The chemical equation of basic copper carbonate prepared by copper sulfate pentahydrate and sodium b

2[cuso4·5h2o]+4[nahco3]=[cu(oh)2·cuco3]↓+2[na2so4]+11[h2o]+3[co2]↑

Note: The chemical formula of the substance in square brackets, Cu(OH)2·CuCO3 represents the basic copper carbonate, which can also be written as Cu2(OH)2CO3.

Agree with 2[CuSO4·5H2O]+4[NaHCO3]=[Cu(OH)2·CuCO3] +2[Na2SO4]+11[H2O]+3[CO2] on the second floor I just came back from the lab and I was doing this experiment to be heated in the Basic Chemistry Experiment

Science Press, Liu Hanbiao, Shi Jianxin, Zou Xiaoyong) I don't understand equations either.

Let's see if the landlord is also a freshman in the chemistry department.

First of all, it is difficult to react between two solids to form basic copper carbonate. Even in solution, basic copper carbonate is difficult to generate because the alkalinity is not enough.

To generate basic copper carbonate, it is necessary to maintain a certain alkalinity of the solution, that is, alkali (NaOH) must be added, or at least sodium carbonate must react with copper sulfate solution to obtain basic copper carbonate, the reaction is as follows:

2cu(2+) 3co3(2-) 2h2o = cu2(oh)2co3 + 2hco3(-)

The above reaction equation can confirm that sodium bicarbonate cannot react with copper sulfate to form basic copper carbonate.

Chemical equation: 2CuSO4 + 2Na2CO3 + H2O==Cu2(OH)2CO3 +2Na2SO4 + CO2.

Metathesis reaction occurs.

A green basic copper carbonate precipitate is formed, accompanied by the appearance of bubbles. Sodium carbonate.

Sodium carbonate) is an inorganic compound with the chemical formula Na2CO3 and molecular weight, also known as soda ash.

But the classification belongs to salt, not alkali. Also known as soda or soda ash in international **.

Copper sulphate

Copper sulphate is an inorganic compound with the chemical formula cuso, anhydrous copper sulphate.

It is white or off-white powder. Copper sulphate is both a fertilizer and a commonly used fungicide. Bordeaux liquid, copper soap liquid, and copper ammonium preparations are made of copper sulfate and quicklime.

Soap, ammonium bicarbonate.

Formulated.

Hydrates are very easy to absorb water vapor in the air and change into hydrates. The hydrate loses crystal water when heated and heats up to 102 loses two crystal waters; 113 Loss of three crystalline waters; 258 Lose all crystal water; When the heating temperature reaches 653, the decomposition begins to form Cuo and SO3, and the decomposition ends at 720.

The above content reference:Encyclopedia - Copper auslate milled by thiogroup

Copper sulphate pentahydrate.

It contains crystal water, and when dissolved in water, the crystal water becomes a solvent, so the chemical reaction between the two.

The equation is. <>

Reaction equation of copper sulfate pentahydrate and sodium hydroxide. ：2naoh + ==cu(oh)2↓ +na2so4+h2o。

Five of the water molecules are separated from the crystal after the reaction.

2naoh+cuso4=cu(oh)2+na2so4

Reaction phenomenon: The blue copper sulfate solution reacts with the sodium hydroxide solution to form sodium sulfate and copper hydroxide precipitates.

cuso4+2naoh==cu(oh)2↓+na2so4

Anhydrous is the same as five waters.

Salt and base react to form new salt and new base. It is a metathesis reaction that exchanges components with each other. Copper sulfate reacts with sodium hydroxide to form copper hydroxide and sodium sulfate.

Copper hydroxide is a blue precipitate. The chemical equation of the reaction is: one part copper sulfate pentahydrate and two parts sodium hydroxide produce one part copper hydroxide precipitate and one part sodium sulfate.

Hope mine is helpful to you.

CuSO4+2NaOH==Cu(OH)2 +Na2SO4 crystal water is not involved in the reaction.

Copper sulfate reacts with sodium hydroxide to form copper hydroxide precipitate with water.

Generally speaking, the reaction between the two is carried out in the solution system, if the copper sulfate crystal pentahydrate is carried out in the solution system, it becomes a solution of copper sulfate, so the reaction equation of copper sulfate and sodium hydroxide can be directly bleeding.

1. The chemical equation is: Cu2(OH)2CO3.

2. Basic copper carbonate, also known as malachite (the main component is Cu2 (OH), non-pure substance), is a precious mineral gemstone, belonging to basic carbonate, is a kind of salt. It is a substance produced by the reaction of copper with substances such as oxygen, carbon dioxide, and water in the air, and is also known as patina (patina). When heated in air, it decomposes into copper oxide, water, and carbon dioxide.

Apatina (patina) is also a basic type of copper carbonate.

3. Basic copper carbonate is insoluble in water, and dissolves in ammonia to generate cup-ammonia ligands. Decomposes when heated to 220 °C. The basic copper carbonate composed of 2 1 is a sky blue powdery crystal.

If it is placed in the air for a long time, it absorbs moisture and releases part of carbon dioxide, which slowly becomes 1 1 type basic copper carbonate, which is insoluble in water, but soluble in ammonia and forms copper ammonia matching ions.

Summary. Hello, the chemical equation is.

Cuso4 dec naHCO3

Cu2(OH)2CO3 Deca2SO4+CO2+H2O g copper pentahydrate and g sodium bicarbonate to prepare basic copper carbonate to obtain quality.

Hello, the chemical equation is CuSO4 deca NaHCO3 = Cu2(OH)2CO3 deca Na2SO4 + CO2 + H2O

is the calculation formula.

Sincerely answer every question for you! If you are satisfied, it is the best! If you have any questions, please keep asking!

Have a great day! Happy every day.

Cu2(OH)2CO3+4HCl=2CuCl2+3H2O+CO2 222 146 270 54 44146g 10% xg y The mass fraction of x=27g copper chloride is obtained after the proportional formula remains? Is it the mass denier volume fraction of the solution after the reaction? Gotta :

y=If it's wrong, blame me, and I'm not either.

2cu(oh)2+3hco3-==cu2(oh)2co3+2h2o+co3²¯

It should be hydrolyzed to produce copper hydroxide and bicarbonate reaction.

1. Balala, and the mall will be gall, and the mall will be cluck,

The corner mark can't be typed hahaha.