Can hydrogen replace copper in copper sulphate solution? 40

Hydrogen cannot displace copper in copper sulfate, although hydrogen is ranked before copper in the potentiometric sequence, but this is because the chemical behavior of hydrogen ions is similar to that of metal cations when they participate in the displacement reaction in water or acid solution, and it is not that hydrogen is similar to metal elements, and the basis of the potential sequence The standard electrode potential is only applicable to reactions in solution. The hydrogen in the sequence table of metal activity described in the middle school should be regarded as the criterion for the reaction between metal and acid, that is, the relative oxidation capacity of hydrogen ions and other metal cations, rather than the comparison of the size of the reduction capacity of the element, and the hydrogen element should not be taken into account.

Hydrogen gas cannot be used to displace the metal in any of the metal salt solutions. What we mean by metal activity order is only the relationship between metals to hydrogen ions and metal ions. Hydrogen can replace the copper in copper oxide, which cannot be simply regarded as metal replacement, and is also affected by temperature and other aspects.

No, hydrogen in the order of metal activity only represents a demarcation point, the one in front of hydrogen can replace hydrogen from the acid, and the one in the back cannot, hydrogen is not a metal.

No, according to the order of activity of the metal (reducible) potassium calcium sodium magnesium aluminum zinc iron tin lead hydrogen copper mercury silver platinum gold. Hydrogen can displace the metal in front of it, and copper is behind the hydrogen, so it can't.

No, you cannot. The reducibility of H2 is reflected in the dry state, that is, in an environment without H2O, and it is heated or at high temperatures.

No, the two reactants do not come into contact easily. There appears to be no gas displacing the metal from the solution.

Yes. You can use this as a galvanic battery.

Acidic substances cannot displace the copper in the copper sulphate.

Metals that are more reactive than copper, such as zinc and iron, can be used to replace the copper in the copper sulfate solution.

Zinc flakes are placed in a copper sulfate solution.

Since metals such as zinc and iron are more active than copper, they can displace copper from the copper sulfate solution.

But very reactive metal potassium.

Sodium, etc., can react directly with water to form alkali and hydrogen gas, so they cannot replace the copper in the copper sulfate solution.

Displacement reaction. It is a chemical reaction in which an element reacts with a compound to form another element and a compound.

It is the four basic types of reaction in the chemistry of the reputation.

One of them, including the reaction of metal with salt solution, the reaction of metal with acid, etc.

There is no acid that can displace copper.

If it is not called replacement if you wish, zinc or iron can replace copper. )

Acids cannot replace copper.

Electrolysis is the precipitation of copper and the escape of oxygen, and there is no loss of hydrogen element, so copper hydroxide should not be used, but copper oxide.

Copper hydroxide is not OK because water will be added, and it is Cu and O2 that really leave the solution during electrolysis, and the process is as follows:

Cathode: 2cu2+ +4e- =2cu

Anode: 4OH- -4E- = 2H2O+O2 Total reaction: 2Cu2+ +2H2O = 2Cu + O2 + 4H+x Y

Therefore, Cuo should be added (since Cu, O2 do not react with the formation of acid).

Copper hydroxide does not work, it will increase the water and make the solution thinner.

Copper carbonate can be added, because the generated carbon dioxide will volatilize, and the actual increase is still cuo <>

During electrolysis, copper (precipitation) and oxygen (gas) are precipitated from the solution, and copper and oxygen are less in the solution. There is no shortage of hydrogen. Why hydrogen? It is correct to add copper oxide, and add what is lacking.

Copper hydroxide is not allowed. Copper oxide or copper carbonate can be added, because Cu(OH)2+H2SO4==CuSO4+2H2O and electrolytic 2CuSO4+2H2O==Electrolysis==2Cu+O2 +2H2SO4

Generally, no.

First of all, copper sulfate is an ionic compound, which is composed of sulfate ions and copper ions, and there are sulfate ions and copper ions in copper sulfate solution.

In the displacement reaction of metal and salt solution, it is the metal ions that replace the metal ions in the salt solution, for example, the reaction between iron and copper sulfate is the conversion of iron atoms into ferrous ions to replace the copper ions in the copper sulfate solution.

Hydrogen is a molecular composition, hydrogen molecules are composed of hydrogen atoms, and hydrogen does not have hydrogen ions, it is generally hydrogen atoms, so it is impossible to replace the metal ions in the salt solution.

It does not react directly into the copper sulfate solution, and the hydrogen can be adsorbed with a platinum electrode through the galvanic battery, and the following reactions can occur:

h2 + cuso4 = h2so4 + cu

The total reaction of electrolytic copper sulfate: 2CuSO4 + 2H2O = electrolysis = 2Cu + O2 + 2H2SO4 The chemical equation for the reaction of sulfuric acid with copper hydroxide is: H2SO4 + Cu(OH)2 = CuSO4 + 2H2O According to the above chemical equation, it can be known:

For each of the two molH2SO4, 2molCuso molH2O is required to be electrolyzed, and when 2molH2SO4 reacts with copper hydroxide, 2molCu(OH)2 is required, and the amount of water generated becomes more pure, so the addition of copper hydroxide cannot reduce the electrolyte solution.