Please give some examples of how chemistry has benefited humanity

It's a lot. "Burning for heating" in daily life, taking pills when you are sick, manufacturing plastic products, and certain clothes, all make use of chemical knowledge.

Eat: potassium sorbate, edible preservatives, are now industrially produced, so that many cooked meat foods such as ham sausages, kimchi foods, etc. can be stored for a long time, which is convenient for people who are far away from the place of origin to eat.

Food colorings such as brilliant blue are also industrially produced, which makes our drinks colorful and much more energetic.

Chemical analysis makes us know that Indian ancient craft ceramic tableware contains lead, which will poison people, so we no longer use Indian ancient craft ceramic tableware to eat, so as to avoid a large number of people in India, West Asia and Europe because of tableware food poisoning.

Finally, let's take a relatively new example, water quality testing. At present, trace elements are generally measured by capillary electrophoresis to strictly prevent poisoning or malnutrition caused by drinking water.

Wear: Various synthetic fibers of petrochemical industry, products of polymer chemistry, are still the first in the wear resistance of various textile raw materials, and can be industrially mass-produced, which greatly enriches our wearing resources.

Nowadays, clothing dyes are generally industrial products. The development of chemical knowledge in this area makes our clothes colorful.

The antiseptic balls in the wardrobe, whether mothballs or p-dichlorobenzene, are industrial products.

Residence: I am very surprised that the current buildings of human beings, especially urban buildings, are almost all industrial products, and there are no traces of nature. From glass, cement, steel, to plastics, they are all products made of technological achievements in chemical science.

Here are a few things that you don't usually think of.

Nowadays, wall coatings are generally industrial products, color, wear-resistant, waterproof, and many handmade limes can not match the excellent performance.

Today's panel furniture, whether it is the glue used in a large number of panels, or the surface material, is an industrial product. Even if it is solid wood furniture, coatings are mostly industrial products.

"Industry" above refers to the chemical industry.

There are more, such as cleaning water with activated carbon, disinfection with hydrogen peroxide, and synthesis of organic polymer plastics...

Abound.

Original. Child.

Bullets are examples of physical killing of humans, referring to the original.

Child. The bullet is Einstein, and Einstein is the physicist.

It can be said that among all kinds of synthetic drugs, medicinal chemistry is the most beneficial to mankind.

Batteries, petroleum refining, chemical fibers, daily chemical products. A lot.

The large use of aluminum is a contribution of chemistry.

Factory exhaust gases. of the acid industry.

There is no such thing as edible salt that you don't eat.

There are a lot of these.

Like the fabrics of the clothes we wear, new synthetic fabrics have many functions, sweat absorption, radiation protection, and some natural fabrics are not available.

And then there's food, there's a positive side here, there's a negative side, and the positive side is that we have a rich variety of food, and we can eat it all over the world, because they can be stored for a longer period of time, and then they can support long-distance transportation.

There are also many new materials, which have made our aerospace industry and transportation develop rapidly.

Some new cleaning agents can remove stubborn stains.

There are also some new types of storage materials, such as football ene, which make our transportation more convenient and safe.

Chemistry is closely related to us, and it is indispensable in modern life.

Fire, chemical reactions, is the rapid development of human intelligence and physique when they eat cooked food.

Ceramics, the first invention of mankind, is still in use today, and transparent ceramics will have greater development in the future.

Gunpowder, in all kinds of engineering, has this huge effect.

The smelting of copper, iron, and aluminum enabled the development of tools for human generation.

Today's petrochemical industry has a huge impact on all aspects of life.

None of human beings have left chemistry.

Any invention can benefit mankind, depending on how you use it.

Nobel invented explosives, which can be regarded as a benefit to mankind.

1.Pesticides: can not only prevent and control crop diseases and pests, but also cause environmental pollution if used excessively2

Chemical fertilizers: can not only promote the growth of the effect, but also cause environmental pollution if used excessively3Plastic film:

It can not only be used as packaging materials, agricultural greenhouses, etc., but also pollute the environment (chemically called white pollution).

4.Food preservatives: appropriate amount of preservatives, excessive amounts are harmful to health.

5.Aluminum(1).Helpful:

The use of aluminum involves many fields, from national defense, aerospace, electric power, communications, etc., to pots and pans and other daily necessities. Its compounds are very widely used, and different aluminum-containing compounds play an important role in medicine, organic synthesis, petroleum refining, etc.

2).Harmful: Aluminum can damage human brain cells, however, often drinking water purified by aluminum salt, eating foods containing aluminum salt, such as fritters, vermicelli, cold powder, oil cakes, translocation canned soft drinks, etc., or often eating meals fried from aluminum cookware, will increase people's aluminum intake, thereby affecting brain cell function, resulting in memory decline and sluggish thinking ability.

Chemicals are a neutral word, in human hands, a tool. Whether it is for the benefit of humanity or the harm to humanity depends on the person, not the chemicals. Just like a knife, it can cut people or pork, but the consequences depend on the person who uses the knife, not the knife.

For example, uranium can be refined and used to generate electricity, or it can be used to build nuclear bombs.

Freon, difluorodichloromethane is a refrigerant in refrigerators, but if it is put into the atmosphere, it will cause a greenhouse effect.

For example, the plastic bags in our lives, the skin care products, the chemicals like oil, and all the other things that are necessary for the benefit of mankind, and then the melamine and the waste gas and wastewater discharged from the chemical factories are polluting the environment and harming human beings.

Many of the clothes and tools used by human beings are chemical products, and the gasoline used in cars running on the road is also chemical products, which of course benefit mankind.

Because chemical reactions can produce new substances, humans use a series of chemical reactions to reduce quality.

Turning things into precious, it can increase production and promote the development of many industries.

What you eat, that one is useless.

pure; Solution; Pale yellow particles, aromatic and sweet. Soluble in water; 3

a. In the process of smelting iron and steel with iron ore, there is a new substance in the formation of iron, which belongs to chemical changes B. There are new substances in the process of brewing wine and vinegar from wheat and rice, which belongs to chemical changes c. There are new substances in the process of using coal as raw materials to make drugs, which belongs to chemical changes D. In the process of producing gasoline from petroleum fractionation, there is no new substance in the process of crude production, which belongs to physical changes, so it is selected; d．

D. Question analysis: chemical change is a change in the formation of new substances; Petroleum contains gasoline, kerosene, diesel and other substances, and no new substances are formed during the fractionation process, which is not a chemical change.

(1) Rice, steamed bread and other substances are rich in starch, so the answer is: rice, steamed bread;

2) According to the information in the question "acrolein is completely burned in the air to produce carbon dioxide and water", the reactants of this reaction are acrolein and oxygen, the products are carbon dioxide and water, the reaction condition is ignition, and the balance is by observation method, so the answer is: 2C3H4O+7O2

Ignite6co2+4h2o；

3) Hydrochloric acid reacts with calcium carbonate in limescale to form calcium chloride, water and carbon dioxide, and the chemical equation of the reaction is: CaCO3+2HCl, CaCl2+CO2+H2O; Hydrochloric acid reacts with magnesium hydroxide in limescale to form magnesium chloride and water, and the chemical equation of the reaction is: Mg(OH)2+2HCl, MgCl2+2H2O

Therefore, limescale can be removed with hydrochloric acid; Hydrochloric acid reacts with aluminum to produce aluminum chloride and hydrogen, the chemical equation of the reaction is: 2Al+6HCl 2ALCL3+3H2, so the appropriate amount of hydrochloric acid added Therefore, the answer is: CaCO3+2HCl CaCl2+CO2 +H2O; mg（oh）2+2hcl═mgcl2+2h2o；2al+6hcl═2alcl3+3h2↑；

4) Because the activity of aluminum is greater than that of copper and iron, it is difficult to smelt, so the utilization of aluminum is much later than that of copper and iron; Because aluminum is easy to react with oxygen to form a dense alumina protective film on the surface of aluminum, which is more resistant to corrosion, aluminum is currently replacing steel that is prone to rust in many fields, so the answer is:

5) Sodium bicarbonate (NaHCO3), which is heated to generate soda ash (Na2CO3), water and carbon dioxide, and the chemical equation of the reaction is: 2NaHCO3

Na2CO3+H2O+CO2, so the answer is: 2NaHCO3

na2co3+h2o+co2↑；

6) The reaction of basic copper carbonate with hydrochloric acid will generate copper chloride, water and carbon dioxide, which is completed in combination with the writing requirements of the chemical equation, so the answer is: Cu2(OH)2CO3+4HCl=2CuCl2+3H2O+CO2;

7) Copper oxide reacts with sulfuric acid to form copper sulfate and water; Since the mother liquor contains the remaining sulfuric acid and copper sulfate solution, the process contains two reactions: displacement reaction with sulfuric acid to generate hydrogen, and reaction with copper sulfate to form copper and ferrous sulfate, so the answer is: cuo+H2SO4=CuSO4+H2O; ③cuso4+fe=feso4+cu；h2so4+fe=feso4+h2↑