An experiment to produce carbon dioxide, a chemical experiment to produce carbon dioxide

Bubbles are formed on the outside of the eggshell, and at the same time, the eggshell floats up (the volume of gas is on the surface, creating buoyancy), and over time, the eggshell gradually becomes smaller and disappears (calcium acetate, calcium carbonate, water, calcium acetate, carbon dioxide).

The paper gradually zooms and burns, and after a while, the paper automatically goes out (not because the paper burns out), because the carbon dioxide generated is heavier than the air, accumulates at the bottom of the beaker, and plays a role in extinguishing the fire (in the laboratory, we should do the experiment of pouring carbon dioxide into the beaker with two candles lit one high and one low, and the low candle goes out first!!

Acetate, Calcium carbonate, Water, Calcium acetate, Carbon dioxide.

Place a beaker with a capacity of 150 ml of water on the left end of the scale, start placing the weight on the right, and move the yard to balance the scale. Once balanced, add 120 grams of weight to the right end, slowly add water to the left end, and when it is almost there, use the rubber tip dropper to add water drop by drop until the balance is balanced.

At 80ml, the method is similar.

1. Bubbles are formed, and the eggshell gradually disappears.

2. Expression: CaCO3+2CH3COOH===CA(CH3COO)2+H2O+CO2 (gas symbol).

The mass of 1 ml of water is 1 gram, and there are 120 grams of water in 120 ml, so you can take 120 grams of water with a balance.

In the same way, as long as 80 milliliters of water are measured, 80 grams of water are weighed.

Summary. Hello dear Hello, I am glad to answer for you: the method of preparing carbon dioxide in the laboratory: marble is prepared by the reaction of dilute hydrochloric acid.

Hello dear Hello, I am glad to answer for you: the method of preparing carbon dioxide in the laboratory: marble is prepared by the reaction of dilute hydrochloric acid.

Collection method: Because carbon dioxide is denser than air, it can be soluble in water and can react with water, so the upward air exhaust method is adopted; Test method: the generated gas is passed into the lime water of Chengzhu Chunqing, and the lime water becomes turbid, which proves that the gas is carbon resistant to the residual dioxide stove; Full Method:

Use a burning wooden strip to put the gas collector at the mouth of the cylinder, be careful not to reach into the bottle, if the flame is extinguished, it proves that it is full.

Why can't the copper sulfate and sodium bicarbonate solutions be reversed?

If you reverse the order, copper sulfate will react with sodium hydroxide.

There is no sodium hydroxide.

Sodium bicarbonate Typo Sorry.

Aren't these two in two bottles, and does copper sulfate suck into sodium bicarbonate.

Prevents gasping. During the reaction, the gas should not gasp if it goes to the right, does it mean that the reaction stops? Right.

When the gunpowder or explosives in a bullet are released, a large amount of gas is suddenly released, making the force extremely destructive. So, when the bullet has not been fired and the explosives have not yet been **, what about these gases hidden in **? It turns out that these gases are all together with solid matter.

If you do a small, early-on-time non-damaging **, we can understand how this chemical reaction comes about.

Find a large bottle and a cork stopper that seals the mouth of the bottle. Fold a small piece of paper into a crease, then spread out the paper and place two tablespoons of baking powder for the dough. Slowly pour the baking powder into the bottle.

Prepare a test tube, fill it with vinegar, and wet the cork with water.

Be fast. Holding the cork in one hand and the test tube full of vinegar in the other, quickly pour the vinegar into the bottle and immediately plug the stopper, but be careful not to stuff it too tightly.

The contents of the bottle suddenly sizzled, and a lot of foam gushed up, and after a while, the cork would fly up with a whirl.

Baking powder is the common name for the compound sodium bicarbonate. It is composed of sodium, hydrogen, carbon and oxygen, and after being mixed with vinegar, it is chemically counter-reacted to release a gas called carbon dioxide, which gathers in the bottle and finally washes the cork away.

Carbon dioxide is a compound of carbon and oxygen. The atoms of carbon and oxygen are part of the sodium bicarbonate molecule. Vinegar can release this atom.

Carbon dioxide is usually a gas, for example, in the experiments you do. However, it can also be purified so that it forms a solid crystal. At this time, it is called "dry ice". Dry ice can be as low as -100 degrees Fahrenheit!

The principle of laboratory production of carbon dioxide is to react marble or limestone with dilute hydrochloric acid, their main component is calcium carbonate, and the products are calcium chloride, water and carbon dioxide. The equation is CaCO3+2HCl, CaCl2+H2O+CO2.

Carbon dioxide is a colorless, odorless, and odorless gas at room temperature. The chemical formula is CO2, one of the carbon oxides, commonly known as carbonic acid, also known as carbonic anhydride or carbonic anhydride. At room temperature, it is a colorless and odorless gas, slightly denser than air, soluble in water (1 volume of H2O can dissolve 1 volume of CO2), and produces carbonic acid.

Solid carbon dioxide, commonly known as dry ice, can absorb a lot of heat during sublimation, so it is used as a refrigerant, such as artificial rainfall, and is also often used in stage art to create smoke (dry ice sublimation absorbs heat, and liquidates water vapor in air).

1. Solid carbon dioxide, commonly known as dry ice, can absorb a lot of heat during sublimation, so it is used as a refrigerant, such as artificial rainfall, and is often used to create smoke on the stage.

2. Carbon dioxide is an indispensable raw material for photosynthesis of green plants, and carbon dioxide is commonly used as fertilizer in greenhouses.

3. Carbon dioxide can also be used to prepare diamond, and the chemical equation of the reaction is 4Na + CO2 = 2Na2O + C.