What are the equations for the thermal decomposition of calcium bicarbonate calcium carbonate ammoni

Ca(HCO3)2 = Heating = CaCO3 + CO2 + H2OCACO3 = High Temperature = Cao + CO2

NH4HCO3 = Heating = NH3 + H2O + CO2 Cu2(OH)2CO3 = Heating = 2Cuo + CO2 + H2O

The equation for the reaction of sodium carbonate and calcium hydroxide is: Na2CO3 + Ca(OH)2=2NaOH+CaCO3.

After calcining the limestone into calcium oxide, it is digested by selection and water in a ratio of 1:(3) to generate calcium hydroxide material liquid through purification, separation and slag removal, and then centrifugal dehydration, dried at 150 300, and then screened (above 120 mesh) is the finished calcium hydroxide product.

The reagent calcium chloride is dissolved in water to prepare a 25% aqueous solution, heated to 80, and then the filtered 30% sodium hydroxide solution (which can exceed 30% of the theoretical amount) is added in stages to obtain calcium hydroxide, and the resulting slurry mixture is washed after filtration, and a large number of chloride ions are washed away with an aqueous solution of sodium hydroxide, and then washed with distilled water until the chloride ions are qualified.

Applications:

Calcium hydroxide is alkaline, so it can be used to reduce the acidity of the soil, thereby improving the soil structure. The Bordeaux liquid in pesticides is prepared in a certain proportion using lime milk (calcium hydroxide dissolved in water) and copper sulfate aqueous solution. In winter, the trees are overwintered to prevent insects, and the roots of the trees are coated with 80 cm of lime mortar.

Calcium hydroxide can be used in rubber, petrochemical additives, such as petroleum industry added to lubricating oil, can prevent coking, sludge deposition, neutralization and anti-corrosion.

Calcium hydroxide is used to prepare bleaching powder, bleaching powder, disinfectant, acid producer, astringent, hard water softener, soil acid prevention agent, depilatory agent, buffer agent, neutralizing agent, curing agent, etc.

The above content reference: Encyclopedia - calcium hydroxide.

The reaction equation of ammonium bicarbonate and calcium hydroxide is NH4HCO3 + Ca(OH)2===NH4OH+H2O+CaCO3. Ammonium bicarbonate is a white compound that crystals in granular, plate, or columnar form with an ammonia odor. Ammonium bicarbonate is a carbonate, so it must not be placed with acid, because acid will react with ammonium bicarbonate to form carbon dioxide.

Deterioration of ammonium bicarbonate.

Calcium hydroxide, an inorganic compound, with the chemical formula Ca(OH)2, commonly known as hydrated lime.

or slaked lime. It is a white powdery solid, after adding water, it is two layers, the upper layer of aqueous solution is called clarified lime water, and the lower layer of suspension is called lime milk or lime slurry. Lime is the earliest cementitious material used by human beings to tremble and seep holes.

The ancient Greeks used it for construction in the 8th century BC, and China also began to use lime in the 7th century BC. Many of the ornate murals and rammed foundation sites of the ancient nightshade have been preserved with lime. The construction of the Great Wall of Qin is also an example.

The chemical equation for the thermal decomposition of calcium bicarbonate is: Ca(HCO3)2 = CaCO3 + CO2 (rise) + H2O (heating).

The chemical formula of calcium bicarbonate is Ca(HCO3)2, which is soluble in water and is an inorganic acid salt. It is used as dough conditioner, loosening agent, yeast food, emulsifier, curing agent, stabilizing agent, etc. Calcium bicarbonate is relatively stable at a temperature below 0 degrees, and the state at room temperature refers to the unstable decomposition to form calcium carbonate solids.

When calcium bicarbonate is decomposed or heated, calcium carbonate, water and carbon dioxide gas are generated.

The chemical equation for the reaction of ammonium bicarbonate with a sufficient amount of calcium hydroxide:

nh4hco3 + ca（oh）2 = caco3↓+2h2o+nh3↑

The ionic equation for the reaction of ammonium bicarbonate with a sufficient amount of calcium hydroxide:

nh4+ +hco3- +2oh- +ca2+ =nh3↑ +caco3↓ +2h2o

The chemical equation for the reaction of ammonium bicarbonate with a small amount of calcium hydroxide:

2nh4hco3+ca（oh）2=caco3↓+（nh4）2co3+2h2o

The ionic equation for the reaction of ammonium bicarbonate with a small amount of calcium hydroxide:

ca2+ +2oh- +2hco3- =caco3↓ +co32- +2h2o

1. Calcium bicarbonate pyrolysis: 2Ca(HCO3)2=CAC3+CO2+H2O;

2. Calcium bicarbonate is an inorganic acid salt. Soluble in water, chemical formula CA (HCO?).)?

Calcium bicarbonate can be obtained by the reaction of sodium bicarbonate and calcium salts that are easily soluble in water. Calcium bicarbonate is more stable below 0 degrees Celsius than Yinshiyun; It is easy to decompose at room temperature to obtain calcium carbonate solids.

The chemical equation for the thermal decomposition of calcium bicarbonate is: 2Ca(HCO) CaCo+Co+HO.

Calcium bicarbonate is an inorganic acid salt. Soluble in water, the chemical formula Ca(HCO) calcium bicarbonate can be obtained by the reaction of sodium bicarbonate and calcium salts that are easily soluble in water. Calcium bicarbonate is relatively stable below 0 degrees Celsius; It is easy to decompose at room temperature to obtain calcium carbonate solids.

When calcium carbonate encounters carbon dioxide and water, chemical attack occurs to form soluble calcium bicarbonate, which produces the phenomenon of "water droplets and stone penetration" over time.

Chemical formula Ca(HCO) Relative molecular mass, calcium carbonate is dissolved in carbonic acid to form calcium bicarbonate. Evaporation of calcium bicarbonate solution yields calcium carbonate solids. Soluble in water, thermal decomposition; Positive salts are formed with alkalis.

When calcium bicarbonate is dissolved in water, its aqueous solution is also called "hard water". Groundwater is "hard water". The water in rivers, lakes and seas is not "hard water" (hard water refers to metal cations such as calcium ions and magnesium ions, and their carbonates are insoluble in water.

used in dough conditioner, loosening agent, yeast food, emulsifier, curing agent, stabilizer, etc. Yushen calcium bicarbonate is relatively stable at a temperature below 0 degrees, and decomposes unsteadily at room temperature to form calcium solids in the carbonate front. When calcium bicarbonate is decomposed by heat, it produces calcium carbonate, water, and carbon dioxide gas.

nh4)2co3 + ca(oh)2 = caco3↓ +2nh3·h2o

When the temperature is high or the pH of the solution is high: NH3·H2O = NH3 Doua + H2O