Which chemist can help with this formula

First, v(l) is divided by , and the number of moles of gas is set to n(mol) fraction and divided by top and bottom.

1000(ml/l)*ρg/ml)*n(mol)c=---m(g/mol)*n(mol)+1000(g/l)v(h2o)(l)

Finishing (think of g l as a unit of density that has been deformed, and the density of water is 1g ml = 1000g l).

1000 (ml l) * g ml) * n (mol) c = --- gas mass + water mass (the denominator is the total mass of the solution) We know that the mass of the solution divided by the density of the solution is the volume of the solution, then divide by the denominator as one of the integral points of the solution, 1000 (ml l) * n (mol).

c = --- volume of solution (ml).

n(mol)

c = --- volume of solution (l).

c = the amount concentration of the solution substance (mol l).

I haven't done chemistry for a month after the college entrance examination, and I'm not good at being rusty, so I'm smiling.

This is the mass concentration of the gas solute completely dissolved in water?

Think of it this way: Push back.

c = the amount of the substance and the volume of the solution.

The amount of the substance = the standard volume of the gas

Solution volume = total mass of solution density.

gas mass + water mass) density.

Gas mass + water volume * water density [1000g l]) solution density.

And gas mass = amount of gaseous substance * molar mass of gas.

Gas standard volume Molar mass of the gas.

With unit calculations:

n = v gas

v solution = (v gas (l) * m (g mol) + v water (l) * 1000g l) p (g ml).

c=n v, simplify, you will know it yourself (note that in order to unify the unit of liquid density, you must multiply by 1000).

I've had countless brain cell deaths...

It will be the calculation of the concentration of the quantity of the substance...

After the college entrance examination, it seems that there is no such thinking now.

w=1 x=3 y=1 The product also has 2 parts water and one part ammonium nitrate.

The chemical formula of this molecule is:

c5h11no.

Other data are shown in the figure.

The chemical formula of this substance is: C5H11NO

The name is: 4-hydroxypiperidine, or p-hydroxypiperidine.

See the figure below for details.

It is not difficult to get this chemical formula, it does have 12 carbons and 6 oxygen, and the molecule contains 6 double bonds and 2 rings, so the unsaturation is 8.

So the calculation shows that there are only 10 hydrogens in this molecule, not 12 hydrogens. So a is wrong, this molecule contains carboxyl group, ester group, hydroxyl group, carbon-carbon double bond, so there are more than 3 functional groups.

The arrows may need to be changed to equal signs.

∵c（ch3coo－）＋c(oh-)=c（h＋）+c(na+)

2c（ch3coo－）＋2c(oh-)=2c（h＋）+2c(na+)

C(CH3COO)+C(CH3COOH)=2C(Na+)Conservation of materials.

c（ch3coo－）＋2c（oh－）＝2c（h＋）＋c（ch3cooh）

The lower one is about the same as the upper one.

The charge is conserved to obtain 2C(CH3CoO-) 2C(OH-) == 2C(H+) 2C(Na+).

The material is conserved to obtain 2C(Na+) == C(CH3COO-) C(CH3COOH).

The superposition of the two formulas yields C(CH3CoO-) 2C(OH-) == 2C(H+) C(CH3CoOH).

Anyway, I hope it works.

I have never been able to understand the significance of establishing such a concentration relation. Please advise.

I think it's a pointless math game. H+ OH- is so small in concentration, what's the point of adding it on both sides?

Let the concentration be a mol L acetic acid dissociation constant PK =CH3COOH ==== CH3COO- +H + mixed concentration A2 A2 C(H+).

k == [ c（h+） a/2 ] / a/2 == c（h+）

pk == ph ==

Suppose that the solution is eventually equivalent to the ionization of only acetic acid, and at equivalence equilibrium, it is equivalent to the ionization of acetic acid x. Let no reaction occur when just mixing, at this time the acetic acid concentration is c, the acetate concentration is also c, after the equivalent equilibrium, the acetic acid concentration is c x, the acid concentration is c x, and the water is ionized y, then the hydrogen ion concentration is x y, and the hydroxide concentration is y, so the left side of the equation is c x 2y, and the right side of the equation is 2 (x y) c x, and it is easy to verify that the left side is equal to the right side.

The assumption about the pure ionization of acetic acid at the beginning can also be thought of as a pure hydrolysis of the acid roots, with only a change in the X sign.

This is the conservation of protons. Available by.

Conservation of electric charge: A: C(CH3COO-)+C(OH-)=C(H+)+C(Na+).

and C(CH3COOH)+C(CH3COO-)=2C(Na+)(B) A*2-B, and then arrange C(CH3CoO-) 2C(OH-) == 2C(H+) C(CH3CoOH).

It's not that you are too ruthless if you don't help you! Won't one of them?

Here you go, go and see.

Adopt me.

You're going to drop out of school! This is the most basic content of high school! I can't help you.

This is the most basic content of high school! I can't help you.

How can you help if you don't send it out?

Write yourself according to the law of conservation of atoms, ask others to help you, so what will you do in the future?