-
Anonymous users2024-02-07Common chemical equations, common chemical equations can be summarized according to the unit, simply write down:
In addition to this, two very important reactions are missing, which are also non-four basic reaction types:
Deterioration of sodium hydroxide: CO2 + 2NaOH NA2CO3 + H2O;
Laboratory CO2 Testing:
CO2 + Ca(OH)2 CaCO3 + H2O, with a precipitation sign after CaCO3.
-
Anonymous users2024-02-06As follows:
1. Fe(OH)3 iron hydroxide, reddish-brown precipitate.
Soluble alkali reacts with iron salt solutions, such as sodium hydroxide and iron sulfate to form iron hydroxide and sodium sulfate
6NaOH+Fe2(SO4)3==2Fe(OH)3 +3Na2SO42, Cu(OH)2 copper hydroxide, blue precipitate.
Common chemical equations.
CuSO4+2NaOH==Na2SO4+Cu(OH)2 CuCl2+2CaOH==Cu(OH)2 +2CaCl3, CaCO3 calcium carbonate, white precipitate.
Common chemical equations.
Ca(OH)2+CO2==CaCO3 +H2O4, BaCO3 barium carbonate, white precipitate.
Common chemical equations.
na2co3+bacl2==2nacl+baco3↓<>
5. AGCL silver chloride is hypothetical and white precipitate.
6. Baso4 barium sulfate, white precipitate.
These two precipitates are neither soluble in water nor soluble in acid!
Chemical equations that are commonly sold in manuscripts.
Ag2SO4 + BACL2==2AGCL +BASO4 7, mg(OH)2 magnesium hydroxide, white precipitate.
Common chemical equations.
MgCl2+Ca(OH)2==CaCl2+Mg(OH)2 8, Ag2CO3 silver carbonate, white precipitate.
Common chemical equations.
AG2CO3+2HNO3=2AGno3+H2O+CO2 The above content reference: Encyclopedia - chemical formula.
-
Anonymous users2024-02-05The commonly used chemical equations in junior high school are as follows:1. Decomposition reaction.
1. Water decomposes under the action of direct current: 2h20 = 2h2 + o2.
2. Heating basic copper carbonate: Cu2(0H)2CO3=2CuO+H2O+CO21.
3. Heating potassium chlorate: 2kc1o3=2kcl+3o2.
4. Heating potassium permanganate: 2kmNO4=K2MNO4+MNO2+021.
5. Oxygen from hydrogen peroxide: 2H2O2=2H2O+O21.
6. Carbonic acid is unstable and decomposes: H2CO3=H2O+CO21.
7. High-temperature calcined limestone: caCO3=cao+CO2.
2. Redox reaction.
1. Hydrogen reduction of copper oxide: H2+CuO=Cu+H20.
2. Reduction of copper oxide by charcoal: C+2CuO=2Cu+CO21.
3. Coke reduced iron oxide: 3C+2Fe203=4Fe+3CO21.
4. Coke reduction of ferric tetroxide: 2C+Fe304=3Fe+2CO2.
5. Carbon monoxide reduction copper oxide: co+cuo=cu+CO2.
6. Carbon monoxide reduces iron oxide: 3CO+FE203=2FE+3CO2.
7. Carbon monoxide reduction of ferric tetroxide: 4CO + FE304 = 3FE + 4CO2.
1. Zinc and dilute sulfuric acid: Zn + H2SO4 = ZnSO4 + H2 2, iron and dilute sulfuric acid: Fe + H2SO4 = FeSO4 + H2 3, magnesium and dilute sulfuric acid: >>>More
Search it: Please write out all the gas chemical equations on the third year of junior high school, as long as the decomposition reaction, add the text equations, thank you.
Hey, I don't even want to write about it, didn't you learn all this in the academy?
Several basic laws of chemical reactions, the law of conservation of mass, the law of conservation of atoms, the law of conservation of energy, these three laws are all introduced in your textbooks, and I won't talk nonsense here. >>>More
1. In general, find a relatively single element, that is, it appears in a substance before the reaction, and appears in a substance after the reaction, if there is an odd number and an even number, it will be flattened according to the odd number, which is the front of the odd number *2 If there is still a fraction in the result *4 >>>More