Equation for the reaction of iron with dilute nitric acid

Dilute nitric acid. The equation for the reaction with a small amount of iron (iron powder reacts with excess dilute nitric acid).

Fe + 4Hno3 (dilute) = Fe (No3) 3 + No + 2H2O

The equation for the reaction of dilute nitric acid with excess iron (reaction of excess iron powder with dilute nitric acid) 3Fe + 8Hno3 (dilute) = 3Fe (NO3) 2 + 2No + 4H2O

Remembering the product, the reduction product is NO, and the sufficient amount of iron will produce +2 valent iron, and the sufficient amount of nitric acid is +3 valent iron.

Extended Information: The reaction of iron with dilute nitric acid is related to the amount of reactants, due to the metallic iron.

There is a price change. The specific situation is more complicated, and the summary analysis is as follows:

One. Knowledge induction.

The chemical reactions involved. Equation:

It is represented by a number line as follows:

Product only. There may be leftovers;

Product only. There may be leftovers;

3., the product is.

And. mixture.

Note: In. In the range of the amount ratio, it reacts exactly with dilute nitric acid, that is, when the two react just right, its amount ratio is a range, not a ratio.

Converting the quantity ratio of the above substances to the mass ratio is more convenient when applying. The correspondence with the above is:

The product is only, and there may be a surplus;

The product is only, and there may be a surplus;

, the product is. And.

mixture. When applying, the quantity ratio is calculated first, and then the reaction that occurs is determined, and then the conclusion is drawn through calculation or judgment.

Iron reacts chemically with concentrated nitric acid.

When dilute nitric acid is insufficient, the chemical equation for the reaction of iron and dilute nitric acid is: 3Fe + 8Hno3 = 3Fe (NO3) 2 + 2 No + 4H2O. When the dilute nitric acid is sufficient, the reaction equation is:

fe+4hno3=fe(no3)3 + no↑+2h2o。

Ionic equation for the reaction of iron with dilute nitric acid:

Iron in small amounts: Fe + 4H+ +NO3- = Fe3+ +NO+2H2O

Iron excess: 3Fe + 8H+ +2NO3- = 3Fe2+ +2NO+4H2O

Reaction conditions. Chemical equations are written about reaction conditions. The general ones are marked with δ above the equal sign. Trim coefficients are mostly not fractions (except for reductions between them).

The reaction that can be carried out at room temperature and pressure does not need to write the conditions; However, if the experiment in the title has a specific condition, it is always marked with that specific condition (e.g., heating). When a single condition is reflected, the condition is always written above; If there are two or more conditions, what cannot be written above is written below; When there is both a catalyst and other reaction conditions, the catalyst is always written on it.

2Fe Ten 8Hno3 = 2Fe (NO3) 3 Ten 2No Ten 4H2O Look at the ratio:

The ratio of iron to nitric acid is 2:8.

Less than 1:4, nitric acid excess, the equation remains unchanged.

>1:4, iron excess, the equation changes, because ferric iron can oxidize elemental iron to form ferric.

2Fe(NO3)3+Fe=3Fe(NO3)2 Total reaction: 3Fe 108HNO3=3Fe(NO3)2+2NO+4H2OExtended data.

Nitric acid dissolves many metals (silver can be dissolved) and produces salts, water, and nitrogen oxides. With the decrease of the concentration of the solution, the reduction product gradually transitions from ** to low price, and NO2, NO2, N2O, N2, NH4NO3 can be generated from the most concentrated to the most rare. The reduction product is generally a mixture, the metal reacts with concentrated nitric acid to form more NO2, and the reaction with dilute nitric acid forms lower price compounds such as NO, and only the very dilute cold nitric acid will react with magnesium, manganese and calcium to form hydrogen.

Iron reacts chemically with concentrated nitric acid.

The equation is as follows:Equation for the reaction of iron with dilute nitric acid

It is Fe+4H+NO3-=Fe3++NO(G)+2H2O. Iron is a metallic element with atomic number.

26, The chemical formula of iron element is Fe. Pure iron.

It is white or silvery-white, with a metallic luster. Melting point 1538, boiling point 2750, soluble in strong acid and medium strong acid, insoluble in water.

Introduction:

The ion equation is carefully carried, that is, the ion reaction is represented by the symbol of the ion that actually participates in the reaction.

of the formula. Refers to the reaction in which soluble substances are detachable. The ionic equation not only represents a certain reaction between certain substances, but also represents the same type of ionic reaction. For example, H++OH-=H2O can represent the neutralization reaction of many strong acids and strong bases.

The result of your reaction with dilute nitric acid is the production of ferric ions, as well as nitric oxide. The ionic equation is as follows: Fe+4H+NO3-=Fe3++NO(G)+2H2O

What needs to be noted is that, unlike the results of the dilute sulfuric acid reaction, the spring iron is the generation of trivalent ions.

When dilute nitric acid is insufficient, the chemical equation for the reaction of iron and dilute nitric acid is: 3Fe + 8Hno3 = 3Fe (NO3) 2 + 2

No +4H2O, when the dilute nitric acid is sufficient, the reaction equation is: Fe + 4Hno3 = Fe (No3) 3 + No + 2H2O.

Introduction to Iron. Iron is a metallic element with atomic number 26 and the chemical formula Fe. Pure iron is white or silvery-white with a metallic luster.

Iron is soluble in strong and moderately strong acids, and insoluble in water. Pure pig iron is silvery-white, and the element iron is called "ferrous metal" because the surface of the iron is often covered with a protective film of black ferric tetroxide.

What is nitric acid.

Dilute nitric acid generally refers to nitric acid, which is a strong acid with strong oxidation and corrosiveness, which is a monary inorganic strong acid, one of the six major inorganic strong acids, and an important chemical raw material. It can be used in industry to make fertilizers, pesticides, explosives, dyes, salts, etc.; In organic chemistry, the mixture of concentrated nitric acid and concentrated sulfuric acid is an important nitrification reagent, and its aqueous solution is commonly known as nitrate water or ammonia nitrogen water.

The chemical equation for the reaction of iron with dilute nitric acid:

A small amount of iron: Fe + 4Hno3 = Fe (NO3) 3 + No + 2H2o Iron excess: 3Fe + 8Hno3 = 3Fe (NO3) 2 + 2No + 4H2O The ionic equation for the reaction of iron with dilute nitric acid:

Iron in small amounts: Fe + 4H+ +NO3- = Fe3+ +NO+2H2O

Iron excess: 3Fe + 8H+ +2NO3- = 3Fe2+ +2NO+4H2O

Iron and a small amount of dilute nitric acid.

The equation of the reaction: 3Fe + 8HNO3 (dilute) = 3Fe (NO3) 2 + 2NO + 4H2O

Ionic equations.

Potato balance 3Fe + 8H (+) 2NO3 (-) 3Fe (2+) + 2NO + 4H2O

Two cases in which iron reacts with dilute nitric acid:

1. Dilute nitric acid reacts with a small amount of iron (iron powder reacts with excess dilute nitric acid).

Excess nitric acid: Fe + 4Hno3 (dilute) = Fe (NO3) 3 + No + 2H2O

Nitric acid excess: Fe + 4H (+) NO3 (-) Fe (3 +) + 2H2O + NO

2. Reaction between dilute nitric acid and excess iron (reaction between excess iron powder and dilute nitric acid).

Iron interception excess: 3Fe + 8Hno3 (dilute) = 3Fe (No3) 2 + 2No + 4H2O

Iron excess: 3Fe + 8H+ +2NO3- = 3Fe2+ +2NO+4H2O

3Fe + 8HNO3 (dilute) = 3Fe (NO3) 2 + 2NO + 4H2O.

Excess nitric acid: Fe + 4Hno3 (dilute) = Fe (NO3) 3 + No + 2H2OIron excess: 3Fe + 8Hno3 (dilute) = 3Fe (NO3) 2 + 2No + 4H2O.

Fe is a variable metal, nitric acid has strong oxidizing properties, FE and nitric acid reaction is to form ferric nitrate, fe and ferric ions react to form ferrous ions, so if nitric acid is excessive, iron and nitric acid react to form Fe(NO3)3.

Equation for the reaction of dilute nitric acid with a small amount of iron (iron powder reacts with excess dilute nitric acid):

Fe + 4Hno3 (dilute) = Fe (NO3) 3 + No + 2H2O Reaction of dilute nitric acid with excess iron (Excess iron powder reacts with dilute nitric acid):

3Fe + 8Hno3 (dilute) = 3Fe (NO3) 2 + 2No + 4H2O are counted as products, the reduction products are all NO, and the sufficient amount of iron will generate +2 valent iron, and the sufficient amount of nitric acid is +3 valent iron.

Iron reacts chemically with concentrated nitric acid.

The equation for the reaction of iron and dilute nitric acid is explained in detail.

The equation for the reaction of dilute nitric acid with excess iron (reaction of excess iron powder with dilute nitric acid) 3Fe + 8Hno3 (dilute) = 3Fe (NO3) 2 + 2No + 4H2O I hope to adopt Oh dear!

Step 1: When dilute nitric acid is sufficient.

Fe+4Hno3=Fe(NO3)3+NO+2H2OStep 2:

When dilute nitric acid is insufficient.

FE reduces ferric iron to ferric iron.

2fe(no3)3+fe=3fe(no3)2

Iron reacts chemically with concentrated nitric acid.

The chemical equation for the reaction of iron with concentrated nitric acid is given below

A small amount of iron: Fe + 6Hno3 (concentrated) = Fe (No3) 3 + 3 No2 + 3H2O (condition: heating).

Excess iron: Fe + 4Hno3 (concentrated) = Fe (No3) 2 + 2NO2 + 2H2O (condition: heated).

The ionic equation for the reaction of iron with concentrated nitric acid is given below

A small amount of iron: Fe + 6H+ +3NO3- = Fe3+ +3NO2 +3H2O (condition: heating).

Excess iron: Fe + 4H+ +2NO3- = Fe2+ +2NO2 + 2H2O (Condition: Heating).