The chemical equation for CO2 generation and reaction with CO2 participation in junior high chemistr

C+O2 ignition ====CO2 (in case of sufficient oxygen).

Phenomenon: Produces pure lime water.

Turbid gas.

2C+O2 ignition =====2CO (in case of insufficient oxygen).

Phenomenon: Not obvious.

High temperature. c+2cuo*****2cu+co2↑

Phenomenon: The solids turn from black to red and decrease, and a gas is formed that can make the pure lime water turbid.

High temperature. 3C+2Fe2O3*****4Fe+3CO2 Phenomenon: The solid gradually changes from red to silvery-white, while the black solid decreases, and a gas is generated that can make the pure lime water turbid.

CO2 + C high temperature =====2CO

Phenomenon: The black solid gradually decreases.

C+O2 ignition ====CO2

Phenomenon: Formation of a gas that can make pure lime water turbid.

ca(oh)2+co2===caco3↓+h2o

Phenomenon: A white precipitate is generated, which is used to test carbon dioxide.

caco3+co2+h2o===ca(hco3)2

Phenomenon: The white solid gradually dissolves.

ca(hco3)

△=caco3↓+co2↑+h2o

Phenomenon: A white precipitate is formed, and a gas is formed that can make the pure lime water turbid.

cu2(oh)2co3==△==2cuo+h2o+co2↑

Phenomenon: The solid gradually turns from green to black, and at the same time, a gas is formed that can make the pure lime water turbid.

2NaOH + CO2 === Na2CO3 + H2O (can also be KOH).

Phenomenon: Not obvious.

CaCO3 high temperature ====CaO+CO2

Phenomenon: There is a gas formation that can make pure lime water turbid.

fe3o4+4co====3fe+4co2

Phenomenon: The solid changes from black to silvery-white, and at the same time, a gas is formed that can make pure lime water turbid.

High temperature. feo+co===fe+co2

Phenomenon: The solid gradually turns from black to silvery-white, and at the same time, a gas is formed that can make the pure lime water turbid.

High temperature. fe2o3+3co====2fe+3co2

Phenomenon: The solid gradually turns from red to silvery-white, and at the same time, a gas is formed that can make the pure lime water turbid.

High temperature. cuo+co====cu+co2

Phenomenon: The solid turns from black to red, and at the same time, a gas is formed that can make the pure lime water turbid.

2 Apatina decomposes by heat:

cu2(oh)2co3

2cuoh2o

CO2 6 Charcoal Burning:

co2====

CO27 charcoal does not burn sufficiently in oxygen: 2C

o2====

2CO13 methane (CH4

Combustion: CH42O2

2h2oco2

22 Co reduces ferric oxide at high temperatures: 3CoFe2O32Fe3Co2

24 Alcohol burns in the air to produce carbon dioxide and water:

c2h5oh3o2

3h2o2co2

26 Reduction of copper oxide by charcoal at high temperatures: C2CuO2CuCO2

27 Reduction of carbon dioxide by charcoal at high temperatures: c

co2====

2CO28 charcoal iron oxide at high temperatures: 3C2Fe2O3

4fe3co2↑

29 Carbon dioxide reacts with water: H2OCo2

H2CO330 carbonic acid is unstable and decomposes at room temperature: H2CO3H2OC2

31 Carbon dioxide is introduced into the clear lime water, and the lime water becomes turbid

ca(oh)2co2

caco3↓+

H2O32 continues to introduce carbon dioxide into the turbid lime water, which becomes clear

caco3co2h2o

ca(hco3)2

33 High-temperature calcined limestone: caCO3

co2↑+cao

34 Reaction principle of CO2 gas prepared in the laboratory: CaCO3 + 2HClCaCl2 + CO2 +

H2O35 dilute hydrochloric acid reacts with sodium carbonate: Na2CO32HCl2NaClCO2+

H2O36 carbon monoxide burns in air or oxygen: 2COo2====

2CO237 Carbon monoxide reduces copper oxide under heated conditions: cocuocuCO2

There is a reaction for the production of carbon dioxide:

caco32hcl

cacl2+h2o+co2

caco32hno3=

ca(no3)2+h2o+co2

CaCO3 high temperature ====CaO+CO2

Cu2(OH)2CO3 (basic copper carbonate) = heating = 2CuO + H2O + CO2

C+O2 ignition ====CO2

Reactions with the participation of carbon dioxide:

CO2 + Ca(OH)2 = CaCO3 + H2O(Ca(OH)2 excess) 2CO2 + Ca(OH)2 = Ca(HCO3)2 (CO2 excess) CO2 + 2NaOH = Na2CO3 + H2O

2NAOH overdose) (Note; When CO2 is excess, NaHCO3 is generated).

:Precipitation. :Gas.

Ca(OH)2 + CO2 = CaCO3 + H2OCACO3 (high temperature.

Written above the equal sign) = cao + co2

CaCO3+2HCI=Caci2+H2O+CO2 (laboratory-made CO2 reaction).

2naoh+co2=na2co3+h2o

H2O+CO2=H2CO3=H2O+CO2 (H2CO3 is very easy to decompose).

CO+CUO (Heating.

Written on the equal sign) = Cu + CO2

C + CO2 (ignition) = 2Co

There is a reaction for the production of carbon dioxide:

CaCO3 high temperature ====CaO+CO2

Cu2(OH)2CO3 (basic copper carbonate) = heating = 2CuO + H2O + CO2

C+O2 ignition ====CO2

Reactions with the participation of carbon dioxide:

co2+ca(oh)2=caco3↓+h2oco2+2naoh=na2co3+h2o

What needs to be mastered in junior high school.

1) Carbon dioxide as a product:

Laboratory-produced CO2:CaCO3

2hclcacl2

h2oco2

Same type: Na2CO32HCl

2naclh2o＋co2

The acid in this reaction can also be sulfuric acid or other acids).

nahco3hcl

naclh2o＋

CO2 industrial CO2: CaCO3 = high temperature = cao CO2 Cu2 (OH) 2CO3 = heating = 2CuOH2OH2

2caHCO3 = heating = = 2caCO3

h2oco2↑

C+O2 ignition ====CO2

Reducibility of carbon class: c

2cuo = high temperature = 2cu

CO22) carbon dioxide as a reactant:

co2＋ca(oh)2==caco3↓＋h2oco2＋2naoh==na2co3

h2oco2＋h2o

H2CO3c CO2 = high temperature = 2Co

2caco3

h2oco2

2cahco3

The equation of CO2, H2O and Na2O2 reaction is tricky for many students, and it is basically written by rote memorization, but the good times are short-lived, and they will soon forget! So what to do? Teacher Qianlong created an original method to share with dear students, welcome students to be serious!

Carbon-containing substances are completely burned in oxygen to produce CO2.

For example, common C, Co, CH4, C2H5OH, etc., can generate CO2 when burned in oxygen; Carbonate, bicarbonate and hydrochloric acid can also be reacted to form CO2.

Among them, the common ones are CO2 generation and belong.

The chemical equation for the chemical reaction is:

C + O2 CO2, reaction condition ignition, 2Co + O2 2CO2, reaction condition ignition.

(1) Combustion generation class:

c+o2=co2

2co+o2=2co2

CH4+2O2=CO2+2H2O (Note: There are many of them, and all hydrocarbons (called hydrocarbons) are burned to form CO2+H2O).

C2H5OH + 3O2 = 2CO2 + 3H2O (Note: There are many of these types, and all compounds formed by carbon, hydroxide and oxygen elements are burned to form CO2 + H2O).

2) Thermal decomposition:

CaCO3== CaO+CO2 (Note: All carbonates that are insoluble in water can be decomposed into metal oxides and CO2 at high temperatures).

nh4hco3==△nh3+co2+h2o

2NaHCO3== Na2CO3+CO2+H2O (Note: All bicarbonates can be thermally decomposed to form carbonates, CO2 and H2O).

cu(oh)2(co3)2==△cuo+2co2+h2o

3) Carbonate and acid reactions:

CaCO3+2HCl===CaCl2+CO2+H2O (Note: All carbonates can react with strong acids to form new salts, CO2 and H2O).

NaHCO3+HCl===NaCl+CO2+H2O (Note: All bicarbonates can react with strong acids to form new salts, CO2 and H2O).

4) Redox reactions (except combustion):

C+2H2SO4 (concentrated) ==CO2+2SO2+2H2O

C + 4Hno3 (concentrated) ==CO2 + 4NO2 + 2H2O

1. Cu2(OH)2CO3 = heating = 2CuO + CO2 (gas detection segment) + H2O

2. C + 2H2SO4 (concentrated) = Heating = CO2 (return to the banquet gas leakage) + 2SO2 (gas) +2H2O

C+O2 ignition ====CO2 (in case of sufficient oxygen) Phenomenon: Produces a gas that makes pure lime water turbid.

2C+O2 ignition ====2CO (in case of insufficient oxygen) Phenomenon: Not obvious.

High temperature C+2CuO*****2Cu+CO2 phenomenon: The solids turn from black to red and decrease, and at the same time, a gas is formed that can make the pure lime water turbid.

High temperature 3C+2Fe2O3*****4Fe+3CO2 Phenomenon: The solid gradually changes from red to silvery-white, while the black solid decreases, and a gas is generated that can make the pure lime water turbid.

CO2+C High Temperature ====2co Phenomenon: The black solid gradually decreases.

C+O2 ignition ====CO2 Phenomenon: Produces a gas that can make pure lime water turbid.

Ca(OH)2+CO2===CaCO3 +H2O phenomenon: A white precipitate is generated, which is used to test carbon dioxide.

CaCO3+CO2+H2O===Ca(HCO3)2 Phenomenon: White solids gradually dissolve.

Ca(HCO3) === =CaCO3 +CO2 +H2O Phenomenon: A white precipitate is generated, and a gas is formed that can make the pure lime water turbid.

Cu2(OH)2CO3== ==2CuO+H2O+CO2 Phenomenon: The solid gradually turns from green to black, and at the same time, there is a gas that can make the pure lime water turbid.

2NaOH + CO2 === Na2CO3 + H2O (can also be KOH) Phenomenon: Not obvious.

CaCO3 High Temperature ====CaO+CO2 Phenomenon: There is a gas generation that can make pure lime water turbid.

Fe3O4+4CO====3Fe+4CO2 Phenomenon: The solid changes from black to silvery-white, and at the same time, there is a gas that can make the pure lime water turbid.

High temperature FeO+CO===Fe+CO2 Phenomenon: The solid gradually turns from black to silvery-white, and at the same time, there is a gas generation that can make the pure lime water turbid.

High temperature Fe2O3+3CO====2Fe+3CO2 Phenomenon: The solid gradually turns from red to silvery-white, and at the same time, there is a gas that can make the pure lime water turbid.

High temperature cuo+co====cu+CO2 Phenomenon: The solid turns from black to red, and at the same time, there is a gas that can make the pure lime water turbid.

What needs to be mastered in junior high school.

1) Carbon dioxide as a product:

Laboratory-prepared CO2:CaCO3 2HCl = =CaCl2 H2O CO2

Same type: Na2CO3 2HCl == 2NaCl + H2O CO2

The acid in this reaction can also be sulfuric acid or other acids).

NaHCO3 HCl == NaCl H2O CO2 Industrially Produced CO2: CAC3 = High Temperature = Cao CO2 Cu2(OH)2CO3 = Heating = 2Cuo H2O CO2 2CaHCO3 = Heating = = 2CaCO3 H2O CO2 C O2 = Ignition = CO2

The reducibility of carbon class: C 2Cuo = high temperature = 2Cu CO2 (2) Carbon dioxide as reactant:

co2＋ca(oh)2==caco3↓＋h2oco2＋2naoh==na2co3 ＋h2o②co2＋h2o ==h2co3

c CO2 = high temperature = 2CO

2caco3 ＋ h2o ＋ co2 == 2cahco3