Introducing the conservation of charge in chemistry Conservation of materials Conservation of proton

1. Conservation of charge: The number of positive and negative charges carried by the anion and cation in the electrolyte solution is equal, that is, the solution is not electrically sensitive. (The characteristic is that one side is all cations, the other side is all anions, and the coefficient is the number of charges) in sodium sulfide solution, C(Na+)+C(H+)=2C(S2-)+C(Hs-)+C(OH-).

2. Conservation of materials: that is, the original concentration (initial concentration) of a component in the electrolyte solution should be equal to the sum of its concentrations in various forms of existence in the solution. (The characteristic is that one side contains one element, and the other side contains another primitive element, and the coefficient is related to the ratio of the number of two elements in the original composition) c(na+)=2c(s2-)+2c(hs-)+2c(h2s).

3. Conservation of protons: The characteristic of water ionization is c (h+) = c (oh-), which can be obtained by adding and subtracting the above two conservation phases.

c (oh-)=c(hs-)+2c(h2s)+c(h+)

Conservation of charge: Whether the compound or the solution is electrically neutral, it is necessary that the positive charge carried by the cation (total) = the negative charge carried by the anion (total).

Conservation of materials: Conservation of an atom or cluster of atoms in solution.

Conservation of protons: the amount of proton obtained in solution is equal to the amount of matter lost proton; In fact, there is a charge conservation relation minus the material conservation relation.

Conservation of charge mainly focuses on which ions are in the solution and the number of charges of the ions, the number of charges of the cation is equal to the number of charges of the anions.

The conservation of materials mainly pays attention to the coefficient of the atom or functional group of the chemical formula of the substance, and whether the cation or anion is hydrolyzed and ionized, which is simply the conservation of the number of atoms.

Proton conservation, can be superimposed with the first two conserved (more troublesome), the simple and fast way to write is to use the principle of acid-base proton theory, less than 15 seconds is very complex (several overmixed substances) can be written, and the accuracy rate is 100

1.Conservation of charge: 3C(Fe)C(H)=2C(SOC(OH)

Conservation of material: 3C(Fe)3 Fe(OH) = 2C(SO.)

Conservation of protons: c(h) = c(oh) + 3 fe(oh).

2.Conservation of charge: C(K) + C(H) = C(HCO)2C(CoC(OH)

Conservation of materials: c(k)=c(hco)c(co(h co)

Conservation of protons: c(h) + c(h co) = c(oh) + c(co

3.Conservation of charge: c(na) + c(h) = c(ch coo) + c(oh).

Conservation of materials: 2C(Na)=C(CH COO)+C(CH Cooh).

Please adopt, thank you

Conservation of charge: The total number of charges of each ion before and after the reaction is equal.

Before the reaction Positive charge + negative charge = after the reaction Conservation of positive charge + negative charge material: under the same conditions, in a reversible reaction, for the reaction under the same conditions, as long as the added substances are converted into reactants, and the mass of each substance is the same, the same equilibrium system will be reached.

Conservation of mass: the total mass of each substance before the reaction = the total mass of each substance after the reaction and the type and number of each "atom" before the reaction = the type and number of each "atom" after the reaction.

conservation of electric charge; Conservation of electrons gained and lost during the reaction.

conservation of materials; The total amount of reactants and products participating in the reaction is unchanged, which is reflected in the same number of atoms in the reaction equation.

Conservation of protons: The reaction changes the substance, the elements do not change.

Conservation of charge means that the number of all cations in the solution is equal to the number of all anions Conservation of materials is the number of sodium ions in the solution for example, NaHCO3 The number of sodium ions in the solution is always equal to the total number of molecular ions containing element C Conservation of protons means that the content of the substance that gets protons is always equal to the content of the substance that loses protons Proton refers to hydrogen ions But this is all basic explanation There are still a lot of variations.

Conservation of charge: The cation concentration is equal to the anion concentration (several valence ions multiplied by a few).

Conservation of materials: Ions that are completely ionized and not hydrolyzed are equal to the products of hydrolyzed ions (multiplied by a few inversely).

Conservation of protons: Hydrogen ions are equal to the direction of anions (hydrogen ions are replaced by hydroxides in alkaline solutions, which are only used in single-salt solutions).

That is, 1 charge is conserved, the total number of yin and yang electrons is equal, one side of each column is conserved, br2 is conserved, that is, the material is proportional (the sum of all states), br3 puts h and oh- on both sides of the equal sign, and the ions are combined with them without difference and written on the same side. (h 'The coefficient of oh- is the proportion coefficient of the feeding and (