How C6H6CCH3CH2 synthesizes C6H6CCOOH CH2

Under the condition of light, the reactants are allowed to react with a low concentration of Cl2, and the main reaction in this step is.

c6h5—c(ch3)=ch2 + cl2 → c6h6—c6h5-c(ch2cl)=ch2 + hcl

Due to the conjugation effect, this reaction has a great tendency to occur, and the addition reaction is difficult to occur) and then reacts with the base in an alcohol solution.

C6H5—C(CH2Cl) = CH2 + NaOH (ethanol) C6H5-C(CH2OH) = CH2 + NaCl

After that, it is oxidized with a selective oxidant, which can be oxidized by using active MNO2, etc.

C6H5—C(CoOH)=CH2.

First, a large amount of chlorine gas is used to ensure the trichloride substitution product, and the light replaces the hydrogen at the alpha position, and then hydrolyzed into alcohol, and then the three hydroxyl groups on a carbon are unstable, and it is automatically dehydrated into carboxylic acid.

c6h6-c(ch3)=ch2+3cl2 ——c6h6-c(ccl3)=ch2+3hcl

c6h6-c(ccl3)=ch2+2h2o——c6h6-c(cooh)=ch2

If you use an oxidizing agent, be careful to oxidize it into benzoic acid!

The second step on the first floor is not in the alcohol solution, but in the aqueous solutionReplace hydrogen on saturated carbon under light conditions.

The answer on the second floor, if it is high school chemistry, is not advisable, it is not a common method, although it may achieve the goal.

1. Sodium hydroxide alcohol solution, heated, eliminated reaction, and ethylene is obtained.

2. React with bromowater jujube to reed stool belt to obtain 1, 2-dibromoethane.

3. React with KCN solution, substitution, and obtain butadionitrile ncch2ch2cn

4. Acidic hydroslickic envy solution to obtain 1,4-succinic acid.

Summary. Hello, according to the problem you described, the method of synthesizing ch3ch2coch2ch2ch2ch3 is as follows: this is an esterification reaction, which requires the use of acetic acid and propanol.

The reaction formula is: ch3cooh + ch3ch2ch2oh ch3cooch2ch2ch3 + h2o, the specific steps are as follows:1

Prepare the reactants. Take a certain amount of acetic acid and propanol to meet the amount of desired product. 2.

Mix the reactants. Acetic acid and propanol are mixed, and a small amount of sulfuric acid is added as a catalyst.

Hello, according to the problem you described, the method of synthesizing ch3ch2coch2ch2ch2ch3 is as follows: this is an esterification reaction, which requires the use of acetic acid and propanol. The reaction formula is:

ch3cooh + ch3ch2ch2oh ch3cooch2ch2ch3 + h2o The specific steps are as follows:1Prepare the reactants.

Take a certain amount of acetic acid and propanol to meet the required amount of product. 2.Mix the reactants.

Acetic acid and propanol are mixed, and a small amount of sulfuric acid is added as a catalytic agent.

3.Reaction heating. The mixed reactants are heated to boiling, and the reaction continues until all the reactants are converted into products.

4.Isolate the product. The reaction mixture is different, and the product can be separated by extraction separation method or distillation method.

5.Purification of the product. The obtained product may contain some impurities, which can be purified by recrystallization, washing, filtration, distillation and other methods to obtain pure ch3ch2coch2ch2ch3 product.

It should be noted that the reaction temperature needs to be controlled to avoid product decomposition when the reaction is hot. At the same time, the amount of catalyst used also needs to be controlled, and excessive use will affect the purity of the product. [Grip Blade Field].

Summary. Pro, the process of converting CH3CH(CH3)CH2CH2OH to CH3CH(CH3)CH2NH2 requires two steps. The first step is to dehydrate CH3CH(CH3)CH2CH2OH to obtain CH3CH(CH3)CH=CH2.

This reaction requires the use of a strong acid catalyst, such as concentrated sulfuric acid or phosphoric acid, to leave -oh and -h from the molecule to form a double bond. The second step is to reduce CH3CH(CH3)CH=CH2 in the presence of hydrogen using an aluminum-magnesium alloy to obtain CH3CH(CH3)CH2NH2. This reaction requires the use of a reducing agent, such as lithium-aluminum hydride or hydrogen in combination with a catalyst, to reduce the double bond to a single bond and replace the original -c=c- with -NH2.

What is the process of synthesis of CH3CH(CH3)CH2CH2OH from CH3CH(CH3)CH2NH2?

Pro, the process of converting CH3CH(CH3)CH2CH2OH to CH3CH(CH3)CH2NH2 requires two steps. The first step is to dehydrate CH3CH(CH3)CH2CH2OH to obtain CH3CH(CH3)CH=CH2. This reaction involves the use of a strong acid catalyst, such as concentrated sulfuric acid or phosphoric acid, to remove -OH and -h from the molecule to form a double bond.

The second step is to reduce CH3CH(CH3)CH=CH2 in the presence of hydrogen using an aluminum-magnesium alloy to obtain CH3CH(CH3)CH2NH2. This reaction requires the use of a reducing agent, such as lithium-aluminum hydride or hydrogen in combination with a catalytic bonding agent, to reduce the double bond to a single bond, and to replace the original -c=c- with -NH2.

Safety needs to be paid attention to in the reaction process, because both the dehydration reaction and the reduction reaction involve flammable and explosive substances. In addition, this process also requires precise control of temperature and time conditions to ensure the purity and yield of the product.

Summary. Hello dear, CH3CH2-C O-CH3 can be prepared by the reaction of sodium acetate and ethyl bromide. The specific preparation steps are as follows:

1.Sodium acetate is mixed with methyl iodide in a dry environment to form ethyl formate. 2.

Ethyl formate is heated to 50 °C, and ethyl bromide is added dropwise at the same time to generate The above products are reacted with isopropyl lithium in liquid ammonia to eliminate BR ions to form CH3CH2-O-C Finally, CH3CH2-O-C O is converted to CH3CH2-C O-CH3, which can be obtained by hydrolysis in the presence of sulfuric acid. It should be noted that during the above preparation process, it is necessary to ensure the dryness of the reagent and the reaction vessel to avoid interference by moisture or other impurities.

CH3CH2-C O-CH3 can be prepared by the reaction of sodium acetate and ethyl bromide. The specific preparation steps are as follows:1

Sodium acetate is mixed with methyl iodide in a drying shed to form ethyl formate. 2.Ethyl formate is heated to 50 °C, and ethyl bromide is added dropwise at the same time to generate The above products are reacted with isopropyl lithium in liquid ammonia to eliminate BR ions to form CH3CH2-O-C Finally, CH3CH2-O-C O is converted to CH3CH2-C O-CH3, which can be obtained by hydrolysis in the presence of sulfuric acid.

It should be noted that during the above preparation process, it is necessary to ensure the dryness of the reagent and the liter and grandson reaction vessel to avoid interference by moisture or other impurities.

Is there a chemical equation.

Hello dear, yes, the following is the synthetic imitation scatter travel equation of ch3ch2-c o-ch3:1Equation for the synthesis of ethyl formate:

Naoac + CH3I Stool CH3Cooch2CH32The synthesis equation of CH3CH2-O-Co-CH2BR is: CH3Cooch2CH3 + BRCH2CH3 CH3CH2-O-Co-CH2BR + NABR + CH3CoOC33

The synthesis equation of CH3CH2-O-C O: CH3CH2-O-Co-CH2BR + 2 LI + NH3 CH3CH2-O-C O + Libr + LinH2 + H24Hydrolysis equation for CH3CH2-C O-CH3:

CH3CH2-O-C O + H2SO4 + H2O CH3CH2-C O-CH3 + H2SO4 H2O where NaOAC stands for sodium acetate, CH3I stands for methyl iodide, BRCH2CH3 stands for ethyl bromide, DIDO represents isopropyl lithium, and NH3 stands for liquid ammonia.

c6h5cooch2ch3+(ch3)2chch2ch2oh---c6h5cooch2ch2ch(ch3)2+ch3ch2oh

Reverse touch Wang Zhaoling line should be a piece of laughter Kai c2h5ona).

CH3CH2CH2COCH3 is a ketone alcohol, also known as pyruvol, which can be obtained by reduction from CH3COCH2COOCH2CH3. The preparation method is as follows: the first search is to react CH3Coch2Cooch2CH3 with lithium aluminum hydride (LiALH4) in ether to obtain silver withered to CH3CHHch2CH2COOH.

CH3CHHch2CH2COOH was then added to the NAOH solution, and the heated front hole conversion was carried out to give CH3CHHch2CH2COONA. Finally, excess CH3COOH is added, and heat conversion again to give CH3CHHch2CH2COCH3. Reaction Equation:

1. ch3coch2cooch2ch3 + 4lialh4 → ch3chohch2ch2cooh + 4lialo2 + 2h22. ch3chohch2ch2cooh + naoh → ch3chohch2ch2coona + h2o3.

ch3chohch2ch2coona + ch3cooh → ch3chohch2ch2coch3 + nach3coo