How to chemically distinguish calcium hydroxide solution from dilute sulfuric acid?

Dilute sulfuric acid is acid, calcium hydroxide.

It is a weak base. 1.With purple litmus. It is sulfuric acid that turns red, and calcium hydroxide that turns blue.

2.With colorless phenolphthalein. It is sulfuric acid that does not change color, and calcium hydroxide that turns red.

3.Add metal zinc or iron, there are bubbles to produce sulfuric acid, and there is no change in calcium hydroxide.

zn+h2so4=znso4+h2

fe+h2so4=feso4+h2

4.Add some insoluble metal oxides such as copper oxide and iron oxide.

Wait. The solids gradually dissolve is sulfuric acid, and the unchanged is calcium hydroxide.

cuo+h2so4=cuso4+h2o

5.Carbon dioxide is introduced into the solution.

Gas, the solution becomes turbid is calcium hydroxide.

co2+ca(oh)2=caco3+h206.Add some carbonate or bicarbonate, such as sodium carbonate.

or sodium bicarbonate.

Sulfuric acid is produced by gas. 2nahco3+h2so4=na2so4+h2o+co2

7.You can also use pH trial production to test the acidity and alkalinity of the solution, etc., and there are really many ways to identify the two. But the main thing is to take advantage of the difference in chemical properties between the two. Pay more attention to accumulation. Chemistry is a process of accumulation.

Ca(OH)2 is introduced into CO2 to produce a white precipitate, and dilute sulfuric acid does not change.

Carbon dioxide is introduced.

The precipitate is calcium hydroxide, and the inconspicuous phenomenon is dilute sulfuric acid.

Ca(OH)2 H2SO4 CaSO4 2H2O belongs to acid-base neutralization reaction.

Neutralization reaction: Acids and bases exchange components with each other to form a reaction of salt and water.

The essence of the neutralization reaction is that H+ and OH- combine to form water (HO).

Acid + alkali salt + water.

There is a reaction of salt and water formation, not necessarily a neutralization reaction, e.g. 2NaOH+CO = NAco+HO.

Calcium hydroxide is a base and sulfuric acid is an acid, and the two undergo acid-base neutralization reactions to produce salt and water.

Ca(OH)2 + H2SO4 = CaSO4 (slightly soluble) + 2H2O

In fact, it is an acid-base neutralization reaction.

The reaction equation is:

The resulting calcium sulfate is a slightly soluble substance and does not produce precipitation if the solution is very thin.

It depends on the concentration of calcium hydroxide, calcium hydroxide itself is slightly soluble in water, although theoretically, calcium sulfate is slightly soluble, and it will produce precipitation, but in practice, it can produce very little calcium sulfate, so in the test, we can't see the white precipitate of calcium sulfate.

ca(oh)2 +h2so4 ==caso4 ↓+2 h2o

In fact, it is an acid-base neutralization reaction.

Ca(OH)2 + H2SO4 = CaSO4 (slightly soluble) + 2H2O

Dilute sulfuric acid. It is acid, calcium hydroxide. Be. Weak.

1.with purple.

Litmus.. It turned red.

Sulfuric acid, which turns blue is calcium hydroxide.

2.With colorless.

Phenolphthalein.. It is sulfuric acid that does not change color, and calcium hydroxide that turns red.

3.Add metal zinc or iron, and there is.

Bubble. What is produced is sulfuric acid, and what does not change is calcium hydroxide.

zn+h2so4=znso4+h2

fe+h2so4=feso4+h2

4.Add some insoluble. to water. Target.

Metal oxides.

As. Copper oxide.

Iron oxide. Wait.

Solid. Gradually dissolved is sulfuric acid, and what does not change is calcium hydroxide.

cuo+h2so4=cuso4+h2o

5.Toward. Solution.

Access. Carbon dioxide.

Gas, the solution becomes turbid is calcium hydroxide.

co2+ca(oh)2=caco3+h206.Join some.

Carbonate. Or yes.

Bicarbonate, such as sodium carbonate or sodium bicarbonate. Sulfuric acid is produced by gas. 2nahco3+h2so4=na2so4+h2o+co2

7.It is also possible to use pH trial to test the solution.

Acidity and alkalinity. And so on, there are really many ways to identify the two. But the main thing is to use both.

Chemical properties. Target.

Distinguish.. Pay more attention to accumulation.

Chemistry. It's a process of accumulation.

Dilute sulfuric acid and calcium hydroxide.

The reaction that takes place is a neutralization reaction and the chemical equation is:

Ca(OH)2+H2SO4=CaSO4+2H2O, which tremor calcium sulfate is generated.

Not Li Na dissolves in water, is a white precipitated eggplant branch.