The chemical equation for the silver mirror reaction of glucose regurgitation is

The chemical equation for the reaction of glucose and silver-ammonia solution is: CH2OH-CHOH-CHOH-CHOH-CHOH-CHOH+2[AG(NH3)2]OH (water bath heating) CH2OH-CHOH-CHOH-CHOH-CHOH-CHOH-COONH4+2AG +3NH3 +H2O.

Reaction equation of glucose To reflect the internal structure of glucose and the breakage of bonds: ch2oh-choh-choh-choh-choh-choh-cho+2ag(NH3)2OH (water bath heating) ch2oh-choh-choh-choh-choh-coonh4+2ag +3NH3+H2O

Reaction Equation CH3CHO+2AG(NH3)2OH (Water Bath)CH3COONH4+2AG +3NH3 +H2O Remarks: The principle is the weak oxidation of silver ammonia solution. In this test, other reducing substances can be used instead of acetaldehyde, such as glucose (similar to acetaldehyde, but also has an aldehyde group).

Formaldehyde (which can be seen as having two aldehyde groups) is oxidized to ammonium carbonate (NH4)2CO3. C6H12O6+2AG(NH3)2OH---heated in water bath)C5H11O5CoonH4+3NH3+2AG +H2O Reaction equation for glucose To reflect the internal structure of glucose and the broken bonds: ch2oh-choh-choh-choh-choh-choh-cho+2ag(NH3)2OH (water bath heating) ch2oh-choh-choh-choh-choh-coonh4+2ag +3nh3+h2o

Grape Fushen sugar occurs in the silver mirror reaction of the chemical equation of Kaijing

CH2OH-CHOH-CHOH-CHOH-CHOH-CHOH-CH+2AG(NH3)2OH (water bath heating).

ch2oh-choh-choh-choh-choh-coonh4+2ag↓+3nh3↑+h2o

The reaction equation of glucose silver mirror: CH2OH-CHOH-CHOH-CHOH-CHOH-CHOH-COONH4+2AG +3NH3 +H2O. The silver mirror reaction is a chemical reaction in which the solution of silver (AG) compounds is reduced to metallic silver, which is called the silver mirror reaction because the generated metallic silver adheres to the inner wall of the container and is as bright as a mirror.

Glucose, an organic compound, with the molecular formula C6H12O6. It is the most widely distributed and important monosaccharide in nature, and it is a polyhydroxyaldehyde. Pure glucose is colorless crystals, has a sweet taste but is not as sweet as sucrose, soluble in water, slightly soluble in ethanol, insoluble in ether.

The natural glucose aqueous solution rotates to the right, so it belongs to "dextrose".

In grapes, the molecular formula of sugar is C6H12O6

Contains aldehyde group tomato, aldehyde group is reducible, can occur silver mirror reaction, so the answer is: C6H12O6 reduction

The chemical equation for the reaction of glucose and silver-ammonia solution is: CH2OH-CHOH-CHOH-CHOH-CHOH-CHOH+2[AG(NH3)2]OH (water bath heating) CH2OH-CHOH-CHOH-CHOH-CHOH-CHOH-COONH4+2AG +3NH3 +H2O.

Reaction equation for glucose.

To reflect the internal structure of glucose and the breakage of bonds:

CH2OH-CHOH-CHOH-CHOH-CHOH-CHOH-CH+2AG(NH3)2OH (water bath heating).

ch2oh-choh-choh-choh-choh-coonh4+2ag↓+3nh3+h2o

Let's take a look at what the silver mirror reaction is:

The silver mirror reaction is a chemical reaction in which the solution of silver (Ag) compounds is reduced to metallic silver, and it is called the silver mirror reaction because the metallic silver generated is attached to the inner wall of the container and is as bright as a mirror. A common silver mirror reaction is a reaction in which the silver ammonia complex ammonia-silver complex (also known as the Tumon reagent) is reduced to silver by aldehydes, and the aldehydes are oxidized to the corresponding carboxylate ions, but in addition, some silver (Ag) compounds (such as silver nitrate) can also be reduced by reducing agents (such as hydrazine) to produce silver mirrors.

The silver mirror reaction is a qualitative experiment used to test aldehydes and reducing sugars, mainly to detect the presence of aldehyde groups (i.e., -cho). This experiment is simple to operate, the phenomenon is obvious, and it is easy to observe.

Therefore, the presence of aldehyde groups is the prerequisite for the silver mirror reaction to occur.

Let's take a look at glucose:

The aldehyde group in the red circle can occur, so the silver mirror reaction can occur.

Gluconic acid: The aldehyde group of glucose is oxidized to a carboxyl group, and the silver mirror reaction cannot occur without the aldehyde group Simply put, the silver mirror reaction can occur, which is to use the reducing property of the aldehyde group to oxidize it to a carboxyl group.

Glucose ——— silver mirror reaction ——— gluconic acid, so how can gluconic acid have another silver mirror reaction? If you don't understand, you can ask

Yes, the former contains aldehyde groups and the latter does not.

Silver mirror reaction of glucose:

Prepare a silver ammonia solution first, then drop a dropper of glucose solution, shake and warm the test tube in hot water. Soon it will be seen that a layer of mirror-like metallic silver is attached to the wall of the heated area of the test tube.

Reaction Equation:

agno3 + nh3·h2o = agoh↓+nh4no3

agoh + 2nh3·h2o =ag(nh3)2 oh + 2h2o

c6h12o6+2[ag(nh3)2]oh=c5h11o5coonh4+3nh3+2ag↓+h2o

Reaction essence: In this reaction, the silver ammonia solution produced by silver nitrate and ammonia contains silver hydroxide diaminia, which is a weak oxidant, which can oxidize the -cho of glucose to -COOH, and -COOH reacts with the generated ammonia to form -COONH4, and the silver ions are reduced to metallic silver.

Reaction: CH2OH-CHOH-CHOH-CHOH-CHOH-CHOH+2[AG(NH3)2]OH (water bath heating) CH2OH-CHOH-CHOH-CHOH-CHOH-CHOH-COONH4+2AG +3NH3+H2O

The principle is: the weak oxidation of silver ammonia solution.

The combined silver is reduced and glucose is oxidized)

Silver mirror reaction of glucose CH2OH-CHOH-CHOH-CHOH-CHOH-CHOH-CHoH-CH+2AG(NH3)2OH (water bath heating).

CH2OH-CHOH-CHOH-CHOH-CHOH-CHOH-COONH4+2AG +3NH3 +H2O The reaction equation between glucose and new copper hydroxide is: CH2OH (CHOH) 4CHO + 2Cu (OH) 2 - heating - > CH2OH (CHOH) 4COOH + Cu2O (precipitation) + 2H2O

Notes:All silver mirror reactions should be heated with a water bath, because when the water bath is heated, the temperature will not be too high all of a sudden and side reactions will occur, causing the silver mirror to turn yellow, and the moderate temperature is conducive to the smooth precipitation of the silver mirror.

No, because, once it is, it will affect whether the silver branch mirror on the inner wall of the test tube is smooth and bright enough.

The experimental operation of the silver mirror reaction is very demanding, the first point is to ask the silver mirror in your test tube to be smooth and bright, without yellow or black impurities.

Silver ammonia solution is a weak oxidizing agent, so it is easy to be oxidized, so in order to make the reaction can be sufficient and there is no side reaction, so it is necessary to use a new one.

Excessive aldehyde in acetoma may cause side effects. Are you still satisfied?