5 points in junior high school chemistry

As follows: 1 Acid + Base = = Salt + Water.

cu(oh)2+2hcl==cucl2+h2o al(oh)3+3hcl==alcl3+3h2o

cu(oh)2+h2so4==cuso4+2h2o mg(oh)2+2hno3==mg(no3)2+2h2o

2 Acid + Salt = = New Acid + New Salt.

Reaction conditions: meet the conditions for the metathesis reaction to occur (the actual reaction conditions are very complex).

caco3+2hcl==cacl2+h2o+co2↑ na2co3+2hcl==2nacl+h2o+co2↑

agno3+hcl==agcl↓+hno3 h2so4+bacl2==2hcl+baso4↓

3 Salt + alkali = = new salt + new alkali.

Reaction conditions: The reactants are soluble in water, and the products are at least insoluble (pre-dissolution and post-precipitation).

cuso4+2naoh==cu(oh)2↓+na2so4 fecl3+3naoh==fe(oh)3↓+3nacl

na2co3+ca(oh)2==2naoh+caco3↓ cuso4+ba(oh)2==cu(oh)2↓+baso4↓

4 Salt + Salt = = New Salt + New Salt.

Reaction conditions: The reactants are soluble in water, and the products are at least insoluble (pre-dissolution and post-precipitation).

nacl+agno3==nano3+agcl↓ na2so4+bacl2==2nacl+baso4↓

na2so4+ba(no3)2==2nano3+baso4↓

5 Acid + Metal Oxide = = Salt + Water.

fe2o3+6hcl==2fecl3+3h2o fe2o3+3h2so4==fe2(so4)3+3h2o

cuo+2hcl== cucl2+h2o cuo+h2so4==cuso4+h2o

Sour. It reacts with active metals to produce hydrogen. HCl+Zn reacts with the base, neutralizes, and produces water.

To react with salt, there must be gas, precipitation, and water formation.

and basic oxides.

Alkali. and acidic oxides.

To react with salt, there must be gas, precipitation, and water formation.

It reacts with alkali to neutralize and produce water.

The rest don't remember - -

1: Acids can be replaced with some active metals to produce hydrogen and salt (generally do not use potassium, calcium, sodium, because they are too active, and do not use tin, platinum. Because the reaction is too slow)

2: The acid can make the purple litmus test solution red, and the colorless phenolphthalein test solution does not change color.

3: Acid can metacompose with certain metal oxides to generate salts and water.

4: Acid and base undergo metathesis reaction (neutralization reaction) to generate salt and water.

5: Acid metathesis reaction with certain salts to generate new salts and new acids.

1. Acid: 1Acid + Elemental Metals = Salt + Hydrogen.

Acid refers to hydrochloric acid and dilute sulfuric acid, and metal element refers to the metal activity table before hydrogen);

2.Acid + alkali = salt + water.

3.The acid can make the purple litmus solution red, and the colorless phenolphthalein solution does not change color.

4.Acids react with metal oxides to form salts and water (no change in valency after any element reaction);

5.Strong acid + carbonate = new salt + water + carbon dioxide.

3 special cases: 1: HCl + AGNO3 = AGCL (precipitation) + HNO32:

H2SO4 + BACL2 = BASO4 (precipitation) + 2HCL3: H2SO4 + BA (NO3) 2 = BASO4 (precipitation) + 2HNO32, alkali: 1

Alkali can make the purple litmus solution turn blue, and the colorless phenolphthalein solution turn red.

2.Alkali + non-metallic oxide = salt + water.

3.Alkali + salt = new alkali + new salt.

Both reactants are solutions, and at least one of the products is insoluble in water)4Alkali + acid = salt + water.

You don't have to write equations, do you? There are a lot of chemistry books! If you want to, let's talk about it.