Find chemical equations, the more the merrier, and the more chemical reaction equations in high scho

Range? Middle school, high school, or college? (If there were too many universities, no one would be able to write them all).

Paste it - a collection of junior high school chemistry equations:

1..Sodium carbonate and a small amount of hydrochloric acid.

na2co3+hcl=nacl+nahco32.Carbon rubber imitation sodium per mu and excess hydrochloric acid.

na2co3+2hcl==co2↑ +h2o+2nacl3.Add a small amount of sodium hydroxide to the sodium bicarbonate solution.

naoh+nahco3=na2co3+h2o4.Excess sodium hydroxide is added to the sodium bicarbonate solution.

naoh+nahco3=na2co3+h2o5.Reaction of aluminum and hydrochloric acid.

2al+6hcl=2alcl3+3h2 ↑6.Alumina and hydrochloric acid.

al2o3 + 6hcl = 2alcl3 + 3h2o7.Alumina and sodium hydroxide.

al2o3 + 2naoh = 2naalo2 + h2o8.Aluminum hydroxide and hydrochloric acid.

al(oh)3+3hcl=alcl3+3h2o9.Aluminum hydroxide and sodium hydroxide are large judgment solutions.

al(oh)3+naoh=naalo2+2h2o10.Aluminium chloride solution and excess ammonia.

alcl3+3nh3·h2o=al(oh)3↓+3nh4cl11.Excess sodium hydroxide is added to the aluminum chloride solution.

alcl3+3naoh=3nacl+al(oh)3al(oh)3+naoh=naalo2+2h2o12.Excess hydrochloric acid is added to sodium metaaluminate solution.

naalo2+4hcl=nacl+alcl3+2h2o13.Magnesium burns in the air.

2mg+o2＝2mgo

3mg+n2=mg3n2

2mg+CO2===ignition===2mgo+c14Iron and hydrochloric acid.

fe+2hcl=fecl2+h2↑

15.Iron oxide is soluble in hydrochloric acid.

fe2o3+6hcl===2fecl3+3h2o16.Sodium hydroxide solution is dropped into the ferric chloride solution.

fecl3 + 3naoh =fe(oh)3↓+ 3nacl17.Iron burns in oxygen.

3Fe + 2O2 = (ignition) Fe3O4

18.Chlorine water is added to the green ferrous solution.

cl2+2fecl2=2fecl3

19.Iron powder is added to the ferric chloride solution.

fe + 2fecl3 =3fecl2

20.The ferric chloride solution reacts with copper.

cu+2fecl3=cucl2+fecl221.Limestone is produced from carbon.

c+o2=co2

co2+cao=caco3

22.Industrially made bleaching powder.

2cl2＋2ca(oh)2＝cacl2＋ca(clo)2＋h2o23.Bleach solution reacts with carbon dioxide.

The Ca(CLO)2+CO2+H2O=CAC3 + 2HCOs chemical equation is not backresting.

You have to understand the principle, memorize the writing rules of Liang Sen's chemical equations, and understand the change of chemical valence in the equation.

Just remember some more characteristic equations.

8nh3+6no2=7n2+12h2o；

ca（oh）2+2nh4cl=cacl2+2nh3+2h2o；

4nh3+5o2=4no+6h2o；

4hno3=4no2+o2+2h2o；(Sometimes the product of this article is N2+O2+H2O).

2hno3+6fe（no3）2=6fe（no3）3+2no+h2o；

Ammonia + nitrogen dioxide = nitrogen.

Calcium hydroxide + ammonium chloride = ammonia + water + calcium chloride.

1）nh4+no2=n2+2h2o

2）2nh4cl+ca(oh)2

cacl2+2nh3↑+2h2o

To be heated. 3) 4NH3 + 5O2 == [PT (catalyst) high temperature] ==4NO+6H2O

4) 4Hno3 (thick).

Light = 4NO2

o22h2o

5)3fe（no3）2

4hno33fe（no3)3

no2h2o

Comrade, there is no conservation of charge, ah......

Reactants: Fe2+, 2 positive charges.

Product: Fe3+ +2Cl-, 1 positive charge.

The correct one is: 2Fe2+ +Cl2 = 2Fe3+ +2Cl- Note that for redox reactions, three conservations are ensured:

1. Conservation of electric charge.

2. Conservation of elements.

3. Conservation of electrons (valence rise and fall conservation).

2fe2++cl2=2fe3++2cl-

That's right, that's right, that's the charge, the atoms are conserved.

Charge imbalance: +2 valence to +3 valence change of iron ions 1

The chloride ion 0 to -1 valence changes to 1, but the two total changes are 2

Have you ever seen ferric dichloride?

Whether it can react or not, and can write chemical equations.

Silver and dilute hydrochloric acid cannot, silver comes in after hydrogen.

Zinc and copper sulphate solution Zn+CuSO4=Cu+ZNSO4 Copper and zinc sulphate solution No, copper is after zinc.

Aluminum and silver nitrate solution Al+3AGnO3=AL(NO3)3+3AGFECl2(CuCl2) Add excess iron powder and filter. fe+cucl2=fecl2+cu

Cu(Fe) plus hydrochloric acid Fe+2HCl=FeCl2+H2 or copper sulfate solution Fe+CuSo4=FeSo4+Cu

Silver and dilute hydrochloric acid: non-reacting.

Zinc and copper sulfate solution: Zn + CuSO4 == ZNSO4 + Cu copper and zinc sulfate solution: no reaction.

Aluminium and silver nitrate solution: Al+3AGnO3 ==AL(NO3)3+3AG

FeCl2 (CuCl2): After adding excess iron powder, it is filtered, and the filtrate obtained is FeSo4 solution: Fe+CuCl2==FeCl2+Cu

Cu (Fe): After adding excess dilute hydrochloric acid, the solid obtained is Cu: Fe + 2HCl = = FeCl2 + H2

1 No, it doesn't. 2 Displacement.

3 No, you can't. 4 replacement.

Remove impurities 1 Excess iron powder after filtration 2 Dilute sulfuric acid after filtration.

zn+cuso4=znso4+cu

Al+3AGNo3=3AG+AL(NO3)3 silver and dilute hydrochloric acid, copper and zinc sulfate solutions do not react.

Add excess iron powder and filter.

Add excess hydrochloric acid and filter.

I just learned the chemical equation and feel that I have too few practice questions, I hope that the brothers will return a few chemical equations to give me a book, the more the better, thank you! Cu O2= K2Mno4 = (pyrolysis) CaCO3 HCl= CO2 Ca

a) Least common multiple method.

This method is suitable for common chemical equations that are not very difficult. For example, the number of oxygen atoms on the right is 2 and 3 on the left in the reflection formula of kclo3 kcl+o2, so the least common multiple is 6, so the coefficient before kclo3 should be matched with 2, and the formula becomes: 2kclo3 kcl+3o2, since the number of potassium atoms and chlorine atoms on the left becomes 2, then the coefficient 2 should be matched before kcl, ** is changed to equal sign, and the condition is marked as:

or Sun. 2kclo3==2kcl+3o2↑

2) Odd-even equalization.

This method is suitable for multiple occurrences of an element on both sides of the chemical equation, and the total number of atoms on both sides of the equation is odd and even, for example: C2H2+O2-CO2+H2O, and the balance of this equation starts with the oxygen atom with the highest number of occurrences first. There are 2 oxygen atoms in O2, and the total number of oxygen atoms should be even, regardless of the number of coefficients before the chemical formula.

Therefore, the coefficient of H2O on the right should be matched with 2 (if other molecular coefficients appear as fractions, it can be matched with 4), from which it can be deduced that the first 2 of C2H2 becomes: 2C2H2+O2==CO2+2H2O, from which it can be seen that the coefficient before CO2 should be 4, and the final coefficients with elemental O2 are 5, and the conditions can be specified:

2c2h2+5o2==4co2+2h2o

3) Observe the balancing.

Sometimes there will be a substance with a chemical formula in the equation, we can deduce the coefficients of other chemical formulas through this complex molecule, for example: Fe + H2O - Fe3O4 + H2, Fe3O4 chemical formula is more complex, obviously, Fe3O4 in Fe** is in the elemental Fe, O comes from H2O, then Fe is preceded by 3, H2O is preceded by 4, then the formula is: 3Fe + 4H2O Fe3O4 + H2 From this, the H2 coefficient is 4, indicating the conditions, ** Change to an equal sign:

3fe+4h2o==fe3o4+4h2↑

2h2o2=2h2o+o2

2kclo3 = manganese dioxide, heating = 2kcl + 3o22kmno4 = k2mno4 + mno2 + o22h2 + o2 = 2h2o

C+O2=ignition=CO2

2mg+o2=2mgo

co+cuo=cu+co2

h2+cuo=cu+h2o

co2+c=2co

co2+ca(oh)2=caco3+h2oco2+2naoh=na2co3+h2o

co2+naoh=nahco3

co2+caco3+h2o=ca(hco3)2cuso4+5h2o=

Reactant: O2: ignition ==CO2

Ignite ==SO2

Ignition ==2CO2

Ignition ==2h2o

Ignition ==CO2+2H2O

CO2: Reversible ==2CO

H2O: High temperature ==Fe3O4+4H2

High temperature = = H2 + Co

Spawn: O2:

High temperature = = cao + CO2

2345 with CO2 on it.