How are sulphur dioxide pollutants produced?

1. In places like power plants, large quantities of coal are burned to generate electricity, and coal contains impurities such as sulfur. When sulfur is oxidized, sulfur dioxide may be produced.

2. When chemical plants produce compounds such as sulfuric acid, they often need to oxidize the sulfur elements in the sulfur ore into sulfur trioxide and inject them into the solution to make corresponding chemical products. And this sulfur element usually has an incomplete oxidized part, which is sulfur dioxide, and if there are no good environmental protection measures, this kind of sulfur dioxide emissions are also very large. In fact, sulfur is easily oxidized to sulfur dioxide after it is oxidized to sulfur monoxide, but from sulfur dioxide to sulfur trioxide, higher temperatures and more adequate oxygen conditions are required, so chemical plants are also very prone to produce large amounts of sulfur dioxide.

It is mainly because of the combustion of sulfur-containing fuels, most of which are related to coal-fired power plants and coal-fired boilers in various industries, as well as the production emissions of metallurgical and chemical enterprises.

Car exhaust, factory emissions, and more.

There is no SO2 in vehicle exhaust emissions

Mainly the combustion of sulfur coal. It is generally emitted in factories and homes.

Coal-burning factories, cars, etc.

Agree with the statement upstairs, especially after the combustion of high-sulfur coal, there is a lot of sulfur dioxide!

Combustion of sulphurous fuels such as coal.

It is composed of sulfur oxide molecules.

Any substance has a smallest unit composition, this smallest unit may be a molecule, it may be an atom, why sulfur dioxide is made of molecules, because molecules are the smallest particles that maintain the chemical properties of the substance, if it is composed of sulfur atoms and oxygen atoms, it is not necessarily sulfur dioxide, it may be sulfur trioxide, the chemical properties of the substance are changed, so, we say that sulfur dioxide is composed of sulfur dioxide molecules.

1. Macroscopically, sulfur dioxide is composed of sulfur and oxygen.

2. Microscopically, sulfur dioxide is composed of a large number of sulfur dioxide molecules.

3. A sulfur dioxide molecule is composed of one sulfur atom and two oxygen atoms.

1. When a volcano erupts, it will spew out liter sulfur dioxide gas, which is a colorless and transparent gas.

2. Sulfur dioxide is also produced in many industrial processes.

3. Since coal and oil usually contain sulfur, sulfur dioxide will be generated when burned. The use of these fuels is one of the reasons for the environmental effects of energy.

Sulfur dioxide is dissolved in water to form sulfurous acid. Sulfurous acid is further oxidized to produce sulfuric acid (the main component of acid rain) efficiently.

There are many ways to generate it.

Coal and oil often contain sulfur compounds, which produce sulfur dioxide when burned.

Industrial ......The sea is up.

Industrial preparation. Sulfur dioxide (SO2).

The methods for producing sulfur dioxide are: incineration of sulfur; roasting pyrite or non-ferrous metal sulfide ores; incineration of gases containing hydrogen sulfide; calcined gypsum or phosphogypsum; pyrolysis of waste sulfuric acid or ferrous sulfate; and from flue gases from which sulphurous fuels are burned** (see sulphuric acid feedstock).

Liquid sulphur dioxide is usually produced as pure sulphur dioxide gas and then liquefied by compression or freezing. The important industrial production methods are:

Hanehi-Helotfa. This method was founded in 1884, using water as an absorbent, the solution after absorbing sulfur dioxide is desorbed by steam, and the desorption gas is condensed and dried and liquefied. The pressurized water absorption method has now been developed.

Ammonia-sulfuric acid method. This method is often used for the first conversion of sulfur dioxide in the sulfuric acid plant. Ammonia is used as the original absorbent, and the absorption solution is decomposed with sulfuric acid to prepare pure sulfur dioxide gas.

Solution absorption method. Inorganic or organic solutions are used to absorb low-concentration sulfur dioxide gas, and then the absorption liquid is heated and regenerated to produce pure sulfur dioxide. The main absorbents are sodium carbonate, sodium citrate, basic aluminum sulfate, organic amines and other solutions.

Direct condensation. Partial condensation and separation of sulfur dioxide from sulfur dioxide containing gas by freezing method directly produces liquid sulfur dioxide, and the uncondensed sulfur dioxide is returned to the sulfuric acid production system.

Sulfur trioxide-sulfur method. The liquid sulfur and sulfur trioxide are reacted in the reactor to produce pure sulfur dioxide gas. Laboratory preparation.

Sulfur dioxide is usually produced by reacting sodium sulfite with concentrated sulfuric acid in laboratories.

na2so3+h2so4=na2so4+so2(g)+h2o

Or use copper to heat the reaction with concentrated sulfuric acid.

cu+2h2so4=△=cuso4+so2(g)+2h2o

Tail gas treatment: Sodium hydroxide solution is introduced.

2naoh+so2=na2so3+h2o

Other methods. Sulphur dioxide can be produced under the condition that sulphur burns.

s(s)+o2(g) →so2(g)

Hydrogen sulfide can be burned to produce sulfur dioxide.

2h2s(g) +3o2(g) →2h2o(g) +2so2(g)

Pyrite, sphalerite, mercury sulfide can be heated to produce sulfur dioxide.

4fes2(s) +11o2(g) →2fe2o3(s) +8so2(g)

2zns(s) +3o2(g) →2zno(s) +2so2(g)

hgs(s) +o2(g) →hg(g) +so2(g)