Find all chemical reaction equations for junior high school. Remember to write down what and what re

Examples of chemical equations for chemical reactions learned in junior high school are as follows:

1. Sodium reacts with oxygen in the air

4na+o₂=2na₂o

2. Synthesis reaction of sodium and sulfur:

2Na+S=NaS (Condition: Heating).

3. Sodium is burned in chlorine

2Na+Cl = 2NaCl (Condition: Ignition).

4. Reaction of sodium oxide and carbon dioxide

na₂o+co₂=na₂co₃

5. Sodium carbonate reacts with carbon dioxide and water

na₂co₃+h₂o+co₂=2nahco₃

6. Magnesium burns in chlorine

Mg+Cl = MgCl (Condition: Ignition).

7. Reaction between magnesium and nitrogen:

3mg+n = mgn (condition: ignition).

8. Reaction between magnesium oxide and carbon dioxide:

mgo+co₂=mgco₃

9. Reaction between aluminum and oxygen:

4al+3o₂=2al₂o₃

10. Iron burns in oxygen

3Fe+2O = Fe O (Condition: Ignition).

11. Iron burns in chlorine

2Fe+3Cl = 2FeCl (Condition: Ignition).

12. Copper burns in chlorine gas

Cu+Cl = CuCl (Condition: Ignition).

13. Reaction between hydrogen and chlorine:

H+Cl = 2HCl (Condition: Light).

14. Sulfur burns in oxygen:

s+o = so (condition: ignition).

15. Sulfur is burned in hydrogen:

s+h = h s (condition: ignition).

16. Reaction of sulfur trioxide with water:

so₃+h₂o=h₂so₄

17. Reaction between nitrogen and oxygen:

n + o = 2no (condition: discharge).

NaOH+HCl==NaCl+H2O sodium hydroxide can be neutralized with hydrochloric acid to generate sodium chloride and water, and the reaction is exothermic. Ba(OH)2+2HCl==BACl2+2H2O The neutralization reaction of barium hydroxide and hydrochloric acid is carried out to form barium chloride and water. Fe(OH)3+3HCl==FeCl3+3H2O Ferric(III) hydroxide is insoluble in water, but can also neutralize with hydrochloric acid to form ferric chloride and water.

KOH+HI==Ki+H2O Potassium hydroxide and hydroiodic acid undergo a neutralization reaction to generate potassium iodide and water. Cu(OH)2+H2SO4==CuSO4+2H2O Copper hydroxide and sulfuric acid undergo a neutralization reaction to form copper sulfate and water. It can be seen that the reaction between acid and alkali to produce salt and water is a neutralization reaction.

The neutralization reaction is a metathesis reaction. However, what happens between an acid and a base is not necessarily a neutralization reaction, for example: 2CO(OH)3+6HCl==2COCl2+Cl2 +6H2O Cobalt(III) hydroxide and hydrochloric acid undergo a redox reaction to produce cobalt(II) chloride), chlorine gas and water, the reaction is exothermic, and the solution turns pink.

2Ni(OH)3+6HCl==2nicL2+Cl2 +6H2O Nickel(III) hydroxide and hydrochloric acid undergo redox reaction to generate nickel chloride(II), chlorine gas and water, the reaction is exothermic, and the solution turns turquoise. Because trivalent cobalt and nickel are oxidizing and can oxidize hydrochloric acid to produce chlorine gas, this kind of reaction is not a neutralization reaction. Similarly, the reaction of ferrous hydroxide and nitric acid is not a neutralization reaction.

The chemical reaction in the junior high school examination mainly refers to the reaction with oxygen. The common equations are as follows:

Hydrogen ions and hydroxide ions are neutralized to form water

It is a reaction in which a mold of H ions and a mold of oh ions react to form a mold of water.

That's too much. Combustion of magnesium, carbon, sulfur, phosphorus, iron wire, etc. in oxygen. Calcium oxide reacts with water. Carbon dioxide and water reactions. The chemical equation is.

A chemical reaction is a reaction in which two or more substances react to form a new substance. Some of these reactions are redox reactions and some are non-redox reactions. In addition, chemical reactions generally release energy.