Typical equation of displacement reaction, equation of displacement reaction

Compounding reaction CO2 + H2O === H2CO3 Cao + H2O === Ca(OH)2

Decomposition reaction H2CO3 === H2O + CO2 Cu(OH)2= Heating = Cuo + H2O

Displacement reaction Zn + H2SO4 === ZnSO4 + H2

zn + 2hcl === zncl2 + h2↑

Metathesis reaction.

1) Basic oxide acid salt H2O

fe2o3+6hcl==2fecl3+3h2o fe2o3+3h2so4==fe2(so4)3+3h2o

cuo+h2so4==cuso4+h2o zno+2hno3==zn(no3)3+h2o

2) Alkaline acid salt H2O

cu(oh)2+2hcl==cucl2+2h2o cu(oh)2+h2so4==cuso4+2h2o

naoh+hcl==nacl+h2o 2naoh+h2so4==na2so4+2h2o

naoh+hno3==nano3+h2o mg(oh)2+2hno3==mg(no3)2+2h2o

ba(oh)2+h2so4==baso4↓+2h2o

3) Acid salt, new salt, new acid.

caco3+2hcl==cacl2+h2o+co2↑

na2co3+2hcl==2nacl+h2o+co2↑

hcl+agno3==agcl↓+hno3 h2so4+bacl2==baso4↓+2hcl

ba(no3)2+h2so4==baso4↓+2hno3

nahco3+hcl==nacl+h2o+co2↑

4) Salt 1 Salt 2 New Salt 1 New Salt 2

kcl+agno3==agcl↓+kno3 nacl+agno3==agcl↓+nano3

na2so4+bacl2==baso4↓+2nacl bacl2+2agno3==2agcl↓+ba(no3)2

cacl2+na2co3==caco3↓+2nacl

5) Saline, alkali, new salt, neoalkali.

cuso4+2naoh==cu(oh)2↓+na2so4

fecl3+3naoh==fe(oh)3↓+3nacl

ca(oh)2+na2co3==caco3↓+2naoh

naoh+nh4cl==nacl+nh3↑+h2o

mgcl2+2naoh==mg(oh)2↓+2nacl fe2(so4)3+3ba(oh)2=3baso4↓+2fe(oh)3↓

Chemical-compulsory di-halogen substitution reaction.

Displacement reaction equation: zinc and dilute sulfuric acid reaction: zn+h2so4===znso4+h2; Magnesium and dilute sulfuric acid reaction:

mg+h2so4===mgso4+h2↑；Reaction of aluminum and dilute sulfuric acid: 2Al+3H2SO4===Al2(SO4)3+3H2, etc.

(1) Metal element + acid --- salt + hydrogen (displacement reaction).

1. Zinc and dilute hydrochloric acid reaction: Zn+2HCl===ZnCl2+H2.

2. Magnesium and dilute hydrochloric acid reaction: mg+2HCl===mgCl2+H2.

3. Reaction of aluminum and dilute hydrochloric acid: 2Al+6HCl===2AlCl3+3H2.

4. Reaction of iron and dilute hydrochloric acid: Fe+2HCl===FeCl2+H2.

5. Reaction of iron and dilute sulfuric acid: Fe+H2SO4===FeSO4+H2.

(2) Elemental metal + salt (solution) - another metal + another salt

1. Iron reacts with copper sulfate: Fe+CuSo4==Cu+FeSo4. Phenomenon: The surface of the iron bar is covered with a layer of red substance, and the solution changes from blue to light green.

2. Put the zinc sheet into the copper sulfate solution: CuSO4+ZN==ZNSO4+CU. Phenomenon: The surface of the zinc sheet is covered with a layer of red substance, and the solution turns from blue to colorless.

3. Put the copper sheet into the silver nitrate solution: 2AGnO3+Cu==Cu(NO3)2+2AG. Phenomenon: The surface of the copper sheet is covered with a layer of silvery-white substance, and the solution changes from colorless to blue.

(c) Metal oxides, charcoal or hydrogen, metals, carbon dioxide or water

1. Coke reduced iron oxide: 3C+2Fe2O34Fe+3CO2 smelting metal.

2. Charcoal reduction copper oxide: C+2CuO2Cu+CO2 smelting metal. Phenomenon: The black powder does not turn red, and the clarified lime water becomes turbid.

3. Hydrogen reduction copper oxide: H2 + CuoCu + H2O. Phenomenon: The black powder turns red, and water beads form on the inner wall of the test tube.

4. Hydrogen reaction with iron oxide: Fe2O3 + 3H22Fe + 3H2O.

5. Preparation method of water vapor passing through the hot carbon layer: H2O + CH2 + CO water gas.

Displacement reactions, also known as single displacement reactions, are a common type in chemical reactions. It refers to a chemical reaction in which elements (usually metals or halogens) in two compounds exchange places to produce two new compounds. The displacement reaction can often be described by the following characteristics:

Exchange position: In a displacement reaction, the exchange of the location of the elements in two compounds. For example, metal ions in one compound exchange positions with non-metal ions in another compound.

Reaction type: Displacement reactions include two types: cation displacement and anion substitution.

Cation displacement: In cation replacement, one cation leaves one compound while another cation enters the compound. For example: a+bc ac+b

Anion displacement: In anion displacement, one anion leaves a compound while another anion enters the compound. For example: a+bc ba+c

Chemical formula: In a displacement reaction, the way the atoms in a compound are combined is changed to produce two new compounds. Therefore, the chemical formula before and after the reaction will be different.

Reaction conditions: Appropriate reaction conditions, such as temperature, pressure, solvent, etc., are usually required for the displacement reaction to be carried out. Some displacement reactions may require the involvement of external energy or catalysts.

Reaction rate: The rate of the displacement reaction may depend on factors such as the nature of the reactant, its concentration, and the conditions of the anti-early response.

Example displacement reaction equation:

Cation replacement: CuSO4 + ZN ZNSO4 + Cu

Anion replacement: agno3 + nacl agcl + nano3

It should be noted that the displacement reaction is a type of chemical reaction, and other types of reactions also include synthesis reactions, decomposition reactions, double substitution reactions, etc. When writing and solving chemical equations, it is important to correctly identify the type of reaction and the conditions of the reaction.

1. Displacement reaction equation: The displacement reaction can be expressed as a+bc=b+ac or ab+c=ac+b.

2. Definition of displacement reaction: the reaction of one element and one compound to generate another element and another compound.

3. Characteristics: The characteristics of the displacement reaction are that there are elemental substances in the reactants and products. e.g. cuo + co = cu + co?

Although one of the products is elemental and the other is a compound, since both of the substances in the reactant are compounds and do not meet the definition, the reaction is not a displacement reaction.

1. Zinc and dilute sulfuric acid reaction: Zn + H2SO4 = = = ZnSO4 + H2 2, magnesium and dilute sulfuric acid reaction: mg + H2SO4 = = = mg SO4 + H2 3, aluminum and dilute sulfuric acid reaction:

2al+3h2so4===al2(so4)3+3h2↑

4. Zinc and dilute hydrochloric acid reaction: Zn + 2HCl = = = ZnCl2 + H2 5. Magnesium and dilute hydrochloric acid reaction: mg + 2HCl = = = MgCl2 + H2 6. Reaction between aluminum and dilute hydrochloric acid

2Al+6HCl===2ALCL3+3H2 7, iron and dilute hydrochloric acid reaction: Fe+2HCl===FeCl2+H2 8, iron and dilute sulfuric acid reaction: Fe+H2SO4===FeSO4+H2