Write chemical equations. Rush There are bonus points at the end

4na+o2=2na2o

na+2s=na2s

2na+2h2o=2naoh+h2

na2o+co2=na2co3

na2o+h2o=2naoh

na2o+2hcl=2nacl+h2o

2na2o2+2co2=2na2co3+o2na2o2+h2o=2naoh+o2

2k+2h2o=2koh+h2

li+o2=lio2

2h2o+2li=2lioh+h2

NaHCO3 HCl=NaCl CO2 H2O2NaHCO3=CO2++H2O+Na2CO3NaHCO3+NAOH=Na2CO3+H2ONa2CO3+BACl2=BaCO3+2NaCl So the reaction conditions and some gas and precipitation symbols are noted by yourself.

1.Chemical reaction with the participation of hydrogen 2H2 + O2 = ignition = 2H2O

2.There is a decomposition reaction with hydrogen generation 2H2O = Energized = 2H2 +O2

3.Displacement reaction with the participation of hydrogen 3C + 2Fe2O3 = High temperature = 4Fe + 3CO2

4.There is a displacement reaction for hydrogen generation Zn+H2SO4=ZNSO4+H2

5.The chemical reaction with the participation of water H2O+CO2=H2CO3

6.Chemical reaction with water generation 2H2+O2=ignition=2H2O

7.Decomposition reaction with the participation of water 2H2O = energized = 2H2 + O2

8.Decomposition reaction with water generation 2H2O2=(MNO2)=2H2O+O2

9.The displacement reaction with the participation of water is 2Na+2H2O=2NaOH+H2

10.There is a displacement reaction of water generation H2+CO=C+H2O (condition is high temperature).

11.There is a metathesis reaction produced by water HCl+KoH=KCl+H2O

12.There are non-basic types of reactions that are generated by water CH4+2O2=CO2+2H2O

13.Compounding reaction with the participation of carbon dioxide H2O+CO2=H2CO3

14.There is a chemical reaction with carbon dioxide generation C+O2=CO2

15.There is a decomposition reaction in which carbon dioxide is generated, H2CO3 = H2O + CO2

16.There are non-basic types of reactions for carbon dioxide production CH4+2O2=CO2+2H2O

17.Mg+CO2==MGO+C in the displacement reaction with the participation of carbon dioxide

18.There is a displacement reaction where carbon dioxide is generated, c + 2cuo = 2cu + CO2

19.There is a metathesis reaction for the production of carbon dioxide. 2hcl+caco3=cacl2+h2o+co2↑

20.Metathesis reaction with the participation of carbon dioxide 2NaOH+CO2=Na2CO3+H2O

Purely handwritten、、Hope to give points。

H2+O2 a.

H20 is powered on.

3.h2+cuo-one.

One heats one Naoh + H2 one one.

One ignites one. One ignition and one high temperature.

One ignition mg0 + c one by one.

One last one is strictly not considered to be a decomposition, but the standard seems to be collected.

The simple reaction is not fully written, and the mobile phone reply is inconvenient after all, so it's time to give points, right?

Hydrogen combustion in air: 2H2 + O2 ignites 2H2O

Water decomposes under the action of direct current (study of the composition of water experiments): 2H2O energized 2H2 + O2

Reduction of copper oxide by hydrogen: H2 + Cuo heating Cu + H2O

Iron and dilute sulfuric acid Fe + H2SO4 = FeSO4 + H2

Sodium peroxide reacts with water: 2Na2O2 + 2H2O = 4NaOH + O2

Hydrogen combustion in air: 2H2 + O2 ignites 2H2O

Water decomposes under the action of direct current (study of the composition of water experiments): 2H2O energized 2H2 + O2

Aluminum hydroxide pyrolysis: 2Al(OH)3Al2O3 + 3H2O

c+h20=co+h2

H2 + Cuo heating = Cu + H2O

hcl+naoh=nacl+h2o

Cu + 4Hno3 (concentrated) === Cu(NO3)2 + 2NO2 +2H2O

h2o+co2==h2co3

2CO+O2=Ignition = 2CO2

caco3===cao+co2

ch4+o2==co2+2h2o

mg+co2==mgo+c

c+2cuo==2cu+co2

na2co3+2hcl==2nacl+h2o+co2

co2＋2naoh=na2co3+h2o

.Chemical reaction with the participation of hydrogen 2H2+O2===2H2O

2.There is a decomposition reaction with hydrogen generation 2H2O===2H2+O2

3.Displacement reaction with the participation of hydrogen H2+CuO===Cu+H2O

4.There is a displacement reaction of hydrogen generation Zn+2HCl===Znc2+H2

5.Chemical reaction with the participation of water CaO+H2O===Ca(OH)2

6.There is a chemical reaction of water generation 2H2+O2===2H2O

7.Decomposition reaction with the participation of water 2H2O===2H2+O2

8.There is a decomposition reaction with water generation Ca(OH)2====CaO+H2O

9.The displacement reaction with the participation of water is 2Na+2H2O=2NaOH+H2

10.There is a displacement reaction with water generation H2+CuO===Cu+H2O

11.There is a metathesis reaction of water generation 2NaHCO3====Na2CO3+CO2+H2O

12.There are non-basic types of reactions that are generated in water CH3COOCH3+H2O===CH3COOH+CH3OH

13.Chemical reaction with the participation of carbon dioxide CO2+C==2CO

14.There is a chemical reaction with carbon dioxide generation C+O2=CO2

15.There is a decomposition reaction of carbon dioxide generation 2NaHCO3====Na2CO3+CO2+H2O

16.There are non-basic types of reactions for carbon dioxide production CH4+2O2=CO2+2H2O

17.Mg+CO2==MGO+C in the displacement reaction with the participation of carbon dioxide

18.There is a displacement reaction for carbon dioxide generation CO+CuO===CO2+Cu

19.There is a metathesis reaction of carbon dioxide generation Na2CO3+2HCl===NaCl+CO2+H2O

20.Metathesis reaction with the participation of carbon dioxide Ba(OH)2+CO2===BAC3+H2O

+ O2 ignites 2H2O

Energized 2H2 + O2

Cuo heats Cu + H2O

C High temperature H2 + CO

h2o === ca(oh)2

+ O2 ignites 2H2O

Power-on 2H2 + O2 only hit so much, too tired + C high temperature H2 + CO

Cuo heats Cu + H2O

jklmnop

Ferrous hydroxide dew is placed in air with 4Fe(OH)2+O2+2H2O---4Fe(OH)3

Sulfur combustion S+O2---SO2

Sulfur dioxide continues to oxidize 2SO2+O2====2SO3

Sulfur trioxide is absorbed by water SO3+H2O---H2SO4

Sulfur dioxide is introduced into chlorine water SO2+Cl2+2H2O---H2OS4+2HCl

Sulfur dioxide is introduced into bromine water SO2+BR2+2H2O---H2SO4+2HBR

Copper is coheated with concentrated sulfuric acid Cu+2H2SO4 (concentrated)--CuSo4+SO2+2H2O

Benzene reacts with liquid bromine under the action of iron C6H6+BR2---C6H5BR+HBR

Silver mirror reaction of glucose.

ch2oh(choh)4cho+2ag(nh3)2oh---ch2oh(choh)4coonh4+3nh3+h2o

Film reaction of glucose CH2OH (CHOH) 4CHO + 2Cu (OH) 2--- CH2OH (CHOH) 4COOH + Cu2O + 2H2O

Aggravated reaction of vinyl chloride nch2=chcl---ch2-chcl-]n-

Nitration of benzene C6H6+HNO3 (concentrated)--C6H5NO2+H2O

Hydrolysis of ethyl chloride CH3CH2Cl+NaOH (water)--CH3CH2OH+NaCl

Elimination of ethyl bromide CH3CH2BR+NaOH(alcohol)--CH2=CH2+NABR+H2O

Ethanol is eliminated CH3CH2OH ---CH2=CH2+H2O (concentrated sulfuric acid, 170 degrees).

Phenol reacts with caustic soda C6H5OH+NaOH---C6H5ONa+H2O

Phenol reacts with concentrated bromine water C6H5OH+3BR2---C6H2BR3OH!+3hbr

Catalytic oxidation of acetaldehyde 2CH3CHO+O2---CH3COOH

These are all basic things, hopefully remember not to ask a second time.

2fecl3 + cu === cucl2 + 2fecl2

Cu + Cl2 == Ignition == CuCl2

2cu + o2 + co2 + h2o === cu2(oh)2co3

2cu + o2 ==△== 2cuo

cuo + h2 ==△== cu + h2o

cuo + co ==△== cu + co2

cuo + h2so4 === cuso4 + h2o

Cu + 2H2SO4 (concentrated) == == CuSO4 + SO2 + 2H2O

cuso4 + fe === feso4 + cu

cu(oh)2 ==△== cuo + h2o

11、cuso4 + 2naoh === cu(oh)2 + na2so4

12、cu(oh)2 + h2so4 === cuso4 + 2h2o

1. In alkaline solution, +1-valent chlorine (clo-) and -1-valent chlorine (cl-) are more stable than chlorine. Therefore, chlorine gas is prone to disproportionation reaction in alkaline solution.

2. The acidity of carbonic acid is stronger than that of hypochlorous acid, so hypochlorite can react with CO2 and H2O (equivalent to carbonic acid) to obtain hypochlorous acid.

3. Same as question 1.

4. Same as question 2. The fact that hydrochloric acid is more acidic than hypochlorous acid is the essential reason.

5. Same as question 2. The fact that carbonic acid is more acidic than hypochlorous acid is the essential reason.

6. The proposition is incorrect! The yellow-green chlorine color is produced by the Cl2 molecule. It reacts with water only in small amounts to form hydrochloric acid and hypochlorous acid. The main reasons for the yellow-green color disappearance of the NaOH solution are:

2naoh + cl2 = naclo + nacl + h2o

Since the product is colorless, the color of the solution fades. It has nothing to do with the hypochlorous acid molecule.

If the magenta solution is added to fade, it can be proved that this is because the Cl2 molecule can't do it and the HClo molecule can.