What are the sources of polymer monomers and polymer monomers

It is true that these two are not the same, and this must be paid attention to when writing about polymer monomers.

The corresponding polymer is expressed in the former equation as -[-ch2ch2ch2ch(ch3)-]n)-(you hit something wrong, right?) A carbon is as many as 4 bonds), and then you have to understand that the polymer is so repeated that the end groups at both ends are not important, so it can be expressed in this way, and the other important thing is that the polymer is actually a mixture, so that "n" is indeterminate, it represents a series of the substances.

Then the polymer corresponding to the latter equation is -[-ch2ch2ch(ch3)ch2-](n)-, then compared with the same analogue, then assuming that the n of the upper and lower classes of substances is the same and the end groups are the same, if you express their chemical formulas, you will find that they are two completely different substances, so these two expressions do not express the same class of substances.

In addition, the monomer is also a reflection of how the polymer is formed, like -ch2-ch2-ch2-ch2-ch(ch3)- The original substance reflected can be H2C=chch=chch3 (denoted A), and the latter can be H2C=CHC(ch3)=ch2 (denoted B), but these two cannot be exchanged, that is, -ch2-ch2-ch2-ch2-ch(ch3)-cannot reflect the original substance as H2C=CHC(CH3)=CH2, The other one is the same.

That should be understood, right? I don't know if it's clear.

In fact, it's just a truncated difference.

ch2-ch2-ch2-ch2(ch3)-ch2-ch2-ch2-ch2(ch3)-ch2-ch2-ch2-ch2(ch3)

This is a polymer segment, if you take 4 from the first C, the monomer is (-ch2-ch2-ch2-ch2(ch3)-).

If 4 are taken from the second c, the monomer is (-ch2-ch2-ch2(ch3)-ch2-).

The way to take it is not the same.

Same. What is written is only a part of the polymer monomer.

The position of the methyl group is the same here.

If the leftmost carbon of (-ch2-ch2-ch2-ch2(ch3)-) is numbered as carbon three, then the methyl group is on carbon six.

ch2-ch2-ch2(ch3)-ch2-) here puts the leftmost number four, and the methyl group is still on carbon six.

A large number of polymer compounds used as materials in the world are made from coal, oil, natural gas, etc. as starting materials to produce low-molecular organic compounds, and then polymerization reactions. These low-molecular compounds are called "monomers", and the polymer compounds formed by their polymerization reaction are also called polymers. Polymerization reactions are usually divided into two categories: addition polymerization and condensation polymerization, referred to as addition and polycondensation.

For some compounds containing unsaturated bonds (double bonds, triple bonds, and conjugated double bonds) or cyclic low-molecular compounds, under the action of catalysts, initiators or radiation, the reaction of the same monomer to form a new covalent bond linked macromolecule is the polyaddition reaction. The reaction of the polymerization of the alkene monomer by the addition of the pei. There are no by-products in the polyaddition reaction.

<> is the product of the reaction of Jiachunqing Qiju Paoling, the main carbon chain contains two C, the number of different grinding machine monomers is only one substance, the middle bracket is removed, and then the two half bonds are closed, and the monomer of the polymer compound can be obtained: CH3C(CH3)=CHH3, so C

Answer]: Repeating unit: The smallest unit of the same composition in the polymer.

Structural unit: The combination of atoms that make up the polymer chain and determine the polymer structure, and are connected in a certain way.

Monomer unit: The dust suppression unit in the polymer has the same chemical composition and different electronic structure as the monomer.

Monomers: low-molecular compounds that form the structural units of high-molecular compounds.

Degree of polymerization: The number of repeating or building blocks that make up a polymer.

A large number of repetitive molecular units form macromolecular compounds.

According to the Encyclopedia, polymers refer to macromolecular compounds formed from a large number of repetitive molecular units. They can have a wide range of structural types, and their properties are influenced by the type and morphology of the molecule. In most cases, polymers are made up of many molecular units of the same type.

For example, polyvinyl chloride (PVC) is made up of vinyl chloride molecular units that are linked, while polyhydrogels are made up of aqueous molecular units that are linked. In some cases, polymers can be formed by cross-linking, for example, polylactic acids are formed by cross-linking lactic acid molecules.

Polymers can be divided into two categories: organic polymers and inorganic polymers. The molecular units in organic polymers are usually organic molecules, which are organic molecules that contain carbon, such as fatty acids and aromatic compounds. Inorganic polymers are a class of substances that do not contain carbon, and their molecular units are various inorganic substances other than organic matter.

A polymer is a chemical compound in which its molecules are held together in a long repeating chain.

Polymer Profile:

The science of polymer synthesis is a good way to control the performance of bulk polymer samples. However, in biotechnology, nanotechnology, and all forms of coating applications, the surface interaction of polymer substrates is an essential area of research. In these cases, the surface properties of the polymer and the material, as well as the resultant force between them, largely determine their usefulness and reliability.

For example, in biomedical applications, the physical response to a foreign body and therefore its biocompatibility is controlled by surface interactions. In addition, surface science is an integral part of coating formulation, manufacturing, and application.

Introduction to Chemistry:

Chemistry is a basic natural science that studies the composition, structure, properties, transformation and application of matter at the atomic and molecular levels. It originates from life and production practices, and continues to evolve with the progress of human society.

Different from particle physics and nuclear physics, which study smaller scales, the material structure of atoms, molecules, and world-wide ions (clusters) in chemistry, as well as the interaction between chemical bonds and intermolecular forces, are located at the scale closest to the macrocosm in the microscopic world, so their natural laws are also most closely related to the physical and chemical properties of substances and materials in the macrocosm of human existence.

As an important bridge between the microscopic and macroscopic material worlds, chemistry is one of the main methods and means for human beings to understand and transform the material world.

Chemistry is a natural science that studies the composition, structure, properties and changes of matter at the atomic level, which is also the core basis of chemical change. Chemistry is a natural science based on experiments. The Chinese word "chemistry", if the single family returns to Xiang, is literally interpreted as "the science of change".

Chemistry, like physics, is the basic science of natural science. Mendeleev's periodic table of chemical elements greatly contributed to the development of chemistry. Nowadays, many people call chemistry the "central science" because chemistry is at the heart of some scientific disciplines, such as materials science, nanotechnology, biochemistry, etc.

There are five sub-disciplines under modern chemistry: inorganic chemistry, organic chemistry, physical chemistry, analytical chemistry and polymer chemistry.

Polymers are macromolecular compounds made up of many repeating units.

Polymers are polymer compounds formed by covalent bonding of many repeating units, also known as polymeric locust units. These repetitive units can be the same or different of them, joining them together through chemical reactions to form long chains or network structures. Common polymers include plastics, rubber, and fibers.

Polymers have unique physical and chemical properties, such as elasticity, heat resistance, plasticity, and corrosion resistance, so they are widely used in a variety of fields, including industrial, medical, construction, and various products in daily life.

1. Unsaturated alcohols: such as glycerol, ethanol, propanol, etc.; 2. Unsaturated acids: such as ethylene oxide, propylene oxide, etc.; 3. Unsaturated carboxylic acids:

For example, acrylic acid, oleic acid, etc.; 4. Unsaturated esters: such as styrene, butadiene, etc.; 5. Unsaturated cyclic alcohols: such as carbon dioxide, methane, ethane, etc.; 6. Others:

For example, chlorinated propylene, naphthenes, etc. Well, that's the end of mine, I hope it helps you, thanks!

For example, the liquid god is in deficit with glycerin, ethanol, propanol, etc.; 2. Unsaturated acids: such as ethylene oxide, propylene oxide, etc.; 3. Unsaturated carboxylic acids: imitation such as acrylic acid, oleic acid, etc.; 4. Unsaturated esters:

For example, styrene, butadiene, etc.; 5. Unsaturated cyclic alcohols: such as carbon dioxide, methane, ethane, etc.; 6. Others: such as chlorinated propylene, naphthenes, etc.

Well, that's the end of mine, I hope it helps you, thanks!

Excuse me, but please go into more detail?

For example, the liquid god is in deficit with glycerin, ethanol, propanol, etc.; 2. Unsaturated acids: such as ethylene oxide, propylene oxide, etc.; 3. Unsaturated carboxylic acids: imitation such as acrylic acid, oleic acid, etc.; 4. Unsaturated esters:

For example, styrene, butadiene, etc.; 5. Unsaturated cyclic alcohols: such as carbon dioxide, methane, ethane, etc.; 6. Others: such as chlorinated propylene, naphthenes, etc.

Well, that's the end of mine, I hope it helps you, thanks!

There are many types of polymerizable monomers with two carboxyl groups, and here are some of the common polymerizable monomers:

1.Acrylic acid: the molecular formula is C3H4O2, has two carboxyl groups, and is one of the monomers commonly used in polymer production.

2.Linoleic acid: The molecular formula is C18H32O2, contains two carboxyl groups, is an important fatty acid, and can also be used as a monomer of biodegradable polymers.

3.Maleic acid: the molecular formula is C4H4O4, containing two carboxyl groups, which can be copolymerized with monomers such as acrylic acid and used to prepare various resins, coatings, etc.

4.Crotonic acid: The molecular formula is C10H16O4, containing two carboxyl groups, is a natural product that can be used as a monomer of biodegradable polymers.

5.Polylactic acid dicarboxylic acid: the molecular formula is (C3H4O2)2(C6H8O4)N, which is a polymer monomer containing two carboxyl groups, which can be used to prepare various biodegradable polymers.

Of course, there are many other copolymerizable monomers containing two carboxyl groups, but here are just a few of the more common ones.

1. Two antelope-based plex-burning polymerizable lead Zhengqin monomers include polyvinyl alcohol (PEG), which is a kind of alkyl ethanol, which is a well-known "water-soluble Huaibi oil";

2. The other is polylactic acid (PLA), which is a plant-based polylactic acid that can also be used as a polymerizable monomer. It can be used to prepare polylactic acid fibers, which are used to prepare various types of fiber fabrics, such as cotton, wool and man-made fibers;

3. In addition, polyacrylamide (PA) is also a polymerizable monomer, which is an olefin amide, which can be used to prepare polyacrylamide fiber, which is a strong material that can be tensile and can be used to manufacture a wide variety of fabrics and clothing, such as shirts, pants and sportswear;

4. Finally, polyethylene (PE) is also a polymerizable monomer, which is an olefin-based polyethylene that can be used to prepare polyethylene fibers, which can be used to prepare a wide variety of fabrics and clothing, such as shirts, coats and sportswear.