-
Anonymous users2024-02-061) cyclohexane + Cl2 --- light ---monochlorocyclohexane + HCl2) monochlorocyclohexane + NaOH ---ethanol, heated --- cycloethylene + NaCl + H2O
3) Cycloethylene + BR2--- o-dibromocyclohexane.
4) o-dibromocyclohexane + 2NaOH ---ethanol, heated --- 1,3-cyclohexadiene + 2NaCl + 2H2O
Concentrated sulfuric acid, heating --- ch3ch(OH)cooch2ch2ch3+H2O concentrated sulfuric acid, heating ---ch3ch2cooch(ch3)cooh+h2o Question 4 is not visible.
Hope it helps!!
-
Anonymous users2024-02-05The substitution of 1 benzene 2 and the addition of benzene 3 is also substitution, that is, the replacement reaction 4 and then a hydrogen readdition of benzene.
-
Anonymous users2024-02-04It's too much trouble. 1. CL addition reaction, dehydrogenation reaction, double bond addition, dehydrogenation reaction.
2,3, both are ordinary -cooh and -oh reactions.
4,-cooh remove oh,-oh remove h,and then add a middle bracket in the removed place.,Add lowercase n.Come to an end.
-
Anonymous users2024-02-03So much, what do you want?
-
Anonymous users2024-02-021 All 1 chemical equation: CH3COOH + = CH3COONH4 + H2O
Ion equation: CH3COOH+ = CH3COO- +NH4+
Ammonium acetate is a strong electrolyte, so write separately.
2 Chemical equation: NaHCO3 + NAOH = Na2CO3 + H2O
Ionic equation: HCO3- +OH- = H2O + CO3)2-
3 ca(oh)2+nahco3==caco3↓+naoh+h2o
Ca2+ +OH- +HCO3- == CaCO3 +H2O (lime water excess).
ca(oh)2+2nahco3==caco3↓+na2co3+2h2o
Ca2+ +2OH- +2HCO3- == CaCO3 + CO32- +H2O (lime water in small amounts).
-
Anonymous users2024-02-011 nh3h2o + ch3cooh =ch3coonh4 +h2o
The ion equation is the same as the chemical equation because it is a weak electrolyte.
2 nahco3 + naoh = na2co3 + h2o
hco3- +oh- = co3 2- +h2o
3 Small amount of 2NaHCO3 + Ca(0H)2 = Na2CO3 + CaCO3 +2H2O
2hco3 - ca2+ 2oh- = caco3 + h2o +co3 2-
Massive NaHCO3 + Ca(OH)2 = CaCO3 + NaOH + H2O
hco3 - ca2+ +oh- = caco3 +h2o
1. For those relatively simple chemical equations for balancing, the best way to use is the least common multiple methodFor example: mg+o2 ignition = mgo, the number of oxygen atoms on the left is 2, and the number of oxygen atoms on the right is 1, then the least common multiple of 2 and 1 is 2, then the coefficient in front of the magnesium oxide on the right should be 2, the coefficient in front of the magnesium oxide has become 2, then the coefficient in front of the magnesium atom should also be 2, the final formula should be 2mg+o2=2mgo, of course, the final must indicate the conditions for the chemical reaction, For example, magnesium reacts with oxygen to form magnesium oxide, and the condition required is to ignite oxygen, and finally the correct chemical formula can be obtained: 2mg+O2 ignition ==2mgo >>>More
Hey, I don't even want to write about it, didn't you learn all this in the academy?
agno3+nacl=agcl()+nano3 ag+ +cl+=agcl
bacl2+na2so4=baso4+2naclcuso4+na2s=cus+naso4 >>>More
Chemical equation.
It is a formula in which the equation is equal to the left (or arrow) of each reactant and the right is the chemical formula of each product. For example, hydrogen and oxygen react to produce water >>>More
hcl+agno3=agcl+hno3
nacl+agno3=nano3+agcl2mgcl+2agno3=mg(no3)2+agclh2so4+bacl2=2hcl+baso4h2so4+ba(no3)2=2hno3+baso4na2so4+bacl2=2nacl+baso4k2so4+ba(oh)2=2koh+baso4h2so4+ba(oh)2=baso4+2h2omgso4+ba(oh)2=mg(oh)2+baso4cuso4+ba(oh)2=cu(oh)2+baso4na2co3+2hcl=na2co3+h2o+co2na2co3+h2so4=na2so4+h2o+co2k2co3+2hno3=2kno3+h2o+co2caco3+2hcl=cacl2+h2o+co2caco3+2hno3=ca(no3)2+h2o+co2mgco3+2hcl=mgcl2+h2o+co2co2+2naoh=na2co3+h2o >>>More