Ionization equations for sodium bicarbonate and nitric acid, etc.

My friend, I don't think what you want is the ionization equation, but the "ionic reaction equation" of these groups of substances reacting with each other, because most of what you wrote here is that it cannot be ionized, but ionic reactions can occur.

1.Sodium bicarbonate vs. nitric acid:

hco3-)+h+)=h2o+co2↑

2.Chlorine and water:

cl2+h2o=(h+)+cl-)+hclo3.Calcium carbonate and acetic acid:

caco3+2ch3cooh=(ca 2+)+2ch3coo-)+h2o+co2↑

4.Sodium peroxide and water:

2na2o2+2h2o=(4na+)+4oh-)+o2↑

Ionization equation.

nahco3=na+ +hco3-

hno3=h+ +no3-

You don't want ion equations???

cl2+h2o=hclo+h+ +clo-caco3+2ch3cooh=ca2+ +h2o + co2+ 2ch3coo-

2na2o2+2h2o=4na+ +4oh- +o2

Sodium bicarbonate and nitric acid: (HCO3-)+H+)=H2+CO2 chlorine and water:Cl2+H2O=(H+)+Cl-)+HCOcalcium carbonate and acetic acid:

caco3+2ch3cooh=(ca2+)+2(ch3coo-)+h2o+co2

Sodium peroxide and water: 2Na2O2+2H2O=2NaOH+O2

The equation for the ionization of sodium carbonate in water is: Na2CO3 = 2Na+ +CO32-.

Sodium carbonate ionizes in a very small amount in water, and the degree of hydrolysis is greater than the degree of ionization, and the hydrolysis equation is:

co3 2- +h2o = hco3- +oh-。

hco3- +h2o = h2co3 + oh-。

h2co3 = h+ +hco3-。

hco3- =h+ +co3 2-。

Introduction to Sodium Carbonate:

Sodium carbonate is an inorganic compound with the molecular formula Na2CO3 and molecular weight. The purity of chemicals is mostly above (mass fraction), also known as soda ash, but the classification belongs to salt, not alkali. Also known as soda or soda ash in international **.

It is an important inorganic chemical raw material, mainly used in the production of flat glass, glass products and ceramic glaze. It is also widely used in household washing, acid neutralization, and food processing.

Sodium bicarbonate ionization equation: NaHCO3=Na++HCO3-. There are two steps of ionization, the first step is ionization into Na+ and bicarbonate ions, and then the bicarbonate is partially ionized into H+ and carbonate ions.

Sodium bicarbonate decomposes easily when heated. Slowly decomposes in moist air. At about 50 the reaction begins to form CO, and at 100 all becomes sodium carbonate.

It is rapidly decomposed in weak acid, and its aqueous solution begins to decompose carbon dioxide and sodium carbonate at 20, and all decompose at the boiling point. The solution made of cold water without agitation only reacts slightly alkaline to phenolphthalein test strips, and its alkalinity increases when placed or raised at a higher temperature.

The ionization chemical equation for sodium bicarbonate is given below:

NaHCO=Na+HCO (Condition: Ionization).

Sodium bicarbonateThe equation for the chemical reaction with sodium hydroxide solution is given below

nahco₃+naoh=na₂co₃+h₂o

Sodium bicarbonate with sodium hydroxide solutionIonic reactionsThe equation is as follows:

hco₃⁻+oh⁻=co₃²⁻h₂o

The ionization equation for sodium bicarbonate is: NaHC=Ionization=Na++HCO3

Sodium bicarbonate, chemical formula Nahco, commonly known as baking soda. White fine crystals, less soluble in water than sodium carbonate.

1. Equation for the reaction of sodium bicarbonate and acid.

Reaction with HCl: NaHCO+HCl=NaCl+HO+Co.

Reaction with Ch Cooh: NaHCO+CH COOH=CH Coona+HO+Co.

2. Reaction equation between sodium bicarbonate and alkali.

Reaction with sodium hydroxide: NaHCO +Naoh=NaCO+HO.

Reaction with calcium hydroxide: The dose of calcium hydroxide is divided into excess and small amounts.

NaHCO3) in small amounts: NaHCO+Ca(OH) = CaCo+NaOH+HO.

Overdose: 2NaHCO+Ca(OH) = NaHCO+CaCo+2HO.

3. Reaction equation between sodium bicarbonate and salt.

Reacts with CACL: Cannot react.

Reaction with CuSO4: basic copper carbonate and sodium sulfate are generated.

4. Sodium bicarbonate hydrolysis equation.

Double hydrolysis with aluminum chloride: 3NaHCO+ALCL ==AL(OH)3CO+3NaCl.

Double hydrolysis with aluminum sulfate: Al(SO)6NaHC==3NaSO+2Al(OH)6CO.

5. Sodium bicarbonate heating equation.

Thermal decomposition: 2naHCo==naco+hO+co.