After carbon dioxide is introduced into the clarified lime water, a white precipitate is formed, and

Idea 1 Acid-base synthesis Ca(OH)2+2HCl=CaCl2+2H2O

Idea 2 This reaction is a reaction with different proportions and different products If you continue to pass CO2, Ca(HCO3)2 will be produced The equation is Ca(OH)2+H2O+CO2=Ca(HCO3)2

Add hydrochloric acid to it:

CaCO3 + 2HCl = CaCl2 + CO2 + H2O to which nitric acid is dropped:

CaCO3 + 2Hno3 = Ca(NO3)2 + CO2 + H2O, in fact, it can be achieved by dropping into an acid containing acid ions that produce soluble calcium salts.

Continue to pass carbon dioxide.

ca(oh)2+h2o+co2=ca(hco3)2

Hydrochloric acid. ca(oh)2+2hcl=cacl2+2h2o

The main component of lime water is calcium hydroxide (Ca(OH)2), and the white precipitate formed by the reaction with carbon dioxide is calcium carbonate (CaCO3), so the reaction can be written: Ca(OH)2

co2==caco3

H2O wants to help you :-) Hopefully.

The main component of lime water is calcium hydroxide (Ca(OH)2), and the white precipitate formed by the reaction with carbon dioxide is calcium carbonate (CaCO3), so the reaction can be written: Ca(OH)2 CO2==CaCO3 H2O

Carbon dioxide gas is passed into lime water to form white back color precipitation; What happened was the following reaction:

Ca(OH)2 + CO2 ==CaCO3 +H2O This is in the case of sufficient calcium hydroxide, if the excess leakage of CO2 continues, the precipitation gradually disappears, because carbon dioxide and calcium carbonate react with water to form calcium bicarbonate dissolved in water, and the reaction is as follows: CaCO3 + CO2 + H2O = Ca(HCO3)2

Co in small amounts: Co +Ca(OH) = CaCo +H O.

CO2 excess: CO + H O + Caco = Ca(HCO) Carbon dioxide passes into the clarified lime water to become turbid, and carbon dioxide reacts with the clarified lime water to form calcium carbonate precipitation, the chemical equation is:

co₂+ca(oh)₂=caco₃↓+h₂o。

If carbon dioxide is introduced, the turbid lime water will become clear again, because the excess carbon dioxide reacts with calcium carbonate and water to form soluble calcium bicarbonate, the chemical equation is:

co₂+h₂o+caco₃=ca(hco₃)₂

Carbon dioxide gas passes into lime water to form a white precipitate; What happened was the following reaction:

Ca(OH)2 + CO2 ==== CaCO3 +H2O This is in the case of sufficient calcium hydroxide, if the excess CO2 is continued to be introduced, the precipitation gradually disappears, because carbon dioxide and calcium carbonate react with water to form calcium bicarbonate that can be dissolved in water, and the reaction is as follows: CaCO3 + CO2 + H2O = Ca(HCO3)2

The precipitate will disappear because CaCO3 + CO2 + H2O – Ca(HCO3)2 and calcium bicarbonate are soluble in water.

Dissolved, calcium carbonate and carbon dioxide form calcium bicarbonate, which has a greater solubility. The solubility of alkali metal carbonate is greater than that of bicarbonate, and the opposite is true of alkaline earth metal. Therefore, excess carbon dioxide is precipitated into the saturated sodium carbonate solution.

co2+ca(oh)2=caco3↓+h2o

Clarified lime water is a clear solution of Ca(OH)2, which is calcium hydroxide.

Carbon dioxide makes clarified lime water turbid, and its chemical reaction equation, you know what.

The precipitation is due to the formation of insoluble calcium carbonate:

Calcium hydroxide reacts with carbon dioxide:

co2+ca(oh)2=caco3+h2o.

1. Take the clarified lime water and add it to the test tube.

2. Exhale into the tube.

Observe the phenomenonThere is a white flocculent precipitate. (too much CO2 back to make the precipitate disappear). ca(oh)2+co2=caco3+h20

Rationale: Carbon dioxide can make clarified lime water turbid.

Procedure: Collect a bottle of exhaled gas from the human body (containing more carbon dioxide gas) Use a gas collector bottle to collect a bottle of pure carbon dioxide.

Several drops of clarified lime water were dropped into each of the two gas collection cylinders and the phenomenon was observed.

Phenomenon: There is more white precipitation in the gas collector cylinder of the exhaled gas exhaled by the human body, while all the pure carbon dioxide gas collector cylinder is white precipitation.

Conclusion: Carbon dioxide can make the clarified lime water turbid, and the more white precipitation, the more carbon dioxide in the gas.

Ask for adoption!