Find a large number of chemical equations from junior high school to senior one.

I'll tell you the truth, it's not very useful for you to make so many equations, it's not very useful, it's not like you usually accumulate with a strong interest, and chemical equations don't have to be memorized one by one, since it's a science subject, you have to grasp the principles and Wubi's laws, rote memorization is not something we should do, and the equations of the one upstairs are all the foundation of the foundation, and it's a complete waste of time to memorize them all, but then again, if you think about a few representative reactions yourself, you might end up with one as ten.

Only 10 points? Also a single-line bridge? It's too troublesome, you can go to see the redox reaction by yourself, it's not difficult.

As for the equation, you go and buy a quick check of the basic knowledge of high school chemistry yourself, and it is not expensive, 10 yuan does not tremble to read, which is good, I use this, and the result is that the chemistry score of 99 is the first in the class.

Learning chemistry is not just about memorizing equations, but about understanding the chemical properties of those commonly used acid roots, the first 20 elements, and some of the elements after 20.

1.Calcium carbonate is soluble in acetic acid (strong acid to weak acid).

caco3 + 2ch3-co-oh → co2↑ +h2o + ch3-co-o）2ca

or CaCO3 + 2HAC CO2 + H2O + Ca(AC)2

2.Iron hydroxide is dissolved in dilute nitric acid (neutralization reaction).

fe（oh）3 + 6hno3 → 2fe（no3）3 + 3h2o

Add excess ammonia (iron hydroxide is insoluble in excess alkaline solution).

fecl3 + 3nh3·h2o → fe（oh）3↓ +3nh4cl

CO2 (strong acid to weak acid) is introduced into the solution

ca(clo)2 + co2 + h2o → caco3↓ +2hclo

Add excess ammonia (iron hydroxide is insoluble in excess alkaline solution).

fe（no3）3 + 3nh3·h2o → fe（oh）3↓ +3nh4no3

6.Alumina plus excess ammonia (alumina is insoluble in weak alkali).

al2o3 + nh3·h2o ≠

Add excess ammonia (copper hydroxide is insoluble in excess alkaline solution).

cuso4 + 2nh3·h2o → cu（oh）2↓ +nh4）2so4

8.Calcium bicarbonate with excess sodium hydroxide.

Step 1: Ca(HCO3)2 + NaOH (a small amount) CaCO3 + NaHCO3 + H2O

Step 2: NaHCO3 + NaOH (overdose) Na2CO3 + H2O

Total reaction: Ca(HCO3)2 + 2NaOH (excess) CaCO3 + Na2CO3 + 2H2O

+ 2ch3cooh == ca(ch3coo)2 + co2 （g）+ h20

Overdose: Ca(clo)2+2CO2+2H2O==Ca(HCO3)2+2HCO

CO2 insufficiency: Ca(ClO)2+CO2+H20==CaCO3 +2HCO

6.It does not react with Al2O3 + H2O 2Naalo2 + CO2 (high temperature).