Isomers of C8H18, How many isomers of C8H18 are there?

Regardless of stereoisomerism, there are 1 species of 8 Cs, 3 species of 7 Cs (1 methyl), 1 species of 6 Cs (1 ethyl) + 6 species (2 methyl), 2 species of 5 Cs (1 ethyl + 1 methyl) + 4 species (3 methyl), and 4 C1 species on the main chain, a total of 18 species.

CH3(CH2)6CH3 octane.

CH3CH2CH2CH(CH3)CH2CH2CH3 4-methylheptane.

CH3(CH2)3CH(CH3)CH2CH3 3-methylheptane.

CH3(CH2)4CH(CH3)2-methylheptane.

ch3ch2ch2c(ch3)2ch2ch3 3,3-dimethylhexane.

CH3(CH2)3C(CH3)3 2,2-dimethylhexane.

CH3CH2CH(CH3)CH(CH3)CH2CH3 3,4-Dimethylhexane.

CH3), 2CH(CH2), 2CH(CH3)2, 2, 5-dimethylhexane.

CH3(CH2)2CH(CH3)CH(CH3)2 2,3-dimethylhexane.

CH3 CH2CH(CH3)CH2CH(CH3)2 2,4-dimethylhexane.

CH3 (CH2)2CH (CH2CH3)2 3-ethylhexane.

CH3CH(CH3)CH(CH3)CH(CH3)2 2,3,4-trimethylpentane.

CH3 CH2C(CH3)2CH(CH3)2 2,3,3-Trimethylpentane.

CH3 CH2CH(CH3)C(CH3)3 2,2,3-trimethylpentane.

CH3CH(CH3)CH2C(CH3)3 2,2,4-Trimethylpentane.

CH3C(CH2CH3)3-3-methyl-3-ethylpentane.

CH3 CH2CH(CH2CH3)CH(CH3)2-methyl-3-ethylpentane.

CH3)3CC(CH3)3 2,2,3,3-tetramethylbutane.

The answer on the 4th floor is very good, but the fourteenth should be "2,2,4-trimethylpentane", a total of 18 species, and C9H20 should be 35 species.

C8H18IsomersThere are 18 kinds. Li Bulu is as follows:

1. N-octane.

cas：111-65-9。

Methylheptane CAS: 592-27-8.

Methylheptane CAS: 589-81-1.

Methylheptane CAS: 589-53-7. , 2-Dimethylhexane.

cas：590-73-8。, 3-Dimethylhexane CAS:

584-94-1。4-Dimethylhexane CAS: 589-43-5.

5-Dimethylhexane CAS: 592-13-2. , 3-Dimethylhexane CAS:

10. Which belt 3,4-dimethylhexane cas: 583-48-2.

Ethylhexane CAS: 619-99-8. , 2,3-trimethylpentane CAS:

564-02-3。, 2,4-Trimethylpentane CAS: 540-84-1.

3,3-Trimethylpentane CAS: 560-21-4. , 3,4-Trimethylpentane CAS:

Methyl-3-ethylpentane CAS: 609-26-7.

Methyl-3-ethylpentane CAS: 1067-08-9. , 2,3,3-tetramethylbutane CAS: 594-82-1.

Isomer Properties:

The composition and molecular weight of isomers are exactly the same, while the structure, physical properties, and chemical properties of the molecules are different.

It's also not the same, like ethanol.

and methyl ether [C2H6O].

Isomers in organic matter are divided into two categories: tectonic isomerism and stereoisomerism. Having the same molecular formula but having a different order of attachment of atoms or groups in a molecule is called tectonic isomerism. In molecules, atoms bind in the same order, while atoms or clusters of atoms.

Differing in relative positions in space is called stereoisomerism.

C7H8O contains isomers of benzene rings: CH6H5-O-CH3, C6H5-CH2-OH (hydroxyl group attached to methylene), CH3-C6H4-OH (three isomers between methyl and hydroxyl neighbors).

The molecular formula of benzene is C6H6. Although benzene should show a high degree of unsaturation in terms of hydrocarbon ratio, benzene does not possess the properties of unsaturated hydrocarbons.

In general, benzene is not easy to undergo electrophilic addition reactions such as olefins, nor is it oxidized by potassium permanganate, and is prone to substitution reactions of benzene rings, such as halogenation, nitration, sulfonation, alkylation and acylation, etc., which maintain the original structure of benzene ring.

Benzene rings are commonly drawn

A benzene ring is commonly drawn as a regular hexagon with a circle inside. The circles emphasize the delocalization of the 6 electrons and the uniform distribution of the electron cloud, which explains the homogeneity of the carbon-carbon bond length and the complete symmetry of the benzene ring.

However, this method is used to refer to other aromatic systems, such as two fused benzene rings, naphthalene, which is easily misleading.

The use of circles in benzene rings to represent delocalized double bonds was proposed by the British scientist Sir Robinson) and called them aromatic hexagons. Sir was awarded the 1947 Nobel Prize in Chemistry for his contributions to the study of natural products, and he was also the first scientist to use a curved arrow to indicate the direction of electron transfer.

There are 18 isomers of C8H18, as shown in the figure below

Isomers are also known as isomers. In guessing chemistry, it refers to molecules with the same molecular formula, and the chemical bonds between atoms are often the same; But the arrangement of the atoms is different. In other words, they have different "structural formulas".

Many isomers have the same or similar chemical properties, but if they are isomers of functional groups (i.e., functional groups are different), then the chemical properties are different because the chemical properties of organic matter are mainly determined by functional groups.

The answer on the 4th floor is very good, but the fourteenth should be "2,2,4-trimethylpentane", a total of 18 species, and C9H20 should be 35 species.

It's really written, it's really persistent. C8H18 is said to have more than 90 isomerisms.

Ring-shaped ones are not considered, only straight chains are considered.

cccccccc,cccccc(ch3)2,ccccc(ch3)cc,cccc(ch3)ccc,cccc(ch3)c(ch3)2,ccc(ch3)cc(ch3)2,cc(ch3)ccc(ch3)2,ccccc(ch3)3,ccc(ch3)c(ch3)3,cc(ch3)cc(ch3)3,cc(ch3)2c(ch3)3

C8H18 (octane) isomer**:

The 18 types of octane are:

n-octane, 2-methylheptane, 3-methylheptane, 4-methylheptane, 2,2-dimethylhexane, 3,3-dimethylhexane, 2,3-dimethylhexane, 2,4-dimethylhexane, 2,5-dimethylhexane, 3,4-dimethylhexane;

3, Ethylhexane, 2,2,3 trimethylpentane, 2,2,4 trimethylpentane, 2,3,3 trimethylpentane, 2,3,4 trimethylpentane, 2-methyl-3-ethylpentane, 3-methyl-3-ethylpentane, 2,2,3,3-tetramethylbutane.