Physical Sciences. Is conservation of matter correct?

Conservation of energy is a universal law of nature.

Conservation of matter (or mass) is a special form of conservation of energy. According to Einstein's mass-energy equation: e=mc, a certain mass of matter is equivalent to a certain amount of energy. So as long as energy is conserved, mass is also conserved.

As for what you call a substance that does not absorb light at all (or a complete reflector), there is no such thing as nature.

Congratulations, classmates, you can see from your question that you are a person who is good at thinking and likes to think. This is very good, Einstein, Newton and other great scientists were representatives of whimsy. You can study hard, work these things, and gradually improve your understanding of the wonders of nature by thinking on your own.

The universe is wonderful, nature is wonderful, and you and I sometimes can't fathom it. Humans are constantly creating new theories to replace old ones, so even a great law may be overturned by new discoveries in the near future. Therefore, the wonders and unfathomableness of the universe need to be practiced by themselves.

Wishing you success.

Light is still inconclusive, but it is said that it has the properties of particles and waves, and heat is a kind of wave, that is, the vibration of particles.

The law of conservation of energy (condition: the total energy of a closed (isolated) system remains constant), the law of conservation of momentum (condition: the system is not subject to external forces), the law of conservation of angular momentum (condition: an object can be used as a particle).

1. The law of conservation of energy.

The energy conservation law, also known as the first law of thermodynamics, states that the total energy in a closed (isolated) system remains constant. Generally speaking, the total energy is no longer just the sum of kinetic energy and potential energy, but the total amount of rest energy (intrinsic energy), kinetic energy, and potential energy.

The law of conservation of energy can be expressed as follows: the change in the total energy of a system can only be equal to the amount of energy transferred to or from the system. The total energy is the sum of the mechanical energy, thermal energy, and any form of internal energy other than thermal energy of the system.

2. The law of conservation of momentum.

A system is not subject to an external force or the resultant external force is zero, and the momentum of the system remains the same. i.e. δp1 = -δp2

Scope of application: 1. The system is not subject to external force.

2. The system is subjected to external forces, but the sum of external forces is zero.

3. The system is subject to external forces, but the internal forces are much greater than the external forces, such as collisions.

4. The system is subjected to an external force and the resultant external force is not zero, but the resultant external force in a certain direction is zero, then the momentum in that direction is conserved.

3. The law of conservation of angular momentum.

For a particle, the angular momentum theorem can be expressed as follows: the microquotient of the angular momentum of the particle to the fixed point to the time is equal to the moment of the force acting on the particle.

One of the fundamental laws of nature. In any system of matter that is isolated from its surroundings (an isolated system), its total mass remains the same regardless of the changes or processes that occur. The law of conservation of matter is that matter does not disappear and does not come into being, but can only be transformed into another by one substance.

The law of conservation of matter says that matter does not come into thin air, but only transforms from one form to another.

1 The early "law of conservation of mass" (before the mass-energy relation).

In a chemical reaction, the sum of the masses of the substances before participating in the reaction is equal to the sum of the masses of the substances produced after the reaction. This law is called the law of conservation of mass. In any system that is isolated from its surroundings, the total mass remains the same, regardless of the changes or processes that occur.

In other words, any change, including chemical reactions and nuclear reactions, cannot eliminate matter, but only change the original form or structure of matter, so this law is also called the law of immortality of matter. It later evolved into one of the universal fundamental laws of nature.

The process of chemical reaction is the process of recombining the atoms of each substance (reactant) participating in the reaction to form other substances. In a chemical reaction, the type of atoms does not change before and after the reaction, the number does not increase or decrease, and the mass of the atoms does not change.

2 "The Law of Conservation of Energy".

3 Albert Einstein's "mass-energy relation".

4 "Conservation of Information".

Dr. Einstein had a formula: energy = mass * speed of light squared. Here, the mass is completely annihilated and converted into energy.

Can we say that when we open the time tunnel, our space will exchange matter and energy with another space, and if a person passes through the time tunnel to another space, then the other space will throw a large amount of energy into this space.

The following equilibrium is present in the solution.

Charge balance (Na+ )H+) HCO3- +OH- +2*(CO3 2-) 1).

Conservation by material na+ =HCO3- +CO3 2-) H2CO3 (2).

1)-(2), the proton conservation is obtained by shifting the term c(h+)+c(h2CO3)=c(CO32-)+c(oh-).

Proton conservation is the same number of protons and bases lost by acid, and the conservation of protons and materials and charge are the same as the three ridges in solution.

How can it be the same?

One speaks of energy, the other of matter!

In chemistry, the immortality of matter means that the substance will not disappear out of thin air, and chemical change is the process of changing a substance into another substance.

Conservation of energy means that energy does not disappear in a vacuum, it is transformed from one form of energy to another.

In addition, matter and energy can be converted into each other, for example, mass loss in nuclear reactions is the process by which matter is converted into energy.

The transformation obeys the e=mc2 equation.

Conservation of charge: c(nh +) c(h+) = c(oh-) + c(cl-).

Conservation of materials: C(NH HO)+C(NH+)2C(Cl-).

Conservation of protons: C(H+)+C(Cl-)=C(NHH HO)+C(OH-).

The conservation of materials, the conservation of electric charge, and the conservation of protons are the same as the three major conservation relationships in solution.

The conservation of charge, the conservation of materials, and the conservation of protons are the same as the three major conservation relationships in solution.

1. The algebraic sum of the positive and negative valency of the elements in the compound is zero.

2. It means that the solution must be electrically neutral, that is, the number of charges carried by all cations in the solution is equal to the number of charges carried by all anions.

3. In addition to the six strong acids and the three strong bases, they are all hydrolyzed, and the multiple weak acids are partially hydrolyzed. There is a partial hydrolysis product in the product.

4. What is the number of charges carried by this ion, and how many are written before the ions.

There are three laws of conservation: the law of conservation of energy du (including the law of conservation of mechanical energy), the law of conservation of momentum, and the law of conservation of momentum at special angles.

Conservation of mechanical energy The total amount of kinetic energy and potential energy is conserved.

And the conservation of energy includes all energy, including heat, and so on.

Therefore, the range of conservation of energy is larger than the range of conservation of mechanical energy, and mechanical energy is a manifestation of a form of energy, and conservation of mechanical energy is also a manifestation of conservation of energy. The range of use of conservation of energy is larger than that of conservation of mechanical energy, but sometimes it is easier to solve a specific problem using specific mechanical energy.

If a system is not subjected to an external force or the vector sum of the external forces is zero, then the total momentum of the system remains the same, and this conclusion is called the law of conservation of momentum.

It might be better to make an analogy:

The conservation of momentum should still be quite clear, right? So for a system, if there is no resultant force, momentum is conserved. So for a system, if there is no resultant moment, the angular momentum is conserved.

The conservation of angular momentum is in rotation"Momentum is conserved"For the contraction of the nebula, I personally believe that it cannot be explained by the conservation of angular momentum alone. (But for nebulae, the gravitational force for their moment is zero, so angular momentum is conserved.) ）