A little chemistry problem, please

NH4)2CO3 is a weak acid and alkali salt, and the hydrolysis of carbonate will promote the hydrolysis of ammonium ions, so that the ammonium ions will be reduced. The (NH4)2SO4 is a strong acid and weak alkali salt, and sulfate has no effect on the hydrolysis of ammonium ions, so the former is greater than the latter.

Sulfuric acid is a strong acid, ammonium sulfate is a strong acid, basically completely ionized, and the solution is weakly acidic (because ammonia is a weak base).

While carbonic acid is a weak base, ammonium carbonate is not completely ionized in solution, and when it reaches equilibrium, the concentration of NH4+ is definitely lower than the concentration of NH4+ in ammonium sulfate.

Both solution concentrations are both. But (NH4)2SO4 is a strong electrolyte, completely ionized, and the concentration of NH4+ is.

Whereas, (NH4)2CO3 is a weak electrolyte, and only a part of it can be ionized. The concentration of NH4+ must be less than.

The former is completely ionized and the latter is ionized in steps.

In other words, NH4CO3 is alkaline, and NH4+ and OH- also need to form ammonia monohydrate, so the former is larger.

The former is a strong acid and weak alkali salt, although the ammonium will be hydrolyzed, but it is not affected by sulfate, the latter is a weak acid and weak alkali salt, which promotes the hydrolysis of each other, and the degree of ammonium hydrolysis is greater and the concentration is lower.

Depending on the degree of hydrolysis, the former is a strong acid and weak alkali salt, and the latter is a weak acid and weak alkali salt. Among them, NH4+ can combine with water molecules to form NH3·H2O and H+, and because carbonate inhibits the hydrolysis of ammonium ions, the concentration of ammonium ions in ammonium sulfate is larger.

NH4) 2CO3 has a partial decomposition and exists in the form of NH3 and H2CO3!

Potassium permanganate and potassium chlorate are both negative bivalent, to oxygen oxygen is zero valent, so it must lose four moles of electron traces, while in hydrogen peroxide oxygen is negative monovalent, to zero finch vertical valence needs to be a spike to lose two moles of electrons, so it is 4:4:2, about 2:2:1

According to the chemical reaction equation.

3co+fe2o3==2fe+3co2

CO2 + Ca(OH)2 = CaCO3 + H20 Here CaCO3 is generated

So n(caco3)=n(co2)=m(caco3) m(caco3)=

So the iron is reduced.

CO2 + Ca(OH)2 = CaCO3 (precipitation) + H2O, then CO2 is grams, 3CO+Fe2O3=3CO2+2Fe, then Fe is grams.

I guess I'm not mistaken.

The precipitate is calcium carbonate and the molar mass is.

3CO+ 2Fe2O3 High temperature 4Fe + 3CO2 reduced ferric oxide:

Restore the iron generated:

Hello landlord!

Hey......That ......What does the landlord mean by not learning???

Forget it, let's put it simply, first of all, as the title says, "reduce ferric oxide with a sufficient amount of carbon monoxide", "sufficient", that is, Fe2O3 all becomes Fe, then write the reaction equation 3CO + FE2O3 == 2FE + 3CO2, well, what is that......If the building is strong enough, it should be found that all the O's in Fe2O3 go to Co, that is, Co + O Co2, and each Fe2O3 provides three O's, so the number of Co will be three times that of Fe2O3, that is, the number of Fe2O3 will be one-third of Co, then, there are two Fe in a Fe2O3, so the number of Fe will be two-thirds of Co, and everyone's 2 3 refers to this.

As for 56, that is the relative atomic mass of iron, in fact, it should be , but it is generally simplified to 56 for convenience.

Well, solve the problem! Just like the method used above, all the C in CO2 goes to CaCO3, that is, CO2 and CaCO3 are 1:1, so ......Obviously, if there is a caco3, there is a co2, there is a co, and the number of fe will be two-thirds of the co, then n(caco3)=n(co2)=n(co)=m(caco3) m(caco3)=,n(fe)=,m(fe)=n(fe)m(fe)=2 3n(co)m(fe)=,uh......Can I understand what I said...... landlord?I don't know where the landlord has learned, so I don't think it's easy to say, let's do it first, if the landlord has a problem, let's talk about it.

The precipitate is CaCO3 ( x (2 3) x 56 = g

Let's figure out the above formulas for yourself.

Uh·· Let me tell you.

1: When there is an excess of CO, the FE element is completely reduced to 0 valence 2: When there is an excess of ferric oxide, FE can only be reduced to 8 3 valence, according to what you said is the first case.

The chemical equation goes like this: one. 3CO+Fe2O3=2Fe+3CO2II.

CO2 + Ca(OH)2 = CaCO3 + H2O In other words, being oxidized means that the valency of that atomic element has increased, and being reduced is reduced So looking at an equation, the iron produced is reduced.

You calculate the mass of the carbon dioxide participating in the reaction based on the mass of the precipitated caCO3 molecule in equation 2, and then you can calculate the mass of the reduced iron in equation 1

Of course, you can also use the valency method to calculate.

According to the ratio of the mass of gold in the C complex and the amount of magnesium and aluminum substances obtained from (3), the aluminum in it can be obtained, and the solute in the filtrate obtained when the aluminum powder is completely dissolved is only NaCl and Naalo2, and the amount of its substances and the volume of the NaOH solution can be obtained according to the atomic conservation of Cl and Al, and its concentration can be obtained finally.

The stone stood for two months, playing an element.

A and B can be converted into each other, B is generated in boiling water to C, C is oxidized in the air to D, D has the smell of rotten eggs.

Answer = = Eggs, Chickens......Needless to say, it's very old, but it's interesting......

Fe3O4 + 4Co = High temperature = 3Fe + 4CO2 The part of the solid mass that decreases.

x 10-8=2g

232：x=64：2

x = mass fraction of ferric tetroxide in magnetite samples =

The weight reduction is due to the combination of oxygen in ferric tetroxide with CO to form CO2

The reduced mass of the solid is the mass of the reactant carbon dioxide, and the mass of ferric tetroxide can be calculated as 29 11 and the mass fraction is 29 11 10*100%=26% by eliminating the equation

Let's assume that there is XGFE3O4 in the sample

Fe3O4+4Co=High temperature=3Fe+4CO2x 8 then there is x=1x8 3 And from the title, it can be seen that the mass of the solid substance after full reaction is 8g, which is solid iron.

So the mass fraction of ferric tetroxide in the magnetite sample = 8 3x10=

Use the difference method. Fe3O4+4Co-->3Fe+4CO2 difference.

x 2 x=

That is, Fe3O4 is, and the impurity is Fe3O4 in the sample

bbaadabb

Small Small Low Solid Silvery-white with metallic luster Lively (should be na) Red solid Black solid Colorless liquid Colorless liquid White solid Colorless gas Silvery-white solid White solid.

Magnesium can burn indicates that magnesium has this property, and being burning indicates a state.

Magnesium strips can emit dazzling white light when burned in the air, and I personally think that we should pay attention to safety, because the burning temperature of magnesium strips is very high, I remember that doing thermite experiments is to ignite magnesium to meet high temperature conditions Also, protect your eyes!

(1) A: Solubility decreases with the increase of temperature, such as: Ca(OH)2

b: Solubility increases significantly with the increase of temperature, such as kno3

C: The solubility does not change significantly with the increase of temperature, such as NaCl

2) a>c>b Raise the temperature and lower the temperature.

3) Where is point m? Is it above the A-curve and below the B-curve? If yes, answer as follows:

Saturated, unsaturated, saturated.

If not, think for yourself, it's simple.

4) A b solubility 40

5) b a6) 16g 18g 18g unsaturated saturated saturated.

7) Heating up crystallization (or evaporation crystallization) Evaporation crystallization.

8) Cooling crystallization Evaporation crystallization.

9) Add an appropriate amount of substance C to the solution, heat the solution, and evaporate the solvent at a constant temperature.

Whew,Finally answered.,I'm tired.,Although there are a lot of questions.,But it's not too difficult to return.,It's better to do it yourself in the future.。

By the way, the increase in the solubility of a substance mentioned in question (2) is actually unscientific, as long as the temperature does not change, the solubility cannot be changed.

Oh no, I just said that in question (1), besides, isn't the way to change solubility is to change the temperature? lz ignored my words, okay, it may be a smoke for a while.

By the way, I'm not sure about the first empty answer to question (7), theoretically Ca(OH)2 type substances, from their solution to get solute, are all by cooling crystallization, but I think evaporation crystallization is not impossible, because cooling crystallization can not get as much solute as possible.

(1) A: The solubility decreases with the higher the temperature B: The solubility increases rapidly with the increase of temperature, and C: The solubility increases steadily with the increase of temperature.

2) a>c>b reduce the temperature and increase the temperature (3) a saturated b unsaturated c saturated.

4) A and B are the same, both are 40

5) Up to b without a

6) 16g 18g 18g unsaturated, saturated, saturated, (7) evaporative, cooled.

8) The solution is heated to T3 first, and then cooled to T2, and the crystalline solution of B is cooled below T1.

9) Heat solution A.

The first hail is the first question, choose A, because B can combine with hydrogen ions and easily release chlorine gas.

c is a reducing ion that can react with ferric iron to produce iodine elemental and divalent source pure iron ions.

The second question is not that concentrated sulfuric acid does not react with aluminum, but reacts with aluminum to form alumina, which is a dense substance, which can prevent concentrated sulfuric acid from reacting with aluminum step by step, so concentrated sulfuric acid can be loaded with aluminum tankers.

The reaction between dilute sulfuric acid and aluminum is the same as everything else, releasing hydrogen.

1. A Because there is no intermediate valence state between ferric ions and ferric ions, there will be no redox reaction.

Hypochlorite and hydrogen ions combine to form hypochlorous acid.

The iodine ion has strong reducing property, and the trivalent iron ion has strong oxidation, and the redox reaction will occur.

2. The product of the reaction between aluminum and concentrated sulfuric acid blocks the reaction between concentrated sulfuric acid and aluminum, which is also called stove passivation.

Dilute sulfuric acid and aluminum react to produce aluminum sulfate and hydrogen.