。Combustion in oxygen.

Reaction Equation Basic Reaction Types Reaction Phenomena Uses.

2kmNO4===K2mNO4+MNO2+O2 Decomposition O2 is prepared in the laboratory

MNO22KCLO3===2KCl+3O2 decomposes and potassium chlorate melts gradually.

MNO22H2O2===2H2O+O2 decomposes to produce a large number of colorless bubbles.

Power. 2H2O===2H2 +O2 Decomposition Colorless bubbles are produced on the positive and negative electrodes, respectively, and the volume of gas produced on the negative electrode is twice that of the gas produced on the positive electrode

2HGO ==2HG+O2 decomposes The red solid fades away, producing a silvery liquid

2kmNO4 = Heating = K2mNO4 + MNO2 + O2 Type: Decomposition.

2kclo3=mno2 heating=2kcl+3o2 decomposition.

H2O2=Mno2=H2O+O2 decomposition.

2H2O = energized = 2H2 +O2 decomposed.