What are the reactions of alkali and salt to salt and water

Both acid salts and bases react to form salt and water NaHCO3+NaOH=H2O+Na2CO3

nahso4+naoh==h2o+na2so4

The reaction of alkali with salt should not produce water.

Acid + alkali quietly burns -- salt blind + water1. Caustic soda hydrochloride initiates reaction: HCl + NaOH ==NaCl + H2O2, potassium hydroxide hydrochloride.

Reaction: HCl + KOH ==KCl +H2O<>

3. Copper hydroxide hydrochloride reaction of milling group: 2HCl + Cu(OH)2 ==CuCl2 + 2H2O

4. Calcium hydroxide hydrochloride.

Reaction: 2HCl + Ca(OH)2 ==CaCl2 + 2H2O5, iron hydroxide hydrochloride reaction: 3HCl + Fe(OH)3 ==FeCl3 + 3H2O

Salts and alkalis react to form new bases and salts, there are no examples of water and salts, and acid salts such as bicarbonate and alkalis are barely possible if they have to.

1. Alkaline oxide + acid - salt + water.

1. Iron oxide dilute hydrochloric acid reaction: Fe2O3+6HCl==2FeCl3+3H2O

2. Iron oxide dilute sulfuric acid reaction: Fe2O3+3H2SO4==Fe2(SO4)3+3H2O

3. Copper oxide dilute hydrochloric acid reaction: CuO+2HCl==CuCl2+H2O

4. Copper oxide dilute sulfuric acid reaction: CuO+H2SO4==CuSO4+H2O

5. Magnesium oxide dilute sulfuric acid reaction: MGO + H2SO4 = = MGso4 + H2O

6. Calcium oxide dilute hydrochloric acid reaction: CaO+2HCl==CaCl2+H2O

2. Acidic oxide + alkali - salt + water.

1. Deterioration of caustic soda exposed air: 2NaOH + CO2 = = Na2CO3 + H2O

2. Caustic soda absorbs sulfur dioxide gas: 2NaOH + SO2 = = Na2SO3 + H2O

3. Caustic soda absorbs sulfur trioxide gas: 2NaOH + SO3 = = Na2SO4 + H2O

4. Slaked lime air deterioration: Ca(OH)2 + CO2==CaCO3 +H2O

5. Slaked lime absorbs sulfur dioxide: Ca(OH)2+SO2==CASO3 +H2O

The reaction of an acid with (a base or an alkaline oxide) to form salt and water is called a neutralization reaction. General formula: acid, alkali salt.

For example: NaOH + HCl = NaCl + H O Sodium hydroxide (commonly known as caustic soda, caustic soda, caustic soda) can be neutralized with hydrochloric acid to produce sodium chloride and water.

2NaOH+H So Na So 2H O Sodium hydroxide can neutralize with sulfuric acid to generate sodium sulfate and water.

NaOH+HNO Nano Ho Sodium hydroxide can neutralize with nitric acid to produce sodium nitrate and water.

Ca(OH) 2HCl=CaCl 2HO Calcium hydroxide can be neutralized with hydrochloric acid to generate calcium chloride and water, and the reaction releases a lot of heat.

Principle of neutralization reaction for the generation of salt and water:

After being dissolved in water, they are ionized into freely moving anions and cations in water. For example, HCl is ionized into hydrogen ions (H+) and chloride ions (Cl-), while NaOH is ionized into sodium ions (Na+) and hydroxide ions (OH-).

Hydrogen ions and hydroxide ions combine to form water that is extremely difficult to ionize, leaving sodium and chloride ions in the solution. Sodium and chloride ions are still ionized in solution and do not combine. But the product is NaCl.

The above content refers to Encyclopedia - Neutralization Reaction.

Acid and base reactions, such as: HCl+Naoh==NaCl+H2O. Basic oxides and acids react as:

fe2o3+6hcl==2fecl3+3h2o。Acidic oxide and base reaction, such as: 2NaOH + CO2 = = Na2CO3 + H2O.

Because the definition of neutralization reaction is the reaction of acid and base to produce salt and water, in addition to acid and base reaction to produce salt and water, salt and water reaction can also be generated in the chemical properties of acid and base, such as some non-metal oxides react with alkali (2NaOH CO2 Na2CO3 H2O), some metal oxides react with acid (CA 2HCl CaCl2 H2O), etc., but these are not neutralization reactions.

Direct reaction to form a salt substance.

Metal universality: It can react with acids to form corresponding salts and hydrogen.

Basic oxides are oxides that react with acids to form water.

Alkalis can neutralize with acids to form salts and water.

Elemental silicon, a non-metallic element, can react with the strong alkali sodium hydroxide to produce sodium silicate and hydrogen.

Acidic oxides are compounds that react with alkalis to form salts and water.

Acids can neutralize with bases to form salts and water.

The above content refers to Encyclopedia - Acid Oxides.

Neutralization reaction: A reaction in which acids and bases interact to form salts and water.

When the base reacts with the salt, a new base and a new salt are formed. Salts refer to a class of compounds in which metal ions or ammonium ions (NH4) are combined with acid ions or non-metal ions. Such as sodium chloride, calcium nitrate, ferrous sulfate, ammonium acetate, calcium sulfate, copper chloride, sodium acetate, etc.

A compound is a chemical substance that is held together by chemical bonds by a fixed molar ratio of two or more elements. Compounds can be broken down into simpler chemicals by chemical reactions. Like methane (CH), glucose.

C6H12O6), lead sulphate (PBSO) and carbon dioxide.

CO2) are chemical compounds.

Question Qi Qiaoyi: Can salt and alkali react? What are the conditions Yes.

Reaction to form water: I think you should know that acid and alkali energy reaction, the essence of the reaction is the reaction of cation (H+) and anion (-OH) to form water (H2O). In fact, there are many kinds of salt, and ordinary salts do not react with alkalis, however, some salts (such as:

Sodium bicarbonate, potassium bicarbonate) ionize negative ions (-HCO3) in water, which can be combined with anions (-OH) ionized by alkali to form water (H2O), thus relieving.

nahco3 + naoh ==na2co3 + h2o

Reactions produce precipitates: Here are just two common chemical equations.

ca(oh)2+na2co3==caco3↓+2na(oh)2ba(oh)2+k2so4==baso4↓+2koh

Question 2: In general, what do salts and acids, salts and bases react to produce respectively? In general:

Soluble salt + soluble base = new salt + new base (the product must have precipitation, gas or water).

Soluble salts + soluble acids = new acids + new salts (the product must have precipitation, gas or water).

Acid + alkali = salt + water.

Problem 3: Salt and alkali reaction, generally generated Salt and alkali reaction, generally generated [new salt and new alkali; Reaction conditions: The salt and alkali of the reactants are soluble, and the products are precipitated! 】

Generate new salt and new denier soda, or salt, water, and ammonia from new yutong.

The reactants must be soluble, and the product must have precipitation, gas, or water before proceeding.

What is generally needed to know is that soluble alkali reacts with soluble magnesium salts, aluminum salts, zinc salts, copper salts or iron salts to form insoluble alkalis and new salts; Calcium hydroxide Barium hydroxide reacts with soluble carbonate to form calcium carbonate, barium carbonate precipitate and new bases; The reaction of barium hydroxide and soluble sulfate to form a molded nuclear barium sulfate precipitate and a new base; Ammonium salts react with soluble alkali to form new salts, water, and ammonia.

The base reacts with the salt to form a new base (a relatively weak base) and a new salt.

There are two requirements for the reaction between alkali and salt, one of which requires that the alkali and salt involved in the reaction be soluble in water, and the other requires that the product has a sedimentary lake, gas or aquatic volta.

ca(oh)₂+na₂co₃=caco₃↓+2naoh<>