Write the chemical equation of the following reaction, and if it is an ionic reaction, write the cor

1) 2Na+O2==Na2O2 Condition: Ignited.

2na + 02 == na2o2

2) 2Na2O2+ 2H20 ==4NaOH + O22Na2O2 + 2H2O==4(Oh-) 4(Na+) O23)2NaOH +CO2= Na2CO3 + H2O4)Na2CO3+ Ba(OH)2 == 2NaOH + BaCO3 (precipitate).

co3 2-）+ba2+)==baco3

5) 2NaHCO3 == Na2CO3 + CO2 + H206)2Na + 2H2O == 2NaOH +H22Na + 2H2O == 2(Na+) +2(OH-) H27)Na2O2 + CO2 = Na2CO3 + O2Na2O2 + CO2 == 2(Na+) + CO3 2-) O2 H. It's finally over.

Thank you LS for the pull!

The first ion equation is wrong, this reaction is not carried out in an aqueous solution or in a molten state Na2O2 does not need to be disassembled; the first less gas symbol; The 6th is not trimmed with a factor of 2221

Solution: (1) Aluminum chloride is used to react with ammonia to generate aluminum hydroxide and ammonium chloride;

2) The silica in the glass reacts with the alkali to form sodium silicate, which is adhesive;

3) hydrochloric acid reacts with iron oxide in rust to form ferric chloride and water;

4) Ferrous hydroxide, oxygen, and water react to form iron hydroxide;

5) Sodium peroxide reacts with carbon dioxide to produce sodium carbonate and oxygen

1) The reaction of aluminum chloride and ammonia water to produce aluminum hydroxide and ammonium chloride is prepared, and the ion reaction is Al3++3NH3 H2O=AL(OH)3 +3NH4+, so the answer is: AL3++3NH3 H2O=AL(OH)3 +3NH4+;

2) The silica in the glass reacts with the alkali to form sodium silicate, which is adhesive, so the ion reaction is SiO2+2OH-=SiO32-+H2O, so the answer is: SiO2+2OH-=SiO32-+H2O;

3) Hydrochloric acid reacts with iron oxide in rust to form ferric chloride and water, and the ion reaction is Fe2O3+6H+=2Fe3+++3H2O, so the answer is: Fe2O3+6H+=2Fe3+++3H2O;

4) Ferrous hydroxide, oxygen, and water react to form iron hydroxide, and the chemical reaction is 4Fe(OH)2+O2+2H2O=4Fe(OH)3, so the answer is: 4Fe(OH)2+O2+2H2O=4Fe(OH)3;

5) Sodium peroxide reacts with carbon dioxide to produce sodium carbonate and oxygen, and the chemical reaction is 2Na2O2+2CO2=2Na2CO3+O2, so the answer is: 2Na2O2+2CO2=2Na2CO3+O2

2. Write the chemical equation or ionic equation for the following reaction:

1) Al(OH) 3 (ion equation) prepared in the laboratory

2) Alkaline solution can not be stored with grinding glass stoppers (ion equation).

3) The main reaction of hydrochloric acid to remove rust (ionic equation).

4) Ferrous hydroxide will be oxidized to iron hydroxide after being left in the air for a period of time (chemical equation).

5) The main reason why Na2O2 is used in breathing masks (chemical equation).

Solution: (1) Some components of bleaching powder are calcium hypochlorite, which reacts with excess carbon dioxide to form calcium bicarbonate and hypochlorous acid;

2) There is enough chlorine, so bromine ions and ferric ions are oxidized;

3) Sulfur dioxide and oxygen undergo redox reaction in the contact chamber to form sulfur trioxide;

4) Concentrated sulfuric acid has strong oxidizing properties and reacts with carbon to form carbon dioxide, sulfur dioxide and water

1) The chemical equation of excess carbon dioxide introduced into the bleaching powder solution: Ca(clo)2+2CO2+2H2O=2HCO+Ca(HCO3)2, so the answer is; ca（clo）2+2co2+2h2o=2hclo+ca（hco3）2；

2) The ion equation for the introduction of sufficient chlorine into the ferrous bromide solution is: 3Cl2+2Fe2++4BR-=6Cl-+2Fe3++2BR2, so the answer is: 3Cl2+2Fe2++4BR-=6Cl-+2Fe3++2BR2;

3) The chemical equation of the reaction that occurs in the contact chamber in the industrial production of sulfuric acid: 2SO2+O2

Catalyst. High temperature and high pressure 2SO3, so the answer is: 2SO2+O2

Catalyst. High temperature and high pressure 2SO3;

4) The chemical equation for the reaction of carbon and concentrated sulfuric acid: C+2H2SO4 (concentrated).

2SO2 +CO2 +2H2O, so the answer is: C+2H2SO4 (concentrated).

2so2↑+co2↑+2h2o．

3. Write the chemical equation or ionic equation of the following reaction

1) The chemical equation for the introduction of excess carbon dioxide into the bleach solution

2) The ion equation in which a sufficient amount of chlorine gas is passed into the ferrous bromide solution

3) The chemical equation of the reaction that occurs in the contact chamber in the industrial production of sulfuric acid 2SO2+O2 catalystHPHT 2SO3 2SO2+O2 catalystHigh temperature and high pressure 2SO3;

4) The chemical equation for the reaction of carbon and concentrated sulfuric acid is C+2H2SO4(concentrated) 2SO2 +CO2 +2H2O C+2H2SO4(concentrated) 2SO2 +CO2 +2H2O

Solution: (1) The two react to form barium sulfate precipitate and copper hydroxide precipitate;

The two react to form copper sulfate and water; Limb.

2) The reaction is an anti-sensitized bond between iron and soluble copper salts, which should generate ferrous ions and copper;

The reaction is a soluble carbonate and a strong acid reaction

1) The reaction of the two is to form barium sulfate precipitate and copper hydroxide precipitate, and the ion equation is Ba2++2OH-+Cu2++SO42-=Cu(OH)2 +BaSO4, so the answer is: Ba2++2OH-+Cu2++SO42-=Cu(OH)2 +BaSO4;

The two react to form copper sulfate and water, and the ion equation is CuO+2H+=Cu2++H2O, so the answer is: CuO+2H+=Cu2++H2O;

2) The reaction is the reaction of iron and soluble copper salts to form ferrous ions and copper, and the reaction equation is: Fe+CuSo4=Cu+FeSo4, so the answer is: Fe+CuSo4=Cu+FeSo4;

The reaction is a reaction of soluble carbonate and strong acid, and the reaction equation is: Na2CO3+2HCl=2NaCl+H2O+CO2, so the answer is: Na2CO3+2HCl=2NaCl+H2O+CO2

Comments: Test points for this question: Writing ion equations

Test Center Comments: This question examines the writing of ion equations, clarifying the properties of substances and the writing rules of ion equations is the key to solving this question, writing chemical formulas such as elemental, oxide, gas, precipitation, weak electrolyte, complex, etc., to follow the conservation of charge, atoms and transfer electrons, ion equations represent a type of reaction, and chemical equations represent a reaction

Iron powder. Reacts with water vapor.

3fe+4h2o=

fe3o44h2

2) Aluminum reacts with hydrochloric acid.

2al+6hcl=2

alcl33h2↑

2al+6h+=2al3++3h2↑

3) Aluminum. Sodium hydroxide solution.

React. 2al+2naoh+2h2o=2

naalo2

3H2 2AL+2OH-+2H2O=2alo2-+3H2 Zinc grains. And.

Copper chloride. Solution reactions.

zn+cucl2

zncl2cu

zn+cu2+=zn2++cu

fe4h2o(g)=△fe3o4＋4h2↑2al6hcl

alcl3h2al

H+ (hydrogen ions).

Al3+ (aluminum-ion).

H2 (hydrogen).

2al+2naoh+2h2o=2naalo2+3h2↑2al+2oh-+2h2o=3h2+2alo2-4、zn+cucl2=zncl2+cu

zn+cu2+=zn2+cu

3Fe + 4H2O(g) == Fe3O4 + 4H2 Because there is gas in the reactant, the gas in the product does not need to be marked with a gas symbol.

Chemical equation: 2Al+6HCl==2AlCl3+3H2( ).

Ion equation: 2Al + 6(H+) = 2(Al3+) 3H2( ).

Chemical equation: (1) 2Al + 6H2O == 2Al(OH)3( )3H2( ) sodium hydroxide solution in small amounts).

2) Al(OH)3 + NaOH == Naalo2 + H2O (sodium hydroxide solution excess).

Ionic equation (total): 2Al + 2(oh-) 2H2O == 2(AlO2-) 3H2( ).

Chemical equation: Zn + CuCl2 == ZnCl2 + Cu

Ionic equation: Zn + Cu2+) == (Zn2+) Cu

Fe+4H2O(G)=Fe3O4+4HAl+6H+ =2Al3+ +3H2 (gas symbol Al+2OH- +2H2O=2alo2- +3H2 (gas symbol)4, Zn+Cu2+ = Zn2+ +Cu

3Fe + 4H2O = Fe3O4 + H2 (gas) Condition: General High Temperature This is the reaction of iron quenching.

2al + 6hcl====2alcl3+3h2↑2al+2naoh+2h2o====2naalo2+3h2↑zn+cucl2===zncl2+cu