4 kinds of chemicals are conserved in materials, charge, and protons

Conservation of protons = conservation of charge - conservation of materials.

The conservation of material Na+=2(S2-+Hs-+H2S) and the conservation of charge (Na+)+H+)=2(S2-)+Hs-) are the prices before the number.

Everything else is the same.

The relationship between the conservation of protons and the conservation of charge is as follows:

Conservation of protons is the use of conservation of materials.

With the conservation of charge introduced, the difference is that the conservation of protons is the same number of protons, the conservation of materials is equal in molecular concentration, and the conservation of charge is equal in the total number of empty bends of the negative charge.

The conservation of electric charge is the same as the conservation of macromaterials and protons, which are the three major conservation relationships in solution. The conservation of protons can also be obtained by the conservation of charge and the conservation of materials. Conservation of materials means that the original concentration of a component in a solution should be equal to the sum of its concentrations in various forms of existence in the solution, that is, the conservation of elements.

Conservation of atoms), the number of atoms of an element before and after the change is conserved.

Conservation of matter

In a chemical reaction, the sum of the masses of the substances before participating in the reaction is equal to the sum of the masses of the substances produced after the reaction. This law is called the law of conservation of mass.

law of conservation of mass）。

In any system that is isolated from its surroundings, the total mass remains the same, regardless of the changes or processes that occur. Or rather, any change includes both chemical and nuclear reactions.

None of them can eliminate matter, but only change the original form or structure of matter, so this law is also called the law of immortality of matter.

It later evolved into one of the universal fundamental laws of nature.

Wrong. 1. Conservation of charge: anions and cations in electrolyte solution.

The number of positive and negative charges is equal, that is, the solution is not electrically conductive. (It is characterized by the fact that one side is all cation and the other side is all anion.)

coefficient for the number of charged fibers) in sodium sulfide.

C(Na+)+C(H+)=2C(S2-)+C(HS-)+C(OH-) in solution

2. Conservation of materials.

That is, the original concentration (initial concentration) of a component in the electrolyte solution should be equal to the sum of its concentrations in the various forms in which it exists in the solution. (The characteristic is that one side contains one element, and the other side contains another primitive element, and the coefficient is related to the ratio of the number of two elements in the original composition) c(na+)=2c(s2-)+2c(hs-)+2c(h2s).

3. Proton fibrillation constancy: The characteristic of water ionization is c (h+) = c (oh-), and the above two conservation phases can be added and subtracted to obtain the destroyed limb.

c (oh-)=c(hs-)+2c(h2s)+c(h+).

The conservation of protons can be pushed out by the first two conservations, not directly subtracted.

1. Conservation of charge:c(na+) c(h+) 2c(co32-) c(hco3-) c(oh-)

2. Conservation of materials: it depends on what proportion the two are mixed; For example, if sodium carbonate is mixed with sodium hydrogen carbonate 1:1 - then n(na):

n(c)=3:2 i.e. c(na+) c(h2CO3)+ c(CO32-)+c(HCO3-) 3:2,So the conservation formula of the material is:

3[c（h2co3)+ c(co32-)+c(hco3-) 2c(na+)

3. Conservation of protons: the conservation of charge and the conservation of materials are superimposed, and C(Na+) is eliminated to obtain: 3H2CO3 +2OH-+HCO3-+2H+=CO32-+2OH-

If it is other proportions, you only need to find the proportional relationship between NA and C, QingwangqiaoTo answer the question of the conservation of the mammoth, eliminate c(na+).Get new relational.

Conservation of protons: Take Na2CO3 as an example, CO32- +H2O = Reversible = HCO3- +OH-( HCO3- +H2O = Reversible = H2CO3 + OH- ( Then the equation can be listed by the conservation of protons: C(OH-) = C(H+) + C(HCO3-) + 2C(H2CO3) that is, OH - in the water is on the left, and because the sensitive H+ in the water is envied by CO32- binding, part of it becomes HCO3-, here 1 is combined, And when it becomes H2CO3, it combines 2 NaHCO3 examplesHCO3- = reversible = H+ +CO32-( HCO3- +H2O= reversible=H2CO3 + OH-( is the ionization of HCO3-, ionization produces a part of H+, and this part of H+ is not ionized by water, so when writing the conservation of protons, this part of H+ is to be subtracted, and the concentration of H+ ionized by HCO3- is equal to the concentration of CO32- ionized, Let's use C(CO32-) instead of HCO3- ionized H+ (equivalent) Because HCO3- only binds 1 H+ in water, the coefficient in front of C(H2CO3) is 1, so the following equation can be listed:

C(OH-)=C(H+)+C(H2CO3)-C(CO32-), so if you take the shot, you have to multiply it by the coefficient 2, then the above equation is listed

Conservation of charge: [H+]+Na+]=OH-]+CH3CoO-].

Conservation of material: [Na+]=CH3COO-]+CH3COOH].

Conservation of protons: [H+]+CH3CoOH]=[OH-]. The three major conservation here are conservation of charge, conservation of materials, and conservation of protons. The largest application of these three conservations is to determine the magnitude of the concentration of particles in a solution, or the equation between them.

Properties of Sodium Carbonate:

Sodium carbonate is a white, odorless powder or granule at room temperature. It is absorbent and gradually absorbs 1mol l of water (about = 15%) in the open air.

Sodium carbonate is easily soluble in water and glycerol. 20 per 100 grams of water can dissolve 20 grams of sodium carbonate, when the solubility is the largest, 100 grams of water can be dissolved gram of sodium carbonate, slightly soluble in absolute ethanol, insoluble in propanol.

Because carbonate can bind protons in water (rock trapped i.e., hydrogen ions) to form bicarbonate and jujube rock carbonic acid, and can bind protons in acid to release carbon dioxide. So sodium carbonate belongs to Brönsster base in acid-base proton theory.

According to the principle that the solubility of NH Cl is larger than that of NaCl but smaller than that of NaCl at low temperature, at 278K 283K (5 10), salt fine powder is added to the mother liquor, and NH Cl is crystallized and precipitated separately for nitrogen fertilizer.

The three major conservation here are conservation of charge, conservation of materials, and conservation of protons. The largest application of these three conservations is to determine the magnitude of the concentration of particles in a solution, or the equation between them.

The above comes with a reference to the royal appearance: Encyclopedia - sodium carbonate.

The charge is conserved h++na+=oh-+ac-

The conservation of materials is the conservation of elements, which is the conservation of the quality of the elements.

ch3cooh，ch3coona

Sodium acetate and acetic acid are mixed in a one-to-one concentration, which means that 1mol of acetic acid and 1mol of sodium acetate are mixed in solids.

Then you can directly say that there is 1molNa, 2mol of CH3COO- (or 2mol of C) in the mixture

nc=2nna+

Then dissolved in water, no matter how ionized hydrolysis, in short, the solution is Na+, CH3COOH, CH3COO-, H+. oh-

Even if a chemical reaction occurs, it is still nc=2nna+

That contains C is CH3COOH, CH3COO-, so NCH3COOH+NCH3COO- =2NNa+

Proton conservation and conservation, from the ionization of water, from the ionization equation of water, the ionization of water nh+=noh-

So the conservation of protons is the conservation of h+ and oh- masses that swim out of the ionized spike of water.

h2o=h++oh-

NH+=NOH-, in this solution, the oh- ionized by water does not bind to anything to form hydroxides, and H+ has a guess to bind to acetate to form acetic acid. So NH++NCH3Cooh=NOH-

The three major conservances are c(na+)+c(h+)=2c(s2-)+c(hs-)+c(oh-); c（na+）=c（s2-）+c（hs-）+c（h2s）；c（oh-）+c（s2-）=c（h+）+c（h2s）。

NaHS is a strong alkali and weak salt, and HS-hydrolysis causes the solution to be alkaline, and the total positive charge concentration in the solution must be equal to the total negative charge concentration, that is, the conservation of charge, the conservation of materials, and the conservation of protons are satisfied.

The three major conservations in chemistry:

1. Conservation of charge: In the electrolyte solution, no matter how many ions exist, the solution is always electrically neutral, that is, the total number of negative charges carried by anions must be equal to the total number of positive charges carried by cations, which is the so-called conservation of charge law, such as the following relationship in NaHCO3 solution: C(Na+)+C(H+)=C(HCO3-)+C(OH-)+2C(CO32-).

2. Conservation of materials: In the electrolyte solution, due to the hydrolysis of some ions, the types of ions increase, but some key atoms are always conserved, such as S2- and Hs- in the solution can be hydrolyzed, so the S element exists in three forms: S2-, Hs-, and H2S, and there is the following conservation relationship between them: C(K+)=2C(S2-)+2C(Hs-)+2C(H2S)=.

3. Conservation of protons: H+ and OH- ionized by water in any solution are always equal, that is, the ratio of H and O atoms in the solution is constant 2:1, so there is: C(H+)+C(Hs-)+2C(H2S)=C(OH-).

Conservation of electric chargeConservation of charge means that the total amount of charge is conserved in any closed system in fields such as physics, chemistry, and biology. That is, in any closed system, the net charge of the electron is always equal to the net charge of the proton, i.e., the total amount of positive and negative charges remains the same all the time.

Conservation of materialsConservation of materials means that in any chemical reaction or physical change, the total amount of matter remains constant. In other words, matter cannot be created or destroyed, but can only be transformed into other forms through chemical reactions or physical changes.

Conservation of protonsConservation of protons means that in a nuclear reaction, the total number of protons remains the same. Protons are one of the elementary particles that make up the nucleus of an atom, so the conservation of protons is very important in nuclear reactions. The law of conservation of protons can help scientists ** the possibility of nuclear reactions, thus providing guidance for the application and research of nuclear reactions.

1. Conservation of charge: The number of positive and negative charges carried by the anion and cation in the electrolyte solution is equal, that is, the solution is not electrically sensitive. (The characteristic is that one side is all cations, the other side is all anions, and the coefficient is the number of charges) in sodium sulfide solution, C(Na+)+C(H+)=2C(S2-)+C(Hs-)+C(OH-).

2. Conservation of materials: that is, the original concentration (initial concentration) of a component in the electrolyte solution should be equal to the sum of its concentrations in various forms of existence in the solution. (The characteristic is that one side contains one element, and the other side contains another primitive element, and the coefficient is related to the ratio of the number of two elements in the original composition) c(na+)=2c(s2-)+2c(hs-)+2c(h2s).

3. Conservation of protons: The characteristic of water ionization is c (h+) = c (oh-), which can be obtained by adding and subtracting the above two conservation phases.

c (oh-)=c(hs-)+2c(h2s)+c(h+)